! function (t) {
var e = {};
function i(r) {
if (e[r]) return e[r].exports;
var n = e[r] = {
i: r,
l: !1,
exports: {}
};
return t[r].call(n.exports, n, n.exports, i), n.l = !0, n.exports
}
i.m = t, i.c = e, i.d = function (t, e, r) {
i.o(t, e) || Object.defineProperty(t, e, {
enumerable: !0,
get: r
})
}, i.r = function (t) {
"undefined" != typeof Symbol && Symbol.toStringTag && Object.defineProperty(t, Symbol.toStringTag, {
value: "Module"
}), Object.defineProperty(t, "__esModule", {
value: !0
})
}, i.t = function (t, e) {
if (1 & e && (t = i(t)), 8 & e) return t;
if (4 & e && "object" == typeof t && t && t.__esModule) return t;
var r = Object.create(null);
if (i.r(r), Object.defineProperty(r, "default", {
enumerable: !0,
value: t
}), 2 & e && "string" != typeof t)
for (var n in t) i.d(r, n, function (e) {
return t[e]
}.bind(null, n));
return r
}, i.n = function (t) {
var e = t && t.__esModule ? function () {
return t.default
} : function () {
return t
};
return i.d(e, "a", e), e
}, i.o = function (t, e) {
return Object.prototype.hasOwnProperty.call(t, e)
}, i.p = "dist/static", i(i.s = 4)
}([function (t, e, i) {
"use strict";
(function (t, r) {
i.d(e, "k", function () {
return n
}), i.d(e, "m", function () {
return a
}), i.d(e, "l", function () {
return s
}), i.d(e, "i", function () {
return l
}), i.d(e, "a", function () {
return u
}), i.d(e, "b", function () {
return h
}), i.d(e, "c", function () {
return c
}), i.d(e, "d", function () {
return f
}), i.d(e, "e", function () {
return d
}), i.d(e, "f", function () {
return p
}), i.d(e, "g", function () {
return m
}), i.d(e, "h", function () {
return _
}), i.d(e, "j", function () {
return g
});
/*!
* VERSION: 2.1.3
* DATE: 2019-05-17
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
*/
var n = "undefined" != typeof window ? window : void 0 !== t && t.exports && void 0 !== r ? r : {},
s = function (t) {
var e = {},
i = t.document,
r = t.GreenSockGlobals = t.GreenSockGlobals || t;
if (r.TweenLite) return r.TweenLite;
var n, s, a, o, l, u = function (t) {
var e, i = t.split("."),
n = r;
for (e = 0; e < i.length; e++) n[i[e]] = n = n[i[e]] || {};
return n
},
h = u("com.greensock"),
c = function (t) {
var e, i = [],
r = t.length;
for (e = 0; e !== r; i.push(t[e++]));
return i
},
f = function () { },
d = function () {
var t = Object.prototype.toString,
e = t.call([]);
return function (i) {
return null != i && (i instanceof Array || "object" == typeof i && !!i.push && t.call(i) === e)
}
}(),
p = {},
m = function (t, i, n, s) {
this.sc = p[t] ? p[t].sc : [], p[t] = this, this.gsClass = null, this.func = n;
var a = [];
this.check = function (o) {
for (var l, h, c, f, d = i.length, _ = d; --d > -1;)(l = p[i[d]] || new m(i[d], [])).gsClass ? (a[d] = l.gsClass, _--) : o && l.sc.push(this);
if (0 === _ && n)
for (c = (h = ("com.greensock." + t).split(".")).pop(), f = u(h.join("."))[c] = this.gsClass = n.apply(n, a), s && (r[c] = e[c] = f), d = 0; d < this.sc.length; d++) this.sc[d].check()
}, this.check(!0)
},
_ = t._gsDefine = function (t, e, i, r) {
return new m(t, e, i, r)
},
g = h._class = function (t, e, i) {
return e = e || function () { }, _(t, [], function () {
return e
}, i), e
};
_.globals = r;
var v = [0, 0, 1, 1],
y = g("easing.Ease", function (t, e, i, r) {
this._func = t, this._type = i || 0, this._power = r || 0, this._params = e ? v.concat(e) : v
}, !0),
b = y.map = {},
w = y.register = function (t, e, i, r) {
for (var n, s, a, o, l = e.split(","), u = l.length, c = (i || "easeIn,easeOut,easeInOut").split(","); --u > -1;)
for (s = l[u], n = r ? g("easing." + s, null, !0) : h.easing[s] || {}, a = c.length; --a > -1;) o = c[a], b[s + "." + o] = b[o + s] = n[o] = t.getRatio ? t : t[o] || new t
};
for ((a = y.prototype)._calcEnd = !1, a.getRatio = function (t) {
if (this._func) return this._params[0] = t, this._func.apply(null, this._params);
var e = this._type,
i = this._power,
r = 1 === e ? 1 - t : 2 === e ? t : t < .5 ? 2 * t : 2 * (1 - t);
return 1 === i ? r *= r : 2 === i ? r *= r * r : 3 === i ? r *= r * r * r : 4 === i && (r *= r * r * r * r), 1 === e ? 1 - r : 2 === e ? r : t < .5 ? r / 2 : 1 - r / 2
}, s = (n = ["Linear", "Quad", "Cubic", "Quart", "Quint,Strong"]).length; --s > -1;) a = n[s] + ",Power" + s, w(new y(null, null, 1, s), a, "easeOut", !0), w(new y(null, null, 2, s), a, "easeIn" + (0 === s ? ",easeNone" : "")), w(new y(null, null, 3, s), a, "easeInOut");
b.linear = h.easing.Linear.easeIn, b.swing = h.easing.Quad.easeInOut;
var x = g("events.EventDispatcher", function (t) {
this._listeners = {}, this._eventTarget = t || this
});
(a = x.prototype).addEventListener = function (t, e, i, r, n) {
n = n || 0;
var s, a, u = this._listeners[t],
h = 0;
for (this !== o || l || o.wake(), null == u && (this._listeners[t] = u = []), a = u.length; --a > -1;)(s = u[a]).c === e && s.s === i ? u.splice(a, 1) : 0 === h && s.pr < n && (h = a + 1);
u.splice(h, 0, {
c: e,
s: i,
up: r,
pr: n
})
}, a.removeEventListener = function (t, e) {
var i, r = this._listeners[t];
if (r)
for (i = r.length; --i > -1;)
if (r[i].c === e) return void r.splice(i, 1)
}, a.dispatchEvent = function (t) {
var e, i, r, n = this._listeners[t];
if (n)
for ((e = n.length) > 1 && (n = n.slice(0)), i = this._eventTarget; --e > -1;)(r = n[e]) && (r.up ? r.c.call(r.s || i, {
type: t,
target: i
}) : r.c.call(r.s || i))
};
var T = t.requestAnimationFrame,
k = t.cancelAnimationFrame,
P = Date.now || function () {
return (new Date).getTime()
},
O = P();
for (s = (n = ["ms", "moz", "webkit", "o"]).length; --s > -1 && !T;) T = t[n[s] + "RequestAnimationFrame"], k = t[n[s] + "CancelAnimationFrame"] || t[n[s] + "CancelRequestAnimationFrame"];
g("Ticker", function (t, e) {
var r, n, s, a, u, h = this,
c = P(),
d = !(!1 === e || !T) && "auto",
p = 500,
m = 33,
_ = function (t) {
var e, i, o = P() - O;
o > p && (c += o - m), O += o, h.time = (O - c) / 1e3, e = h.time - u, (!r || e > 0 || !0 === t) && (h.frame++, u += e + (e >= a ? .004 : a - e), i = !0), !0 !== t && (s = n(_)), i && h.dispatchEvent("tick")
};
x.call(h), h.time = h.frame = 0, h.tick = function () {
_(!0)
}, h.lagSmoothing = function (t, e) {
if (!arguments.length) return p < 1e8;
p = t || 1e8, m = Math.min(e, p, 0)
}, h.sleep = function () {
null != s && (d && k ? k(s) : clearTimeout(s), n = f, s = null, h === o && (l = !1))
}, h.wake = function (t) {
null !== s ? h.sleep() : t ? c += -O + (O = P()) : h.frame > 10 && (O = P() - p + 5), n = 0 === r ? f : d && T ? T : function (t) {
return setTimeout(t, 1e3 * (u - h.time) + 1 | 0)
}, h === o && (l = !0), _(2)
}, h.fps = function (t) {
if (!arguments.length) return r;
a = 1 / ((r = t) || 60), u = this.time + a, h.wake()
}, h.useRAF = function (t) {
if (!arguments.length) return d;
h.sleep(), d = t, h.fps(r)
}, h.fps(t), setTimeout(function () {
"auto" === d && h.frame < 5 && "hidden" !== (i || {}).visibilityState && h.useRAF(!1)
}, 1500)
}), (a = h.Ticker.prototype = new h.events.EventDispatcher).constructor = h.Ticker;
var S = g("core.Animation", function (t, e) {
if (this.vars = e = e || {}, this._duration = this._totalDuration = t || 0, this._delay = Number(e.delay) || 0, this._timeScale = 1, this._active = !!e.immediateRender, this.data = e.data, this._reversed = !!e.reversed, Z) {
l || o.wake();
var i = this.vars.useFrames ? W : Z;
i.add(this, i._time), this.vars.paused && this.paused(!0)
}
});
o = S.ticker = new h.Ticker, (a = S.prototype)._dirty = a._gc = a._initted = a._paused = !1, a._totalTime = a._time = 0, a._rawPrevTime = -1, a._next = a._last = a._onUpdate = a._timeline = a.timeline = null, a._paused = !1;
var C = function () {
l && P() - O > 2e3 && ("hidden" !== (i || {}).visibilityState || !o.lagSmoothing()) && o.wake();
var t = setTimeout(C, 2e3);
t.unref && t.unref()
};
C(), a.play = function (t, e) {
return null != t && this.seek(t, e), this.reversed(!1).paused(!1)
}, a.pause = function (t, e) {
return null != t && this.seek(t, e), this.paused(!0)
}, a.resume = function (t, e) {
return null != t && this.seek(t, e), this.paused(!1)
}, a.seek = function (t, e) {
return this.totalTime(Number(t), !1 !== e)
}, a.restart = function (t, e) {
return this.reversed(!1).paused(!1).totalTime(t ? -this._delay : 0, !1 !== e, !0)
}, a.reverse = function (t, e) {
return null != t && this.seek(t || this.totalDuration(), e), this.reversed(!0).paused(!1)
}, a.render = function (t, e, i) { }, a.invalidate = function () {
return this._time = this._totalTime = 0, this._initted = this._gc = !1, this._rawPrevTime = -1, !this._gc && this.timeline || this._enabled(!0), this
}, a.isActive = function () {
var t, e = this._timeline,
i = this._startTime;
return !e || !this._gc && !this._paused && e.isActive() && (t = e.rawTime(!0)) >= i && t < i + this.totalDuration() / this._timeScale - 1e-8
}, a._enabled = function (t, e) {
return l || o.wake(), this._gc = !t, this._active = this.isActive(), !0 !== e && (t && !this.timeline ? this._timeline.add(this, this._startTime - this._delay) : !t && this.timeline && this._timeline._remove(this, !0)), !1
}, a._kill = function (t, e) {
return this._enabled(!1, !1)
}, a.kill = function (t, e) {
return this._kill(t, e), this
}, a._uncache = function (t) {
for (var e = t ? this : this.timeline; e;) e._dirty = !0, e = e.timeline;
return this
}, a._swapSelfInParams = function (t) {
for (var e = t.length, i = t.concat(); --e > -1;) "{self}" === t[e] && (i[e] = this);
return i
}, a._callback = function (t) {
var e = this.vars,
i = e[t],
r = e[t + "Params"],
n = e[t + "Scope"] || e.callbackScope || this;
switch (r ? r.length : 0) {
case 0:
i.call(n);
break;
case 1:
i.call(n, r[0]);
break;
case 2:
i.call(n, r[0], r[1]);
break;
default:
i.apply(n, r)
}
}, a.eventCallback = function (t, e, i, r) {
if ("on" === (t || "").substr(0, 2)) {
var n = this.vars;
if (1 === arguments.length) return n[t];
null == e ? delete n[t] : (n[t] = e, n[t + "Params"] = d(i) && -1 !== i.join("").indexOf("{self}") ? this._swapSelfInParams(i) : i, n[t + "Scope"] = r), "onUpdate" === t && (this._onUpdate = e)
}
return this
}, a.delay = function (t) {
return arguments.length ? (this._timeline.smoothChildTiming && this.startTime(this._startTime + t - this._delay), this._delay = t, this) : this._delay
}, a.duration = function (t) {
return arguments.length ? (this._duration = this._totalDuration = t, this._uncache(!0), this._timeline.smoothChildTiming && this._time > 0 && this._time < this._duration && 0 !== t && this.totalTime(this._totalTime * (t / this._duration), !0), this) : (this._dirty = !1, this._duration)
}, a.totalDuration = function (t) {
return this._dirty = !1, arguments.length ? this.duration(t) : this._totalDuration
}, a.time = function (t, e) {
return arguments.length ? (this._dirty && this.totalDuration(), this.totalTime(t > this._duration ? this._duration : t, e)) : this._time
}, a.totalTime = function (t, e, i) {
if (l || o.wake(), !arguments.length) return this._totalTime;
if (this._timeline) {
if (t < 0 && !i && (t += this.totalDuration()), this._timeline.smoothChildTiming) {
this._dirty && this.totalDuration();
var r = this._totalDuration,
n = this._timeline;
if (t > r && !i && (t = r), this._startTime = (this._paused ? this._pauseTime : n._time) - (this._reversed ? r - t : t) / this._timeScale, n._dirty || this._uncache(!1), n._timeline)
for (; n._timeline;) n._timeline._time !== (n._startTime + n._totalTime) / n._timeScale && n.totalTime(n._totalTime, !0), n = n._timeline
}
this._gc && this._enabled(!0, !1), this._totalTime === t && 0 !== this._duration || (I.length && H(), this.render(t, e, !1), I.length && H())
}
return this
}, a.progress = a.totalProgress = function (t, e) {
var i = this.duration();
return arguments.length ? this.totalTime(i * t, e) : i ? this._time / i : this.ratio
}, a.startTime = function (t) {
return arguments.length ? (t !== this._startTime && (this._startTime = t, this.timeline && this.timeline._sortChildren && this.timeline.add(this, t - this._delay)), this) : this._startTime
}, a.endTime = function (t) {
return this._startTime + (0 != t ? this.totalDuration() : this.duration()) / this._timeScale
}, a.timeScale = function (t) {
if (!arguments.length) return this._timeScale;
var e, i;
for (t = t || 1e-8, this._timeline && this._timeline.smoothChildTiming && (i = (e = this._pauseTime) || 0 === e ? e : this._timeline.totalTime(), this._startTime = i - (i - this._startTime) * this._timeScale / t), this._timeScale = t, i = this.timeline; i && i.timeline;) i._dirty = !0, i.totalDuration(), i = i.timeline;
return this
}, a.reversed = function (t) {
return arguments.length ? (t != this._reversed && (this._reversed = t, this.totalTime(this._timeline && !this._timeline.smoothChildTiming ? this.totalDuration() - this._totalTime : this._totalTime, !0)), this) : this._reversed
}, a.paused = function (t) {
if (!arguments.length) return this._paused;
var e, i, r = this._timeline;
return t != this._paused && r && (l || t || o.wake(), i = (e = r.rawTime()) - this._pauseTime, !t && r.smoothChildTiming && (this._startTime += i, this._uncache(!1)), this._pauseTime = t ? e : null, this._paused = t, this._active = this.isActive(), !t && 0 !== i && this._initted && this.duration() && (e = r.smoothChildTiming ? this._totalTime : (e - this._startTime) / this._timeScale, this.render(e, e === this._totalTime, !0))), this._gc && !t && this._enabled(!0, !1), this
};
var A = g("core.SimpleTimeline", function (t) {
S.call(this, 0, t), this.autoRemoveChildren = this.smoothChildTiming = !0
});
(a = A.prototype = new S).constructor = A, a.kill()._gc = !1, a._first = a._last = a._recent = null, a._sortChildren = !1, a.add = a.insert = function (t, e, i, r) {
var n, s;
if (t._startTime = Number(e || 0) + t._delay, t._paused && this !== t._timeline && (t._pauseTime = this.rawTime() - (t._timeline.rawTime() - t._pauseTime)), t.timeline && t.timeline._remove(t, !0), t.timeline = t._timeline = this, t._gc && t._enabled(!0, !0), n = this._last, this._sortChildren)
for (s = t._startTime; n && n._startTime > s;) n = n._prev;
return n ? (t._next = n._next, n._next = t) : (t._next = this._first, this._first = t), t._next ? t._next._prev = t : this._last = t, t._prev = n, this._recent = t, this._timeline && this._uncache(!0), this
}, a._remove = function (t, e) {
return t.timeline === this && (e || t._enabled(!1, !0), t._prev ? t._prev._next = t._next : this._first === t && (this._first = t._next), t._next ? t._next._prev = t._prev : this._last === t && (this._last = t._prev), t._next = t._prev = t.timeline = null, t === this._recent && (this._recent = this._last), this._timeline && this._uncache(!0)), this
}, a.render = function (t, e, i) {
var r, n = this._first;
for (this._totalTime = this._time = this._rawPrevTime = t; n;) r = n._next, (n._active || t >= n._startTime && !n._paused && !n._gc) && (n._reversed ? n.render((n._dirty ? n.totalDuration() : n._totalDuration) - (t - n._startTime) * n._timeScale, e, i) : n.render((t - n._startTime) * n._timeScale, e, i)), n = r
}, a.rawTime = function () {
return l || o.wake(), this._totalTime
};
var R = g("TweenLite", function (e, i, r) {
if (S.call(this, i, r), this.render = R.prototype.render, null == e) throw "Cannot tween a null target.";
this.target = e = "string" != typeof e ? e : R.selector(e) || e;
var n, s, a, o = e.jquery || e.length && e !== t && e[0] && (e[0] === t || e[0].nodeType && e[0].style && !e.nodeType),
l = this.vars.overwrite;
if (this._overwrite = l = null == l ? q[R.defaultOverwrite] : "number" == typeof l ? l >> 0 : q[l], (o || e instanceof Array || e.push && d(e)) && "number" != typeof e[0])
for (this._targets = a = c(e), this._propLookup = [], this._siblings = [], n = 0; n < a.length; n++)(s = a[n]) ? "string" != typeof s ? s.length && s !== t && s[0] && (s[0] === t || s[0].nodeType && s[0].style && !s.nodeType) ? (a.splice(n--, 1), this._targets = a = a.concat(c(s))) : (this._siblings[n] = $(s, this, !1), 1 === l && this._siblings[n].length > 1 && J(s, this, null, 1, this._siblings[n])) : "string" == typeof (s = a[n--] = R.selector(s)) && a.splice(n + 1, 1) : a.splice(n--, 1);
else this._propLookup = {}, this._siblings = $(e, this, !1), 1 === l && this._siblings.length > 1 && J(e, this, null, 1, this._siblings);
(this.vars.immediateRender || 0 === i && 0 === this._delay && !1 !== this.vars.immediateRender) && (this._time = -1e-8, this.render(Math.min(0, -this._delay)))
}, !0),
M = function (e) {
return e && e.length && e !== t && e[0] && (e[0] === t || e[0].nodeType && e[0].style && !e.nodeType)
};
(a = R.prototype = new S).constructor = R, a.kill()._gc = !1, a.ratio = 0, a._firstPT = a._targets = a._overwrittenProps = a._startAt = null, a._notifyPluginsOfEnabled = a._lazy = !1, R.version = "2.1.3", R.defaultEase = a._ease = new y(null, null, 1, 1), R.defaultOverwrite = "auto", R.ticker = o, R.autoSleep = 120, R.lagSmoothing = function (t, e) {
o.lagSmoothing(t, e)
}, R.selector = t.$ || t.jQuery || function (e) {
var r = t.$ || t.jQuery;
return r ? (R.selector = r, r(e)) : (i || (i = t.document), i ? i.querySelectorAll ? i.querySelectorAll(e) : i.getElementById("#" === e.charAt(0) ? e.substr(1) : e) : e)
};
var I = [],
L = {},
E = /(?:(-|-=|\+=)?\d*\.?\d*(?:e[\-+]?\d+)?)[0-9]/gi,
D = /[\+-]=-?[\.\d]/,
j = function (t) {
for (var e, i = this._firstPT; i;) e = i.blob ? 1 === t && null != this.end ? this.end : t ? this.join("") : this.start : i.c * t + i.s, i.m ? e = i.m.call(this._tween, e, this._target || i.t, this._tween) : e < 1e-6 && e > -1e-6 && !i.blob && (e = 0), i.f ? i.fp ? i.t[i.p](i.fp, e) : i.t[i.p](e) : i.t[i.p] = e, i = i._next
},
z = function (t) {
return (1e3 * t | 0) / 1e3 + ""
},
F = function (t, e, i, r) {
var n, s, a, o, l, u, h, c = [],
f = 0,
d = "",
p = 0;
for (c.start = t, c.end = e, t = c[0] = t + "", e = c[1] = e + "", i && (i(c), t = c[0], e = c[1]), c.length = 0, n = t.match(E) || [], s = e.match(E) || [], r && (r._next = null, r.blob = 1, c._firstPT = c._applyPT = r), l = s.length, o = 0; o < l; o++) h = s[o], d += (u = e.substr(f, e.indexOf(h, f) - f)) || !o ? u : ",", f += u.length, p ? p = (p + 1) % 5 : "rgba(" === u.substr(-5) && (p = 1), h === n[o] || n.length <= o ? d += h : (d && (c.push(d), d = ""), a = parseFloat(n[o]), c.push(a), c._firstPT = {
_next: c._firstPT,
t: c,
p: c.length - 1,
s: a,
c: ("=" === h.charAt(1) ? parseInt(h.charAt(0) + "1", 10) * parseFloat(h.substr(2)) : parseFloat(h) - a) || 0,
f: 0,
m: p && p < 4 ? Math.round : z
}), f += h.length;
return (d += e.substr(f)) && c.push(d), c.setRatio = j, D.test(e) && (c.end = null), c
},
N = function (t, e, i, r, n, s, a, o, l) {
"function" == typeof r && (r = r(l || 0, t));
var u = typeof t[e],
h = "function" !== u ? "" : e.indexOf("set") || "function" != typeof t["get" + e.substr(3)] ? e : "get" + e.substr(3),
c = "get" !== i ? i : h ? a ? t[h](a) : t[h]() : t[e],
f = "string" == typeof r && "=" === r.charAt(1),
d = {
t: t,
p: e,
s: c,
f: "function" === u,
pg: 0,
n: n || e,
m: s ? "function" == typeof s ? s : Math.round : 0,
pr: 0,
c: f ? parseInt(r.charAt(0) + "1", 10) * parseFloat(r.substr(2)) : parseFloat(r) - c || 0
};
if (("number" != typeof c || "number" != typeof r && !f) && (a || isNaN(c) || !f && isNaN(r) || "boolean" == typeof c || "boolean" == typeof r ? (d.fp = a, d = {
t: F(c, f ? parseFloat(d.s) + d.c + (d.s + "").replace(/[0-9\-\.]/g, "") : r, o || R.defaultStringFilter, d),
p: "setRatio",
s: 0,
c: 1,
f: 2,
pg: 0,
n: n || e,
pr: 0,
m: 0
}) : (d.s = parseFloat(c), f || (d.c = parseFloat(r) - d.s || 0))), d.c) return (d._next = this._firstPT) && (d._next._prev = d), this._firstPT = d, d
},
X = R._internals = {
isArray: d,
isSelector: M,
lazyTweens: I,
blobDif: F
},
B = R._plugins = {},
Y = X.tweenLookup = {},
U = 0,
V = X.reservedProps = {
ease: 1,
delay: 1,
overwrite: 1,
onComplete: 1,
onCompleteParams: 1,
onCompleteScope: 1,
useFrames: 1,
runBackwards: 1,
startAt: 1,
onUpdate: 1,
onUpdateParams: 1,
onUpdateScope: 1,
onStart: 1,
onStartParams: 1,
onStartScope: 1,
onReverseComplete: 1,
onReverseCompleteParams: 1,
onReverseCompleteScope: 1,
onRepeat: 1,
onRepeatParams: 1,
onRepeatScope: 1,
easeParams: 1,
yoyo: 1,
immediateRender: 1,
repeat: 1,
repeatDelay: 1,
data: 1,
paused: 1,
reversed: 1,
autoCSS: 1,
lazy: 1,
onOverwrite: 1,
callbackScope: 1,
stringFilter: 1,
id: 1,
yoyoEase: 1,
stagger: 1
},
q = {
none: 0,
all: 1,
auto: 2,
concurrent: 3,
allOnStart: 4,
preexisting: 5,
true: 1,
false: 0
},
W = S._rootFramesTimeline = new A,
Z = S._rootTimeline = new A,
G = 30,
H = X.lazyRender = function () {
var t, e, i = I.length;
for (L = {}, t = 0; t < i; t++)(e = I[t]) && !1 !== e._lazy && (e.render(e._lazy[0], e._lazy[1], !0), e._lazy = !1);
I.length = 0
};
Z._startTime = o.time, W._startTime = o.frame, Z._active = W._active = !0, setTimeout(H, 1), S._updateRoot = R.render = function () {
var t, e, i;
if (I.length && H(), Z.render((o.time - Z._startTime) * Z._timeScale, !1, !1), W.render((o.frame - W._startTime) * W._timeScale, !1, !1), I.length && H(), o.frame >= G) {
for (i in G = o.frame + (parseInt(R.autoSleep, 10) || 120), Y) {
for (t = (e = Y[i].tweens).length; --t > -1;) e[t]._gc && e.splice(t, 1);
0 === e.length && delete Y[i]
}
if ((!(i = Z._first) || i._paused) && R.autoSleep && !W._first && 1 === o._listeners.tick.length) {
for (; i && i._paused;) i = i._next;
i || o.sleep()
}
}
}, o.addEventListener("tick", S._updateRoot);
var $ = function (t, e, i) {
var r, n, s = t._gsTweenID;
if (Y[s || (t._gsTweenID = s = "t" + U++)] || (Y[s] = {
target: t,
tweens: []
}), e && ((r = Y[s].tweens)[n = r.length] = e, i))
for (; --n > -1;) r[n] === e && r.splice(n, 1);
return Y[s].tweens
},
Q = function (t, e, i, r) {
var n, s, a = t.vars.onOverwrite;
return a && (n = a(t, e, i, r)), (a = R.onOverwrite) && (s = a(t, e, i, r)), !1 !== n && !1 !== s
},
J = function (t, e, i, r, n) {
var s, a, o, l;
if (1 === r || r >= 4) {
for (l = n.length, s = 0; s < l; s++)
if ((o = n[s]) !== e) o._gc || o._kill(null, t, e) && (a = !0);
else if (5 === r) break;
return a
}
var u, h = e._startTime + 1e-8,
c = [],
f = 0,
d = 0 === e._duration;
for (s = n.length; --s > -1;)(o = n[s]) === e || o._gc || o._paused || (o._timeline !== e._timeline ? (u = u || K(e, 0, d), 0 === K(o, u, d) && (c[f++] = o)) : o._startTime <= h && o._startTime + o.totalDuration() / o._timeScale > h && ((d || !o._initted) && h - o._startTime <= 2e-8 || (c[f++] = o)));
for (s = f; --s > -1;)
if (l = (o = c[s])._firstPT, 2 === r && o._kill(i, t, e) && (a = !0), 2 !== r || !o._firstPT && o._initted && l) {
if (2 !== r && !Q(o, e)) continue;
o._enabled(!1, !1) && (a = !0)
}
return a
},
K = function (t, e, i) {
for (var r = t._timeline, n = r._timeScale, s = t._startTime; r._timeline;) {
if (s += r._startTime, n *= r._timeScale, r._paused) return -100;
r = r._timeline
}
return (s /= n) > e ? s - e : i && s === e || !t._initted && s - e < 2e-8 ? 1e-8 : (s += t.totalDuration() / t._timeScale / n) > e + 1e-8 ? 0 : s - e - 1e-8
};
a._init = function () {
var t, e, i, r, n, s, a = this.vars,
o = this._overwrittenProps,
l = this._duration,
u = !!a.immediateRender,
h = a.ease,
c = this._startAt;
if (a.startAt) {
for (r in c && (c.render(-1, !0), c.kill()), n = {}, a.startAt) n[r] = a.startAt[r];
if (n.data = "isStart", n.overwrite = !1, n.immediateRender = !0, n.lazy = u && !1 !== a.lazy, n.startAt = n.delay = null, n.onUpdate = a.onUpdate, n.onUpdateParams = a.onUpdateParams, n.onUpdateScope = a.onUpdateScope || a.callbackScope || this, this._startAt = R.to(this.target || {}, 0, n), u)
if (this._time > 0) this._startAt = null;
else if (0 !== l) return
} else if (a.runBackwards && 0 !== l)
if (c) c.render(-1, !0), c.kill(), this._startAt = null;
else {
for (r in 0 !== this._time && (u = !1), i = {}, a) V[r] && "autoCSS" !== r || (i[r] = a[r]);
if (i.overwrite = 0, i.data = "isFromStart", i.lazy = u && !1 !== a.lazy, i.immediateRender = u, this._startAt = R.to(this.target, 0, i), u) {
if (0 === this._time) return
} else this._startAt._init(), this._startAt._enabled(!1), this.vars.immediateRender && (this._startAt = null)
}
if (this._ease = h = h ? h instanceof y ? h : "function" == typeof h ? new y(h, a.easeParams) : b[h] || R.defaultEase : R.defaultEase, a.easeParams instanceof Array && h.config && (this._ease = h.config.apply(h, a.easeParams)), this._easeType = this._ease._type, this._easePower = this._ease._power, this._firstPT = null, this._targets)
for (s = this._targets.length, t = 0; t < s; t++) this._initProps(this._targets[t], this._propLookup[t] = {}, this._siblings[t], o ? o[t] : null, t) && (e = !0);
else e = this._initProps(this.target, this._propLookup, this._siblings, o, 0);
if (e && R._onPluginEvent("_onInitAllProps", this), o && (this._firstPT || "function" != typeof this.target && this._enabled(!1, !1)), a.runBackwards)
for (i = this._firstPT; i;) i.s += i.c, i.c = -i.c, i = i._next;
this._onUpdate = a.onUpdate, this._initted = !0
}, a._initProps = function (e, i, r, n, s) {
var a, o, l, u, h, c;
if (null == e) return !1;
for (a in L[e._gsTweenID] && H(), this.vars.css || e.style && e !== t && e.nodeType && B.css && !1 !== this.vars.autoCSS && function (t, e) {
var i, r = {};
for (i in t) V[i] || i in e && "transform" !== i && "x" !== i && "y" !== i && "width" !== i && "height" !== i && "className" !== i && "border" !== i || !(!B[i] || B[i] && B[i]._autoCSS) || (r[i] = t[i], delete t[i]);
t.css = r
}(this.vars, e), this.vars)
if (c = this.vars[a], V[a]) c && (c instanceof Array || c.push && d(c)) && -1 !== c.join("").indexOf("{self}") && (this.vars[a] = c = this._swapSelfInParams(c, this));
else if (B[a] && (u = new B[a])._onInitTween(e, this.vars[a], this, s)) {
for (this._firstPT = h = {
_next: this._firstPT,
t: u,
p: "setRatio",
s: 0,
c: 1,
f: 1,
n: a,
pg: 1,
pr: u._priority,
m: 0
}, o = u._overwriteProps.length; --o > -1;) i[u._overwriteProps[o]] = this._firstPT;
(u._priority || u._onInitAllProps) && (l = !0), (u._onDisable || u._onEnable) && (this._notifyPluginsOfEnabled = !0), h._next && (h._next._prev = h)
} else i[a] = N.call(this, e, a, "get", c, a, 0, null, this.vars.stringFilter, s);
return n && this._kill(n, e) ? this._initProps(e, i, r, n, s) : this._overwrite > 1 && this._firstPT && r.length > 1 && J(e, this, i, this._overwrite, r) ? (this._kill(i, e), this._initProps(e, i, r, n, s)) : (this._firstPT && (!1 !== this.vars.lazy && this._duration || this.vars.lazy && !this._duration) && (L[e._gsTweenID] = !0), l)
}, a.render = function (t, e, i) {
var r, n, s, a, o = this._time,
l = this._duration,
u = this._rawPrevTime;
if (t >= l - 1e-8 && t >= 0) this._totalTime = this._time = l, this.ratio = this._ease._calcEnd ? this._ease.getRatio(1) : 1, this._reversed || (r = !0, n = "onComplete", i = i || this._timeline.autoRemoveChildren), 0 === l && (this._initted || !this.vars.lazy || i) && (this._startTime === this._timeline._duration && (t = 0), (u < 0 || t <= 0 && t >= -1e-8 || 1e-8 === u && "isPause" !== this.data) && u !== t && (i = !0, u > 1e-8 && (n = "onReverseComplete")), this._rawPrevTime = a = !e || t || u === t ? t : 1e-8);
else if (t < 1e-8) this._totalTime = this._time = 0, this.ratio = this._ease._calcEnd ? this._ease.getRatio(0) : 0, (0 !== o || 0 === l && u > 0) && (n = "onReverseComplete", r = this._reversed), t > -1e-8 ? t = 0 : t < 0 && (this._active = !1, 0 === l && (this._initted || !this.vars.lazy || i) && (u >= 0 && (1e-8 !== u || "isPause" !== this.data) && (i = !0), this._rawPrevTime = a = !e || t || u === t ? t : 1e-8)), (!this._initted || this._startAt && this._startAt.progress()) && (i = !0);
else if (this._totalTime = this._time = t, this._easeType) {
var h = t / l,
c = this._easeType,
f = this._easePower;
(1 === c || 3 === c && h >= .5) && (h = 1 - h), 3 === c && (h *= 2), 1 === f ? h *= h : 2 === f ? h *= h * h : 3 === f ? h *= h * h * h : 4 === f && (h *= h * h * h * h), this.ratio = 1 === c ? 1 - h : 2 === c ? h : t / l < .5 ? h / 2 : 1 - h / 2
} else this.ratio = this._ease.getRatio(t / l);
if (this._time !== o || i) {
if (!this._initted) {
if (this._init(), !this._initted || this._gc) return;
if (!i && this._firstPT && (!1 !== this.vars.lazy && this._duration || this.vars.lazy && !this._duration)) return this._time = this._totalTime = o, this._rawPrevTime = u, I.push(this), void (this._lazy = [t, e]);
this._time && !r ? this.ratio = this._ease.getRatio(this._time / l) : r && this._ease._calcEnd && (this.ratio = this._ease.getRatio(0 === this._time ? 0 : 1))
}
for (!1 !== this._lazy && (this._lazy = !1), this._active || !this._paused && this._time !== o && t >= 0 && (this._active = !0), 0 === o && (this._startAt && (t >= 0 ? this._startAt.render(t, !0, i) : n || (n = "_dummyGS")), this.vars.onStart && (0 === this._time && 0 !== l || e || this._callback("onStart"))), s = this._firstPT; s;) s.f ? s.t[s.p](s.c * this.ratio + s.s) : s.t[s.p] = s.c * this.ratio + s.s, s = s._next;
this._onUpdate && (t < 0 && this._startAt && -1e-4 !== t && this._startAt.render(t, !0, i), e || (this._time !== o || r || i) && this._callback("onUpdate")), n && (this._gc && !i || (t < 0 && this._startAt && !this._onUpdate && -1e-4 !== t && this._startAt.render(t, !0, i), r && (this._timeline.autoRemoveChildren && this._enabled(!1, !1), this._active = !1), !e && this.vars[n] && this._callback(n), 0 === l && 1e-8 === this._rawPrevTime && 1e-8 !== a && (this._rawPrevTime = 0)))
}
}, a._kill = function (t, e, i) {
if ("all" === t && (t = null), null == t && (null == e || e === this.target)) return this._lazy = !1, this._enabled(!1, !1);
e = "string" != typeof e ? e || this._targets || this.target : R.selector(e) || e;
var r, n, s, a, o, l, u, h, c, f = i && this._time && i._startTime === this._startTime && this._timeline === i._timeline,
p = this._firstPT;
if ((d(e) || M(e)) && "number" != typeof e[0])
for (r = e.length; --r > -1;) this._kill(t, e[r], i) && (l = !0);
else {
if (this._targets) {
for (r = this._targets.length; --r > -1;)
if (e === this._targets[r]) {
o = this._propLookup[r] || {}, this._overwrittenProps = this._overwrittenProps || [], n = this._overwrittenProps[r] = t ? this._overwrittenProps[r] || {} : "all";
break
}
} else {
if (e !== this.target) return !1;
o = this._propLookup, n = this._overwrittenProps = t ? this._overwrittenProps || {} : "all"
}
if (o) {
if (u = t || o, h = t !== n && "all" !== n && t !== o && ("object" != typeof t || !t._tempKill), i && (R.onOverwrite || this.vars.onOverwrite)) {
for (s in u) o[s] && (c || (c = []), c.push(s));
if ((c || !t) && !Q(this, i, e, c)) return !1
}
for (s in u) (a = o[s]) && (f && (a.f ? a.t[a.p](a.s) : a.t[a.p] = a.s, l = !0), a.pg && a.t._kill(u) && (l = !0), a.pg && 0 !== a.t._overwriteProps.length || (a._prev ? a._prev._next = a._next : a === this._firstPT && (this._firstPT = a._next), a._next && (a._next._prev = a._prev), a._next = a._prev = null), delete o[s]), h && (n[s] = 1);
!this._firstPT && this._initted && p && this._enabled(!1, !1)
}
}
return l
}, a.invalidate = function () {
this._notifyPluginsOfEnabled && R._onPluginEvent("_onDisable", this);
var t = this._time;
return this._firstPT = this._overwrittenProps = this._startAt = this._onUpdate = null, this._notifyPluginsOfEnabled = this._active = this._lazy = !1, this._propLookup = this._targets ? {} : [], S.prototype.invalidate.call(this), this.vars.immediateRender && (this._time = -1e-8, this.render(t, !1, !1 !== this.vars.lazy)), this
}, a._enabled = function (t, e) {
if (l || o.wake(), t && this._gc) {
var i, r = this._targets;
if (r)
for (i = r.length; --i > -1;) this._siblings[i] = $(r[i], this, !0);
else this._siblings = $(this.target, this, !0)
}
return S.prototype._enabled.call(this, t, e), !(!this._notifyPluginsOfEnabled || !this._firstPT) && R._onPluginEvent(t ? "_onEnable" : "_onDisable", this)
}, R.to = function (t, e, i) {
return new R(t, e, i)
}, R.from = function (t, e, i) {
return i.runBackwards = !0, i.immediateRender = 0 != i.immediateRender, new R(t, e, i)
}, R.fromTo = function (t, e, i, r) {
return r.startAt = i, r.immediateRender = 0 != r.immediateRender && 0 != i.immediateRender, new R(t, e, r)
}, R.delayedCall = function (t, e, i, r, n) {
return new R(e, 0, {
delay: t,
onComplete: e,
onCompleteParams: i,
callbackScope: r,
onReverseComplete: e,
onReverseCompleteParams: i,
immediateRender: !1,
lazy: !1,
useFrames: n,
overwrite: 0
})
}, R.set = function (t, e) {
return new R(t, 0, e)
}, R.getTweensOf = function (t, e) {
if (null == t) return [];
var i, r, n, s;
if (t = "string" != typeof t ? t : R.selector(t) || t, (d(t) || M(t)) && "number" != typeof t[0]) {
for (i = t.length, r = []; --i > -1;) r = r.concat(R.getTweensOf(t[i], e));
for (i = r.length; --i > -1;)
for (s = r[i], n = i; --n > -1;) s === r[n] && r.splice(i, 1)
} else if (t._gsTweenID)
for (i = (r = $(t).concat()).length; --i > -1;)(r[i]._gc || e && !r[i].isActive()) && r.splice(i, 1);
return r || []
}, R.killTweensOf = R.killDelayedCallsTo = function (t, e, i) {
"object" == typeof e && (i = e, e = !1);
for (var r = R.getTweensOf(t, e), n = r.length; --n > -1;) r[n]._kill(i, t)
};
var tt = g("plugins.TweenPlugin", function (t, e) {
this._overwriteProps = (t || "").split(","), this._propName = this._overwriteProps[0], this._priority = e || 0, this._super = tt.prototype
}, !0);
if (a = tt.prototype, tt.version = "1.19.0", tt.API = 2, a._firstPT = null, a._addTween = N, a.setRatio = j, a._kill = function (t) {
var e, i = this._overwriteProps,
r = this._firstPT;
if (null != t[this._propName]) this._overwriteProps = [];
else
for (e = i.length; --e > -1;) null != t[i[e]] && i.splice(e, 1);
for (; r;) null != t[r.n] && (r._next && (r._next._prev = r._prev), r._prev ? (r._prev._next = r._next, r._prev = null) : this._firstPT === r && (this._firstPT = r._next)), r = r._next;
return !1
}, a._mod = a._roundProps = function (t) {
for (var e, i = this._firstPT; i;)(e = t[this._propName] || null != i.n && t[i.n.split(this._propName + "_").join("")]) && "function" == typeof e && (2 === i.f ? i.t._applyPT.m = e : i.m = e), i = i._next
}, R._onPluginEvent = function (t, e) {
var i, r, n, s, a, o = e._firstPT;
if ("_onInitAllProps" === t) {
for (; o;) {
for (a = o._next, r = n; r && r.pr > o.pr;) r = r._next;
(o._prev = r ? r._prev : s) ? o._prev._next = o : n = o, (o._next = r) ? r._prev = o : s = o, o = a
}
o = e._firstPT = n
}
for (; o;) o.pg && "function" == typeof o.t[t] && o.t[t]() && (i = !0), o = o._next;
return i
}, tt.activate = function (t) {
for (var e = t.length; --e > -1;) t[e].API === tt.API && (B[(new t[e])._propName] = t[e]);
return !0
}, _.plugin = function (t) {
if (!(t && t.propName && t.init && t.API)) throw "illegal plugin definition.";
var e, i = t.propName,
r = t.priority || 0,
n = t.overwriteProps,
s = {
init: "_onInitTween",
set: "setRatio",
kill: "_kill",
round: "_mod",
mod: "_mod",
initAll: "_onInitAllProps"
},
a = g("plugins." + i.charAt(0).toUpperCase() + i.substr(1) + "Plugin", function () {
tt.call(this, i, r), this._overwriteProps = n || []
}, !0 === t.global),
o = a.prototype = new tt(i);
for (e in o.constructor = a, a.API = t.API, s) "function" == typeof t[e] && (o[s[e]] = t[e]);
return a.version = t.version, tt.activate([a]), a
}, n = t._gsQueue) {
for (s = 0; s < n.length; s++) n[s]();
for (a in p) p[a].func || t.console.log("GSAP encountered missing dependency: " + a)
}
return l = !1, R
}(n),
a = n.GreenSockGlobals,
o = a.com.greensock,
l = o.core.SimpleTimeline,
u = o.core.Animation,
h = a.Ease,
c = a.Linear,
f = c,
d = a.Power1,
p = a.Power2,
m = a.Power3,
_ = a.Power4,
g = a.TweenPlugin;
o.events.EventDispatcher
}).call(this, i(10)(t), i(11))
}, function (t, e, i) {
t.exports = function () {
"use strict";
function t(t, e) {
return t(e = {
exports: {}
}, e.exports), e.exports
}
function e() {
return {
"align-content": !1,
"align-items": !1,
"align-self": !1,
"alignment-adjust": !1,
"alignment-baseline": !1,
all: !1,
"anchor-point": !1,
animation: !1,
"animation-delay": !1,
"animation-direction": !1,
"animation-duration": !1,
"animation-fill-mode": !1,
"animation-iteration-count": !1,
"animation-name": !1,
"animation-play-state": !1,
"animation-timing-function": !1,
azimuth: !1,
"backface-visibility": !1,
background: !0,
"background-attachment": !0,
"background-clip": !0,
"background-color": !0,
"background-image": !0,
"background-origin": !0,
"background-position": !0,
"background-repeat": !0,
"background-size": !0,
"baseline-shift": !1,
binding: !1,
bleed: !1,
"bookmark-label": !1,
"bookmark-level": !1,
"bookmark-state": !1,
border: !0,
"border-bottom": !0,
"border-bottom-color": !0,
"border-bottom-left-radius": !0,
"border-bottom-right-radius": !0,
"border-bottom-style": !0,
"border-bottom-width": !0,
"border-collapse": !0,
"border-color": !0,
"border-image": !0,
"border-image-outset": !0,
"border-image-repeat": !0,
"border-image-slice": !0,
"border-image-source": !0,
"border-image-width": !0,
"border-left": !0,
"border-left-color": !0,
"border-left-style": !0,
"border-left-width": !0,
"border-radius": !0,
"border-right": !0,
"border-right-color": !0,
"border-right-style": !0,
"border-right-width": !0,
"border-spacing": !0,
"border-style": !0,
"border-top": !0,
"border-top-color": !0,
"border-top-left-radius": !0,
"border-top-right-radius": !0,
"border-top-style": !0,
"border-top-width": !0,
"border-width": !0,
bottom: !1,
"box-decoration-break": !0,
"box-shadow": !0,
"box-sizing": !0,
"box-snap": !0,
"box-suppress": !0,
"break-after": !0,
"break-before": !0,
"break-inside": !0,
"caption-side": !1,
chains: !1,
clear: !0,
clip: !1,
"clip-path": !1,
"clip-rule": !1,
color: !0,
"color-interpolation-filters": !0,
"column-count": !1,
"column-fill": !1,
"column-gap": !1,
"column-rule": !1,
"column-rule-color": !1,
"column-rule-style": !1,
"column-rule-width": !1,
"column-span": !1,
"column-width": !1,
columns: !1,
contain: !1,
content: !1,
"counter-increment": !1,
"counter-reset": !1,
"counter-set": !1,
crop: !1,
cue: !1,
"cue-after": !1,
"cue-before": !1,
cursor: !1,
direction: !1,
display: !0,
"display-inside": !0,
"display-list": !0,
"display-outside": !0,
"dominant-baseline": !1,
elevation: !1,
"empty-cells": !1,
filter: !1,
flex: !1,
"flex-basis": !1,
"flex-direction": !1,
"flex-flow": !1,
"flex-grow": !1,
"flex-shrink": !1,
"flex-wrap": !1,
float: !1,
"float-offset": !1,
"flood-color": !1,
"flood-opacity": !1,
"flow-from": !1,
"flow-into": !1,
font: !0,
"font-family": !0,
"font-feature-settings": !0,
"font-kerning": !0,
"font-language-override": !0,
"font-size": !0,
"font-size-adjust": !0,
"font-stretch": !0,
"font-style": !0,
"font-synthesis": !0,
"font-variant": !0,
"font-variant-alternates": !0,
"font-variant-caps": !0,
"font-variant-east-asian": !0,
"font-variant-ligatures": !0,
"font-variant-numeric": !0,
"font-variant-position": !0,
"font-weight": !0,
grid: !1,
"grid-area": !1,
"grid-auto-columns": !1,
"grid-auto-flow": !1,
"grid-auto-rows": !1,
"grid-column": !1,
"grid-column-end": !1,
"grid-column-start": !1,
"grid-row": !1,
"grid-row-end": !1,
"grid-row-start": !1,
"grid-template": !1,
"grid-template-areas": !1,
"grid-template-columns": !1,
"grid-template-rows": !1,
"hanging-punctuation": !1,
height: !0,
hyphens: !1,
icon: !1,
"image-orientation": !1,
"image-resolution": !1,
"ime-mode": !1,
"initial-letters": !1,
"inline-box-align": !1,
"justify-content": !1,
"justify-items": !1,
"justify-self": !1,
left: !1,
"letter-spacing": !0,
"lighting-color": !0,
"line-box-contain": !1,
"line-break": !1,
"line-grid": !1,
"line-height": !1,
"line-snap": !1,
"line-stacking": !1,
"line-stacking-ruby": !1,
"line-stacking-shift": !1,
"line-stacking-strategy": !1,
"list-style": !0,
"list-style-image": !0,
"list-style-position": !0,
"list-style-type": !0,
margin: !0,
"margin-bottom": !0,
"margin-left": !0,
"margin-right": !0,
"margin-top": !0,
"marker-offset": !1,
"marker-side": !1,
marks: !1,
mask: !1,
"mask-box": !1,
"mask-box-outset": !1,
"mask-box-repeat": !1,
"mask-box-slice": !1,
"mask-box-source": !1,
"mask-box-width": !1,
"mask-clip": !1,
"mask-image": !1,
"mask-origin": !1,
"mask-position": !1,
"mask-repeat": !1,
"mask-size": !1,
"mask-source-type": !1,
"mask-type": !1,
"max-height": !0,
"max-lines": !1,
"max-width": !0,
"min-height": !0,
"min-width": !0,
"move-to": !1,
"nav-down": !1,
"nav-index": !1,
"nav-left": !1,
"nav-right": !1,
"nav-up": !1,
"object-fit": !1,
"object-position": !1,
opacity: !1,
order: !1,
orphans: !1,
outline: !1,
"outline-color": !1,
"outline-offset": !1,
"outline-style": !1,
"outline-width": !1,
overflow: !1,
"overflow-wrap": !1,
"overflow-x": !1,
"overflow-y": !1,
padding: !0,
"padding-bottom": !0,
"padding-left": !0,
"padding-right": !0,
"padding-top": !0,
page: !1,
"page-break-after": !1,
"page-break-before": !1,
"page-break-inside": !1,
"page-policy": !1,
pause: !1,
"pause-after": !1,
"pause-before": !1,
perspective: !1,
"perspective-origin": !1,
pitch: !1,
"pitch-range": !1,
"play-during": !1,
position: !1,
"presentation-level": !1,
quotes: !1,
"region-fragment": !1,
resize: !1,
rest: !1,
"rest-after": !1,
"rest-before": !1,
richness: !1,
right: !1,
rotation: !1,
"rotation-point": !1,
"ruby-align": !1,
"ruby-merge": !1,
"ruby-position": !1,
"shape-image-threshold": !1,
"shape-outside": !1,
"shape-margin": !1,
size: !1,
speak: !1,
"speak-as": !1,
"speak-headernav": !1,
"speak-numeral": !1,
"speak-punctuation": !1,
"speech-rate": !1,
stress: !1,
"string-set": !1,
"tab-size": !1,
"table-layout": !1,
"text-align": !0,
"text-align-last": !0,
"text-combine-upright": !0,
"text-decoration": !0,
"text-decoration-color": !0,
"text-decoration-line": !0,
"text-decoration-skip": !0,
"text-decoration-style": !0,
"text-emphasis": !0,
"text-emphasis-color": !0,
"text-emphasis-position": !0,
"text-emphasis-style": !0,
"text-height": !0,
"text-indent": !0,
"text-justify": !0,
"text-orientation": !0,
"text-overflow": !0,
"text-shadow": !0,
"text-space-collapse": !0,
"text-transform": !0,
"text-underline-position": !0,
"text-wrap": !0,
top: !1,
transform: !1,
"transform-origin": !1,
"transform-style": !1,
transition: !1,
"transition-delay": !1,
"transition-duration": !1,
"transition-property": !1,
"transition-timing-function": !1,
"unicode-bidi": !1,
"vertical-align": !1,
visibility: !1,
"voice-balance": !1,
"voice-duration": !1,
"voice-family": !1,
"voice-pitch": !1,
"voice-range": !1,
"voice-rate": !1,
"voice-stress": !1,
"voice-volume": !1,
volume: !1,
"white-space": !1,
widows: !1,
width: !0,
"will-change": !1,
"word-break": !0,
"word-spacing": !0,
"word-wrap": !0,
"wrap-flow": !1,
"wrap-through": !1,
"writing-mode": !1,
"z-index": !1
}
}
var i = /javascript\s*\:/gim,
r = {
whiteList: {
"align-content": !1,
"align-items": !1,
"align-self": !1,
"alignment-adjust": !1,
"alignment-baseline": !1,
all: !1,
"anchor-point": !1,
animation: !1,
"animation-delay": !1,
"animation-direction": !1,
"animation-duration": !1,
"animation-fill-mode": !1,
"animation-iteration-count": !1,
"animation-name": !1,
"animation-play-state": !1,
"animation-timing-function": !1,
azimuth: !1,
"backface-visibility": !1,
background: !0,
"background-attachment": !0,
"background-clip": !0,
"background-color": !0,
"background-image": !0,
"background-origin": !0,
"background-position": !0,
"background-repeat": !0,
"background-size": !0,
"baseline-shift": !1,
binding: !1,
bleed: !1,
"bookmark-label": !1,
"bookmark-level": !1,
"bookmark-state": !1,
border: !0,
"border-bottom": !0,
"border-bottom-color": !0,
"border-bottom-left-radius": !0,
"border-bottom-right-radius": !0,
"border-bottom-style": !0,
"border-bottom-width": !0,
"border-collapse": !0,
"border-color": !0,
"border-image": !0,
"border-image-outset": !0,
"border-image-repeat": !0,
"border-image-slice": !0,
"border-image-source": !0,
"border-image-width": !0,
"border-left": !0,
"border-left-color": !0,
"border-left-style": !0,
"border-left-width": !0,
"border-radius": !0,
"border-right": !0,
"border-right-color": !0,
"border-right-style": !0,
"border-right-width": !0,
"border-spacing": !0,
"border-style": !0,
"border-top": !0,
"border-top-color": !0,
"border-top-left-radius": !0,
"border-top-right-radius": !0,
"border-top-style": !0,
"border-top-width": !0,
"border-width": !0,
bottom: !1,
"box-decoration-break": !0,
"box-shadow": !0,
"box-sizing": !0,
"box-snap": !0,
"box-suppress": !0,
"break-after": !0,
"break-before": !0,
"break-inside": !0,
"caption-side": !1,
chains: !1,
clear: !0,
clip: !1,
"clip-path": !1,
"clip-rule": !1,
color: !0,
"color-interpolation-filters": !0,
"column-count": !1,
"column-fill": !1,
"column-gap": !1,
"column-rule": !1,
"column-rule-color": !1,
"column-rule-style": !1,
"column-rule-width": !1,
"column-span": !1,
"column-width": !1,
columns: !1,
contain: !1,
content: !1,
"counter-increment": !1,
"counter-reset": !1,
"counter-set": !1,
crop: !1,
cue: !1,
"cue-after": !1,
"cue-before": !1,
cursor: !1,
direction: !1,
display: !0,
"display-inside": !0,
"display-list": !0,
"display-outside": !0,
"dominant-baseline": !1,
elevation: !1,
"empty-cells": !1,
filter: !1,
flex: !1,
"flex-basis": !1,
"flex-direction": !1,
"flex-flow": !1,
"flex-grow": !1,
"flex-shrink": !1,
"flex-wrap": !1,
float: !1,
"float-offset": !1,
"flood-color": !1,
"flood-opacity": !1,
"flow-from": !1,
"flow-into": !1,
font: !0,
"font-family": !0,
"font-feature-settings": !0,
"font-kerning": !0,
"font-language-override": !0,
"font-size": !0,
"font-size-adjust": !0,
"font-stretch": !0,
"font-style": !0,
"font-synthesis": !0,
"font-variant": !0,
"font-variant-alternates": !0,
"font-variant-caps": !0,
"font-variant-east-asian": !0,
"font-variant-ligatures": !0,
"font-variant-numeric": !0,
"font-variant-position": !0,
"font-weight": !0,
grid: !1,
"grid-area": !1,
"grid-auto-columns": !1,
"grid-auto-flow": !1,
"grid-auto-rows": !1,
"grid-column": !1,
"grid-column-end": !1,
"grid-column-start": !1,
"grid-row": !1,
"grid-row-end": !1,
"grid-row-start": !1,
"grid-template": !1,
"grid-template-areas": !1,
"grid-template-columns": !1,
"grid-template-rows": !1,
"hanging-punctuation": !1,
height: !0,
hyphens: !1,
icon: !1,
"image-orientation": !1,
"image-resolution": !1,
"ime-mode": !1,
"initial-letters": !1,
"inline-box-align": !1,
"justify-content": !1,
"justify-items": !1,
"justify-self": !1,
left: !1,
"letter-spacing": !0,
"lighting-color": !0,
"line-box-contain": !1,
"line-break": !1,
"line-grid": !1,
"line-height": !1,
"line-snap": !1,
"line-stacking": !1,
"line-stacking-ruby": !1,
"line-stacking-shift": !1,
"line-stacking-strategy": !1,
"list-style": !0,
"list-style-image": !0,
"list-style-position": !0,
"list-style-type": !0,
margin: !0,
"margin-bottom": !0,
"margin-left": !0,
"margin-right": !0,
"margin-top": !0,
"marker-offset": !1,
"marker-side": !1,
marks: !1,
mask: !1,
"mask-box": !1,
"mask-box-outset": !1,
"mask-box-repeat": !1,
"mask-box-slice": !1,
"mask-box-source": !1,
"mask-box-width": !1,
"mask-clip": !1,
"mask-image": !1,
"mask-origin": !1,
"mask-position": !1,
"mask-repeat": !1,
"mask-size": !1,
"mask-source-type": !1,
"mask-type": !1,
"max-height": !0,
"max-lines": !1,
"max-width": !0,
"min-height": !0,
"min-width": !0,
"move-to": !1,
"nav-down": !1,
"nav-index": !1,
"nav-left": !1,
"nav-right": !1,
"nav-up": !1,
"object-fit": !1,
"object-position": !1,
opacity: !1,
order: !1,
orphans: !1,
outline: !1,
"outline-color": !1,
"outline-offset": !1,
"outline-style": !1,
"outline-width": !1,
overflow: !1,
"overflow-wrap": !1,
"overflow-x": !1,
"overflow-y": !1,
padding: !0,
"padding-bottom": !0,
"padding-left": !0,
"padding-right": !0,
"padding-top": !0,
page: !1,
"page-break-after": !1,
"page-break-before": !1,
"page-break-inside": !1,
"page-policy": !1,
pause: !1,
"pause-after": !1,
"pause-before": !1,
perspective: !1,
"perspective-origin": !1,
pitch: !1,
"pitch-range": !1,
"play-during": !1,
position: !1,
"presentation-level": !1,
quotes: !1,
"region-fragment": !1,
resize: !1,
rest: !1,
"rest-after": !1,
"rest-before": !1,
richness: !1,
right: !1,
rotation: !1,
"rotation-point": !1,
"ruby-align": !1,
"ruby-merge": !1,
"ruby-position": !1,
"shape-image-threshold": !1,
"shape-outside": !1,
"shape-margin": !1,
size: !1,
speak: !1,
"speak-as": !1,
"speak-headernav": !1,
"speak-numeral": !1,
"speak-punctuation": !1,
"speech-rate": !1,
stress: !1,
"string-set": !1,
"tab-size": !1,
"table-layout": !1,
"text-align": !0,
"text-align-last": !0,
"text-combine-upright": !0,
"text-decoration": !0,
"text-decoration-color": !0,
"text-decoration-line": !0,
"text-decoration-skip": !0,
"text-decoration-style": !0,
"text-emphasis": !0,
"text-emphasis-color": !0,
"text-emphasis-position": !0,
"text-emphasis-style": !0,
"text-height": !0,
"text-indent": !0,
"text-justify": !0,
"text-orientation": !0,
"text-overflow": !0,
"text-shadow": !0,
"text-space-collapse": !0,
"text-transform": !0,
"text-underline-position": !0,
"text-wrap": !0,
top: !1,
transform: !1,
"transform-origin": !1,
"transform-style": !1,
transition: !1,
"transition-delay": !1,
"transition-duration": !1,
"transition-property": !1,
"transition-timing-function": !1,
"unicode-bidi": !1,
"vertical-align": !1,
visibility: !1,
"voice-balance": !1,
"voice-duration": !1,
"voice-family": !1,
"voice-pitch": !1,
"voice-range": !1,
"voice-rate": !1,
"voice-stress": !1,
"voice-volume": !1,
volume: !1,
"white-space": !1,
widows: !1,
width: !0,
"will-change": !1,
"word-break": !0,
"word-spacing": !0,
"word-wrap": !0,
"wrap-flow": !1,
"wrap-through": !1,
"writing-mode": !1,
"z-index": !1
},
getDefaultWhiteList: e,
onAttr: function (t, e, i) { },
onIgnoreAttr: function (t, e, i) { },
safeAttrValue: function (t, e) {
return i.test(e) ? "" : e
}
},
n = {
indexOf: function (t, e) {
var i, r;
if (Array.prototype.indexOf) return t.indexOf(e);
for (i = 0, r = t.length; i < r; i++)
if (t[i] === e) return i;
return -1
},
forEach: function (t, e, i) {
var r, n;
if (Array.prototype.forEach) return t.forEach(e, i);
for (r = 0, n = t.length; r < n; r++) e.call(i, t[r], r, t)
},
trim: function (t) {
return String.prototype.trim ? t.trim() : t.replace(/(^\s*)|(\s*$)/g, "")
},
trimRight: function (t) {
return String.prototype.trimRight ? t.trimRight() : t.replace(/(\s*$)/g, "")
}
},
s = function (t, e) {
";" !== (t = n.trimRight(t))[t.length - 1] && (t += ";");
var i = t.length,
r = !1,
s = 0,
a = 0,
o = "";
function l() {
if (!r) {
var i = n.trim(t.slice(s, a)),
l = i.indexOf(":");
if (-1 !== l) {
var u = n.trim(i.slice(0, l)),
h = n.trim(i.slice(l + 1));
if (u) {
var c = e(s, o.length, u, h, i);
c && (o += c + "; ")
}
}
}
s = a + 1
}
for (; a < i; a++) {
var u = t[a];
if ("/" === u && "*" === t[a + 1]) {
var h = t.indexOf("*/", a + 2);
if (-1 === h) break;
s = (a = h + 1) + 1, r = !1
} else "(" === u ? r = !0 : ")" === u ? r = !1 : ";" === u ? r || l() : "\n" === u && l()
}
return n.trim(o)
};
function a(t) {
return null == t
}
function o(t) {
(t = function (t) {
var e = {};
for (var i in t) e[i] = t[i];
return e
}(t || {})).whiteList = t.whiteList || r.whiteList, t.onAttr = t.onAttr || r.onAttr, t.onIgnoreAttr = t.onIgnoreAttr || r.onIgnoreAttr, t.safeAttrValue = t.safeAttrValue || r.safeAttrValue, this.options = t
}
o.prototype.process = function (t) {
if (!(t = (t = t || "").toString())) return "";
var e = this.options,
i = e.whiteList,
r = e.onAttr,
n = e.onIgnoreAttr,
o = e.safeAttrValue;
return s(t, function (t, e, s, l, u) {
var h = i[s],
c = !1;
if (!0 === h ? c = h : "function" == typeof h ? c = h(l) : h instanceof RegExp && (c = h.test(l)), !0 !== c && (c = !1), l = o(s, l)) {
var f, d = {
position: e,
sourcePosition: t,
source: u,
isWhite: c
};
return c ? a(f = r(s, l, d)) ? s + ":" + l : f : a(f = n(s, l, d)) ? void 0 : f
}
})
};
var l = o,
u = t(function (t, e) {
for (var i in (e = t.exports = function (t, e) {
return new l(e).process(t)
}).FilterCSS = l, r) e[i] = r[i];
"undefined" != typeof window && (window.filterCSS = t.exports)
}),
h = (u.FilterCSS, {
indexOf: function (t, e) {
var i, r;
if (Array.prototype.indexOf) return t.indexOf(e);
for (i = 0, r = t.length; i < r; i++)
if (t[i] === e) return i;
return -1
},
forEach: function (t, e, i) {
var r, n;
if (Array.prototype.forEach) return t.forEach(e, i);
for (r = 0, n = t.length; r < n; r++) e.call(i, t[r], r, t)
},
trim: function (t) {
return String.prototype.trim ? t.trim() : t.replace(/(^\s*)|(\s*$)/g, "")
},
spaceIndex: function (t) {
var e = /\s|\n|\t/.exec(t);
return e ? e.index : -1
}
}),
c = u.FilterCSS,
f = u.getDefaultWhiteList,
d = new c;
function p(t) {
return t.replace(m, "<").replace(_, ">")
}
var m = /</g,
_ = />/g,
g = /"/g,
v = /"/g,
y = /&#([a-zA-Z0-9]*);?/gim,
b = /:?/gim,
w = /&newline;?/gim,
x = /((j\s*a\s*v\s*a|v\s*b|l\s*i\s*v\s*e)\s*s\s*c\s*r\s*i\s*p\s*t\s*|m\s*o\s*c\s*h\s*a)\:/gi,
T = /e\s*x\s*p\s*r\s*e\s*s\s*s\s*i\s*o\s*n\s*\(.*/gi,
k = /u\s*r\s*l\s*\(.*/gi;
function P(t) {
return t.replace(g, """)
}
function O(t) {
return t.replace(v, '"')
}
function S(t) {
return t.replace(y, function (t, e) {
return "x" === e[0] || "X" === e[0] ? String.fromCharCode(parseInt(e.substr(1), 16)) : String.fromCharCode(parseInt(e, 10))
})
}
function C(t) {
return t.replace(b, ":").replace(w, " ")
}
function A(t) {
for (var e = "", i = 0, r = t.length; i < r; i++) e += t.charCodeAt(i) < 32 ? " " : t.charAt(i);
return h.trim(e)
}
function R(t) {
return t = A(t = C(t = S(t = O(t))))
}
function M(t) {
return t = p(t = P(t))
}
var I = /<!--[\s\S]*?-->/g,
L = {
whiteList: {
a: ["target", "href", "title"],
abbr: ["title"],
address: [],
area: ["shape", "coords", "href", "alt"],
article: [],
aside: [],
audio: ["autoplay", "controls", "loop", "preload", "src"],
b: [],
bdi: ["dir"],
bdo: ["dir"],
big: [],
blockquote: ["cite"],
br: [],
caption: [],
center: [],
cite: [],
code: [],
col: ["align", "valign", "span", "width"],
colgroup: ["align", "valign", "span", "width"],
dd: [],
del: ["datetime"],
details: ["open"],
div: [],
dl: [],
dt: [],
em: [],
font: ["color", "size", "face"],
footer: [],
h1: [],
h2: [],
h3: [],
h4: [],
h5: [],
h6: [],
headernav: [],
hr: [],
i: [],
img: ["src", "alt", "title", "width", "height"],
ins: ["datetime"],
li: [],
mark: [],
nav: [],
ol: [],
p: [],
pre: [],
s: [],
section: [],
small: [],
span: [],
sub: [],
sup: [],
strong: [],
table: ["width", "border", "align", "valign"],
tbody: ["align", "valign"],
td: ["width", "rowspan", "colspan", "align", "valign"],
tfoot: ["align", "valign"],
th: ["width", "rowspan", "colspan", "align", "valign"],
thead: ["align", "valign"],
tr: ["rowspan", "align", "valign"],
tt: [],
u: [],
ul: [],
video: ["autoplay", "controls", "loop", "preload", "src", "height", "width"]
},
getDefaultWhiteList: function () {
return {
a: ["target", "href", "title"],
abbr: ["title"],
address: [],
area: ["shape", "coords", "href", "alt"],
article: [],
aside: [],
audio: ["autoplay", "controls", "loop", "preload", "src"],
b: [],
bdi: ["dir"],
bdo: ["dir"],
big: [],
blockquote: ["cite"],
br: [],
caption: [],
center: [],
cite: [],
code: [],
col: ["align", "valign", "span", "width"],
colgroup: ["align", "valign", "span", "width"],
dd: [],
del: ["datetime"],
details: ["open"],
div: [],
dl: [],
dt: [],
em: [],
font: ["color", "size", "face"],
footer: [],
h1: [],
h2: [],
h3: [],
h4: [],
h5: [],
h6: [],
headernav: [],
hr: [],
i: [],
img: ["src", "alt", "title", "width", "height"],
ins: ["datetime"],
li: [],
mark: [],
nav: [],
ol: [],
p: [],
pre: [],
s: [],
section: [],
small: [],
span: [],
sub: [],
sup: [],
strong: [],
table: ["width", "border", "align", "valign"],
tbody: ["align", "valign"],
td: ["width", "rowspan", "colspan", "align", "valign"],
tfoot: ["align", "valign"],
th: ["width", "rowspan", "colspan", "align", "valign"],
thead: ["align", "valign"],
tr: ["rowspan", "align", "valign"],
tt: [],
u: [],
ul: [],
video: ["autoplay", "controls", "loop", "preload", "src", "height", "width"]
}
},
onTag: function (t, e, i) { },
onIgnoreTag: function (t, e, i) { },
onTagAttr: function (t, e, i) { },
onIgnoreTagAttr: function (t, e, i) { },
safeAttrValue: function (t, e, i, r) {
if (i = R(i), "href" === e || "src" === e) {
if ("#" === (i = h.trim(i))) return "#";
if ("http://" !== i.substr(0, 7) && "https://" !== i.substr(0, 8) && "mailto:" !== i.substr(0, 7) && "tel:" !== i.substr(0, 4) && "data:image/" !== i.substr(0, 11) && "ftp://" !== i.substr(0, 6) && "./" !== i.substr(0, 2) && "../" !== i.substr(0, 3) && "#" !== i[0] && "/" !== i[0]) return ""
} else if ("background" === e) {
if (x.lastIndex = 0, x.test(i)) return ""
} else if ("style" === e) {
if (T.lastIndex = 0, T.test(i)) return "";
if (k.lastIndex = 0, k.test(i) && (x.lastIndex = 0, x.test(i))) return "";
!1 !== r && (i = (r = r || d).process(i))
}
return i = M(i)
},
escapeHtml: p,
escapeQuote: P,
unescapeQuote: O,
escapeHtmlEntities: S,
escapeDangerHtml5Entities: C,
clearNonPrintableCharacter: A,
friendlyAttrValue: R,
escapeAttrValue: M,
onIgnoreTagStripAll: function () {
return ""
},
StripTagBody: function (t, e) {
"function" != typeof e && (e = function () { });
var i = !Array.isArray(t),
r = [],
n = !1;
return {
onIgnoreTag: function (s, a, o) {
if (function (e) {
return !!i || -1 !== h.indexOf(t, e)
}(s)) {
if (o.isClosing) {
var l = "[/removed]",
u = o.position + l.length;
return r.push([!1 !== n ? n : o.position, u]), n = !1, l
}
return n || (n = o.position), "[removed]"
}
return e(s, a, o)
},
remove: function (t) {
var e = "",
i = 0;
return h.forEach(r, function (r) {
e += t.slice(i, r[0]), i = r[1]
}), e += t.slice(i)
}
}
},
stripCommentTag: function (t) {
return t.replace(I, "")
},
stripBlankChar: function (t) {
var e = t.split("");
return (e = e.filter(function (t) {
var e = t.charCodeAt(0);
return !(127 === e || e <= 31 && 10 !== e && 13 !== e)
})).join("")
},
cssFilter: d,
getDefaultCSSWhiteList: f
};
function E(t) {
var e = h.spaceIndex(t);
if (-1 === e) var i = t.slice(1, -1);
else i = t.slice(1, e + 1);
return "/" === (i = h.trim(i).toLowerCase()).slice(0, 1) && (i = i.slice(1)), "/" === i.slice(-1) && (i = i.slice(0, -1)), i
}
function D(t) {
return "</" === t.slice(0, 2)
}
var j = /[^a-zA-Z0-9_:\.\-]/gim;
function z(t, e) {
for (; e < t.length; e++) {
var i = t[e];
if (" " !== i) return "=" === i ? e : -1
}
}
function F(t, e) {
for (; e > 0; e--) {
var i = t[e];
if (" " !== i) return "=" === i ? e : -1
}
}
function N(t) {
return function (t) {
return '"' === t[0] && '"' === t[t.length - 1] || "'" === t[0] && "'" === t[t.length - 1]
}(t) ? t.substr(1, t.length - 2) : t
}
var X = {
parseTag: function (t, e, i) {
var r = "",
n = 0,
s = !1,
a = !1,
o = 0,
l = t.length,
u = "",
h = "";
for (o = 0; o < l; o++) {
var c = t.charAt(o);
if (!1 === s) {
if ("<" === c) {
s = o;
continue
}
} else if (!1 === a) {
if ("<" === c) {
r += i(t.slice(n, o)), s = o, n = o;
continue
}
if (">" === c) {
r += i(t.slice(n, s)), u = E(h = t.slice(s, o + 1)), r += e(s, r.length, u, h, D(h)), n = o + 1, s = !1;
continue
}
if (('"' === c || "'" === c) && "=" === t.charAt(o - 1)) {
a = c;
continue
}
} else if (c === a) {
a = !1;
continue
}
}
return n < t.length && (r += i(t.substr(n))), r
},
parseAttr: function (t, e) {
var i = 0,
r = [],
n = !1,
s = t.length;
function a(t, i) {
if (!((t = (t = h.trim(t)).replace(j, "").toLowerCase()).length < 1)) {
var n = e(t, i || "");
n && r.push(n)
}
}
for (var o = 0; o < s; o++) {
var l, u = t.charAt(o);
if (!1 !== n || "=" !== u)
if (!1 === n || o !== i || '"' !== u && "'" !== u || "=" !== t.charAt(o - 1)) {
if (/\s|\n|\t/.test(u)) {
if (t = t.replace(/\s|\n|\t/g, " "), !1 === n) {
if (-1 === (l = z(t, o))) {
a(h.trim(t.slice(i, o))), n = !1, i = o + 1;
continue
}
o = l - 1;
continue
}
if (-1 === (l = F(t, o - 1))) {
a(n, N(h.trim(t.slice(i, o)))), n = !1, i = o + 1;
continue
}
}
} else {
if (-1 === (l = t.indexOf(u, o + 1))) break;
a(n, h.trim(t.slice(i + 1, l))), n = !1, i = (o = l) + 1
}
else n = t.slice(i, o), i = o + 1
}
return i < t.length && (!1 === n ? a(t.slice(i)) : a(n, N(h.trim(t.slice(i))))), h.trim(r.join(" "))
}
},
B = u.FilterCSS,
Y = X.parseTag,
U = X.parseAttr;
function V(t) {
return null == t
}
function q(t) {
(t = function (t) {
var e = {};
for (var i in t) e[i] = t[i];
return e
}(t || {})).stripIgnoreTag && (t.onIgnoreTag && console.error('Notes: cannot use these two options "stripIgnoreTag" and "onIgnoreTag" at the same time'), t.onIgnoreTag = L.onIgnoreTagStripAll), t.whiteList = t.whiteList || L.whiteList, t.onTag = t.onTag || L.onTag, t.onTagAttr = t.onTagAttr || L.onTagAttr, t.onIgnoreTag = t.onIgnoreTag || L.onIgnoreTag, t.onIgnoreTagAttr = t.onIgnoreTagAttr || L.onIgnoreTagAttr, t.safeAttrValue = t.safeAttrValue || L.safeAttrValue, t.escapeHtml = t.escapeHtml || L.escapeHtml, this.options = t, !1 === t.css ? this.cssFilter = !1 : (t.css = t.css || {}, this.cssFilter = new B(t.css))
}
q.prototype.process = function (t) {
if (!(t = (t = t || "").toString())) return "";
var e = this.options,
i = e.whiteList,
r = e.onTag,
n = e.onIgnoreTag,
s = e.onTagAttr,
a = e.onIgnoreTagAttr,
o = e.safeAttrValue,
l = e.escapeHtml,
u = this.cssFilter;
e.stripBlankChar && (t = L.stripBlankChar(t)), e.allowCommentTag || (t = L.stripCommentTag(t));
var c = !1;
e.stripIgnoreTagBody && (c = L.StripTagBody(e.stripIgnoreTagBody, n), n = c.onIgnoreTag);
var f = Y(t, function (t, e, c, f, d) {
var p, m = {
sourcePosition: t,
position: e,
isClosing: d,
isWhite: i.hasOwnProperty(c)
};
if (!V(p = r(c, f, m))) return p;
if (m.isWhite) {
if (m.isClosing) return "</" + c + ">";
var _ = function (t) {
var e = h.spaceIndex(t);
if (-1 === e) return {
html: "",
closing: "/" === t[t.length - 2]
};
var i = "/" === (t = h.trim(t.slice(e + 1, -1)))[t.length - 1];
return i && (t = h.trim(t.slice(0, -1))), {
html: t,
closing: i
}
}(f),
g = i[c],
v = U(_.html, function (t, e) {
var i, r = -1 !== h.indexOf(g, t);
return V(i = s(c, t, e, r)) ? r ? (e = o(c, t, e, u)) ? t + '="' + e + '"' : t : V(i = a(c, t, e, r)) ? void 0 : i : i
});
return f = "<" + c, v && (f += " " + v), _.closing && (f += " /"), f += ">"
}
return V(p = n(c, f, m)) ? l(f) : p
}, l);
return c && (f = c.remove(f)), f
};
var W = q,
Z = t(function (t, e) {
function i(t, e) {
return new W(e).process(t)
}
for (var r in (e = t.exports = i).filterXSS = i, e.FilterXSS = W, L) e[r] = L[r];
for (var r in X) e[r] = X[r];
"undefined" != typeof window && (window.filterXSS = t.exports), "undefined" != typeof self && "undefined" != typeof DedicatedWorkerGlobalScope && self instanceof DedicatedWorkerGlobalScope && (self.filterXSS = t.exports)
}),
G = (Z.filterXSS, Z.FilterXSS, "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function (t) {
return typeof t
} : function (t) {
return t && "function" == typeof Symbol && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t
});
function H(t) {
var e = t.status;
if (e >= 200 && e < 300) return t;
var i = new Error("(Status Code: " + t.status + "): " + t.statusText);
throw i.response = t, i
}
function $(t) {
return t.response ? t.response : t
}
var Q = function (t, e) {
if ("string" != typeof t) throw new TypeError("argument str must be a string");
for (var i = {}, r = e || {}, n = t.split(K), s = r.decode || J, a = 0; a < n.length; a++) {
var o = n[a],
l = o.indexOf("=");
if (!(l < 0)) {
var u = o.substr(0, l).trim(),
h = o.substr(++l, o.length).trim();
'"' == h[0] && (h = h.slice(1, -1)), null == i[u] && (i[u] = tt(h, s))
}
}
return i
},
J = decodeURIComponent,
K = /; */;
function tt(t, e) {
try {
return e(t)
} catch (e) {
return t
}
}
function et(t) {
var e = arguments.length > 1 && void 0 !== arguments[1] ? arguments[1] : {};
return e.headernavs = function () {
var t = arguments.length > 0 && void 0 !== arguments[0] ? arguments[0] : {},
e = arguments.length > 1 && void 0 !== arguments[1] ? arguments[1] : "",
i = Object.assign({}, t);
delete i.host, delete i["content-length"], delete i["content-type"];
var r = Q(e),
n = r.ajs_anonymous_id,
s = r.authentication_token;
if (n) {
var a = decodeURIComponent(n).replace(/"/g, "");
"null" !== a && (i["X-Anonymous-Id"] = a)
}
return s && (i.Authorization = "Bearer " + s), i
}(e.headernavs, document.cookie),
function (t, e) {
var i = t.headernavs;
if (t.headernavs instanceof e || (i = new e, t.headernavs && Object.keys(t.headernavs).forEach(function (e) {
var r = t.headernavs[e];
i.set(e, "string" == typeof r ? r : "" + r)
}), t.headernavs = i), "undefined" != typeof location) {
var r = location.toString().split("?")[0];
t.headernavs.set("x-uc-referer", r)
}
var n = (t.method || "GET").toUpperCase();
i.has("Content-Type") ? "undefined" === i.get("Content-Type") && i.delete("Content-Type") : "POST" !== n && "PUT" !== n && "PATCH" !== n || !t.body || "object" !== G(t.body) || i.set("Content-Type", "application/json"), "string" == typeof t.ucResponseFilter && "" !== t.ucResponseFilter && i.set("X-Compass-Response-Filter", t.ucResponseFilter.replace(/\n+/gm, " ").replace(/\s{2,}/g, " "))
}(e, window.headernavs), t = new URL(t, e.baseURL || window.location.origin).href,
function (t, e) {
var i = arguments.length > 2 && void 0 !== arguments[2] ? arguments[2] : {};
if (function (t) {
-1 !== (t.headernavs.get("Content-Type") || "").indexOf("application/json") && t.body && "object" === G(t.body) && (t.body = JSON.stringify(t.body))
}(i), i.ucJsonParam) {
var r = encodeURIComponent(Z(JSON.stringify(i.ucJsonParam)));
e = e + (e.indexOf("?") > -1 ? "&" : "?") + "json=" + r
}
return i.credentials || (i.credentials = "same-origin"), t(e, i).then(H).then(function (t) {
return function (t, e) {
var i = t.headernavs.get("Content-Type"),
r = !0 === e.doNotParseJson;
return -1 === (i || "").indexOf("application/json") || r ? t : t.json()
}(t, i)
}).then($)
}(window.fetch, t, e)
}
return function (t, e) {
["get", "delete", "head"].forEach(function (e) {
t[e] = function (i, r) {
return t(i, Object.assign(r || {}, {
method: e
}))
}
})
}(et),
function (t, e) {
["post", "put", "patch"].forEach(function (e) {
t[e] = function (i, r, n) {
return t(i, Object.assign(n || {}, {
method: e,
body: r
}))
}
})
}(et), et
}()
}, function (t, e, i) {
"use strict";
function r(t, e) {
var i = Object.keys(t);
if (Object.getOwnPropertySymbols) {
var r = Object.getOwnPropertySymbols(t);
e && (r = r.filter(function (e) {
return Object.getOwnPropertyDescriptor(t, e).enumerable
})), i.push.apply(i, r)
}
return i
}
function n(t, e, i) {
return e in t ? Object.defineProperty(t, e, {
value: i,
enumerable: !0,
configurable: !0,
writable: !0
}) : t[e] = i, t
}
Object.defineProperty(e, "__esModule", {
value: !0
}), e.trackEvent = function (t) {
var e = arguments.length > 1 && void 0 !== arguments[1] ? arguments[1] : {},
i = window,
s = i.uc,
a = i.analytics,
o = function (t) {
for (var e, i = document.cookie.split(";"), r = 0; r < i.length; r++) {
var n = i[r].trim();
0 === n.indexOf(t + "=") && (e = n.substring((t + "=").length, n.length))
}
return e
}("_pid");
a && a.track && a.track(t, function (t) {
for (var e = 1; e < arguments.length; e++) {
var i = null != arguments[e] ? arguments[e] : {};
e % 2 ? r(Object(i), !0).forEach(function (e) {
n(t, e, i[e])
}) : Object.getOwnPropertyDescriptors ? Object.defineProperties(t, Object.getOwnPropertyDescriptors(i)) : r(Object(i)).forEach(function (e) {
Object.defineProperty(t, e, Object.getOwnPropertyDescriptor(i, e))
})
}
return t
}({
"Current Geography": s && s.geoId || "Geography Not Detected",
Source: "Concierge",
"User ID": s && s.user && s.user.personId || "User ID Not Detected",
referring_agent_id: s && s.agentRelations && s.agentRelations.brandingAgentOrTeam && s.agentRelations.brandingAgentOrTeam.id
}, e, {}, o ? {
pid: o
} : {}))
}
}, function (t, e, i) {
"use strict";
function r(t, e) {
if (!(t instanceof e)) throw new TypeError("Cannot call a class as a function")
}
function n(t, e) {
for (var i = 0; i < e.length; i++) {
var r = e[i];
r.enumerable = r.enumerable || !1, r.configurable = !0, "value" in r && (r.writable = !0), Object.defineProperty(t, r.key, r)
}
}
function s(t, e, i) {
return e && n(t.prototype, e), i && n(t, i), t
}
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = void 0;
var a = function () {
function t(e) {
r(this, t), this.id = e, this.player = t.createPlayer(e)
}
return s(t, null, [{
key: "createPlayer",
value: function (t) {
return new window.YT.Player("yt-".concat(t), {
videoId: t,
events: {
onStateChange: o.createOnStateChangeCallback(t)
}
})
}
}]), s(t, [{
key: "stop",
value: function () {
this.player.stopVideo()
}
}, {
key: "play",
value: function () {
this.player.playVideo()
}
}]), t
}(),
o = new (function () {
function t() {
r(this, t), this.videos = []
}
return s(t, [{
key: "registerVideo",
value: function (t) {
this.videos.push(new a(t))
}
}, {
key: "playVideo",
value: function (t) {
this._getVideo(t).play()
}
}, {
key: "stopVideo",
value: function (t) {
this._getVideo(t).stop()
}
}, {
key: "_getVideo",
value: function (t) {
return this.videos.find(function (e) {
return e.id === t
})
}
}, {
key: "createOnStateChangeCallback",
value: function (t) {
var e = this;
return function (i) {
1 === i.data && e.pauseOthers(t)
}
}
}, {
key: "pauseOthers",
value: function (t) {
this.videos.filter(function (e) {
return e.id !== t
}).forEach(function (t) {
return t.stop()
})
}
}]), t
}()),
l = o;
e.default = l
}, function (t, e, i) {
"use strict";
var r = function (t) {
return t && t.__esModule ? t : {
default: t
}
}(i(5));
document.addEventListener("DOMContentLoaded", function () {
try {
window.renderNav()
} catch (t) {
console.error("RenderNav Error:", t)
} (0, r.default)()
})
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function () {
(0, a.trackEvent)("concierge_viewed");
var t = window.$,
e = t(window),
i = e.width(),
h = e.height(),
c = t("section:not(#hero-mobile)"),
f = window.location.pathname,
d = !1;
void 0 !== t.fn && (t.fn.serializeObject = s.default);
"agents" !== f.split("/concierge/")[1] && "agents/" !== f.split("/concierge/")[1] || (t(".agent-hide, .corpNav-phoneNumber").remove(), i <= 1250 && t("#headernav").remove());
"" !== f.split("/concierge/agents/")[1] && t("#headernav-phone, .corpNav-phoneNumber").remove();
t("body").hasClass("concierge-app-calculator") ? function () {
i > 768 && t(".icon-down").remove();
t("#calculator form").on("submit", function (e) {
e.preventDefault();
var i = t(this),
r = function (e) {
var i = !0;
return e.find("input").each(function () {
var e = "" !== t(this).val();
t(this).toggleClass("input_error", !e), e || (i = !1)
}), i
}(t(this));
if (r) {
var n = function (t) {
return {
listingZipCode: t.listingZipCode,
listingPrice: m(t.listingPrice),
budgetRequest: m(t.budgetRequest),
amountOwed: m(t.amountOwed),
workWeeks: m(t.workWeeks)
}
}(t(this).serializeObject()),
s = i.find("button[type=submit]");
s.addClass("loading"),
function (t) {
return fetch("/concierge/calculator", {
headernavs: {
Accept: "application/json",
"Content-Type": "application/json"
},
method: "POST",
body: JSON.stringify(t)
}).then(function (t) {
return t.json()
}).catch(function (t) {
throw new Error(t)
})
}(n).then(function (e) {
setTimeout(function () {
var r = e.message,
n = e.additionalRequirements,
s = e.approved;
t("#calculator").addClass("submitted"), t("#approval-message").text(r), t(".calculator-modal-inner").append('<a href="#" data-js="calculator-modal-close" class="icon-close" aria-label="close" id="closeBtn"></a>'), t("#closeBtn").trigger("focus"), t("[data-js=calculator-modal-close]").on("click", function (e) {
e.preventDefault(), t("#calculator").removeClass("submitted"), t("#calculator").removeClass("requirements"), t("#calculator").removeClass("approved"), t(".icon-close").remove()
}), n && t("#calculator").addClass("requirements"), s && t("#calculator").addClass("approved");
var a = window.uc.user,
o = a.displayName,
l = a.email,
u = {
Name: o,
Email: l,
"Listing Zip Code": i.find("[name=listingZipCode]").val(),
"Listing Price": i.find("[name=listingPrice]").val(),
"Budget Request": i.find("[name=budgetRequest]").val(),
"Amount Owed": i.find("[name=amountOwed]").val(),
"Work Weeks": i.find("[name=workWeeks]").val(),
"Result Message": r
},
h = function (t) {
return "?" + Object.keys(t).map(function (e) {
return encodeURIComponent(e) + "=" + encodeURIComponent(t[e])
}).join("&")
}(u);
fetch("".concat("https://script.google.com/macros/s/AKfycbytL5PzuiWGG7kWgqJikpCtxYQslI3u2qgmvAzyMeK7DdTYtaA/exec").concat(h)).catch(function (t) {
throw new Error(t)
})
}, 1500), setTimeout(function () {
s.removeClass("loading")
}, 1800)
})
}
}), t("[data-js=calculator-collapse]").on("click", function (e) {
e.preventDefault(), t(".calculator-collapse").toggleClass("active")
}), t("[data-js=validate-usd]").on("input", function () {
var e = t(this).val();
if (e && "$" !== e) {
var i = m(e),
r = function (t) {
return "$" + t.toString().replace(/\B(?=(\d{3})+(?!\d))/g, ",")
}(i);
t(this).val(r)
} else t(this).val("")
}), t("[data-js=validate-zipcode]").on("input", function () {
var e = t(this).val(),
i = m(e),
r = function (t) {
return t.toString().slice(0, 5)
}(i);
t(this).val(r)
})
}() : (function () {
i > 768 && t('[class*="btn-h-"]').mouseenter(function () {
t(this).removeClass("h_out").addClass("h_in")
}).mouseleave(function () {
t(this).removeClass("h_in").addClass("h_out")
});
t("main a.btn, main p > a").on("click", function (e) {
e.stopPropagation(), e.preventDefault();
var i = t(this).attr("href");
window.location.href = i
})
}(), function () {
var r = t("#headernav-chapters"),
n = h * (i < 900 ? .5 : .75);
function s() {
var i = e.scrollTop() + n;
c.each(function () {
var e = t(this),
n = e.attr("id"),
s = e.data("top"),
a = void 0 === e.next().data("top") ? 1 / 0 : e.next().data("top");
i > s && (e.hasClass("scrolled") || e.addClass("scrolled")), i > s && i < a && r.find('[data-scroll="#'.concat(n, '"]')).addClass("active").siblings().removeClass("active")
})
}
c.each(function () {
var e = t(this);
e.attr("data-top", Math.floor(e.offset().top))
}), s(), t(window).scroll(s), t("[data-scroll]").on("click touchend", function () {
var e = t(this).attr("data-scroll");
t("html, body").animate({
scrollTop: t(e).offset().top - 120
}, 600), "#contact" === e && (setTimeout(function () {
t('#contact [name="Name"]').focus()
}, 600), (0, a.trackEvent)("Concierge Clicked Get Started Button"))
}), t("[data-scroll]").on("keypress", function (e) {
var i = t(this).attr("data-scroll");
"#contact" === i || "Enter" !== e.key && "Spacebar" !== e.key && " " !== e.key || t("html, body").animate({
scrollTop: t(i).offset().top - 120
}, 600)
})
}(), function () {
d ? t("#contact").remove() : t("#contact").addClass("scrolled");
var e = !1;
t("#contact-form input").on("keyup", function () {
e || ((0, a.trackEvent)("Concierge Started Form Submission"), e = !0), t(this).attr("value", t(this).val())
}), t("#contact-agent").change(function () {
var e = t(this);
"on" === e.val() || "Yes" === e.val() ? e.val("No") : e.val("Yes")
});
var i = t("#contact-form");
i.on("submit", function (e) {
var r = this;
e.preventDefault();
var s = i.closest("#contact-profile").length,
o = i.find("[name=Email]").val(),
l = o.includes("@compass.com");
if (i.find("[name=Timestamp]").val(new Date), i.find('[name="PID"]').val(function (t) {
for (var e, i = document.cookie.split(";"), r = 0; r < i.length; r++) {
var n = i[r].trim();
0 === n.indexOf(t + "=") && (e = n.substring((t + "=").length, n.length))
}
return e
}("_pid")), s) {
var h = (0, n.getFormValues)(i);
window.grecaptcha.ready(function () {
window.grecaptcha.execute(window.uc.recaptchaSiteKey, {
action: "form/brandedConcierge"
}).then(function (e) {
return h.captchaToken = e, (0, u.submitAgentBrandedConciergeLead)(h).then(function (e) {
if (e.success) (0, n.submitCompleted)(l), (0, a.trackEvent)("Concierge Branded Form Submit", {
name: i.find("[name=Name]").val(),
email: i.find("[name=Email]").val(),
zip: i.find("[name=Zip]").val(),
phone: i.find("[name=Phone]").val()
});
else {
var s = e.errors;
p(t("#contact-form"), s), (0, a.trackEvent)("Concierge Branded Form Submit (Invalid)", {
name: t(r).find("[name=Name]").val(),
email: t(r).find("[name=Email]").val(),
zip: t(r).find("[name=Zip]").val(),
phone: t(r).find("[name=Phone]").val()
})
}
}).catch(function (t) {
throw new Error(t)
})
})
})
} else {
var c = t(this),
f = c.find(":submit");
f.prop("disabled", !0);
var d = c.serializeObject();
window.grecaptcha.ready(function () {
window.grecaptcha.execute(window.uc.recaptchaSiteKey, {
action: "form/concierge"
}).then(function (e) {
d.captchaToken = e;
var n = i.find("#contact-agent").val();
return d.isWorkingWithAgent = "Yes" === n, (0, u.submitGenericConciergeLead)(d).then(function (e) {
if (e.success) ! function (t) {
t.find("button[type=submit]").text("Submitting...").addClass("no-arrow")
}(i), l ? (t("#contact-success").remove(), t("#contact-success-agent").addClass("active")) : (t("#contact-success-agent").remove(), t("#contact-success").addClass("active")), t("#contact-form").addClass("sent"), (0, a.trackEvent)("Concierge Landing Form Submit", {
name: i.find("[name=Name]").val(),
email: i.find("[name=Email]").val(),
zip: i.find("[name=Zip]").val(),
phone: i.find("[name=Phone]").val(),
workingWithAgent: n
});
else {
var s = e.errors;
p(t("#contact-form"), s), (0, a.trackEvent)("Concierge Landing Form Submit (Invalid)", {
name: t(r).find("[name=Name]").val(),
email: t(r).find("[name=Email]").val(),
zip: t(r).find("[name=Zip]").val(),
phone: t(r).find("[name=Phone]").val(),
workingWithAgent: t(r).find("#contactagent").val()
})
}
}).catch(function (t) {
throw new Error(t)
}).finally(function () {
return f.prop("disabled", !1)
})
})
})
}
})
}(), function () {
var i = t("#headernav");
function r() {
var t = parseInt(e.scrollTop());
t > h ? i.addClass("headernav_slide_down") : i.removeClass("headernav_slide_down")
}
r(), e.scroll(r)
}(), (0, r.default)(), window.YT && window.YT.ready(function () {
t(".video-placeholder").each(function (e, i) {
l.default.registerVideo(t(i).data("youtubeId"))
}), t(".video-thumb, .video-cta").on("click keypress", function (e) {
if ("click" === e.type || "keypress" === e.type && ["Enter", "Spacebar", " "].includes(e.key)) {
e.preventDefault(), e.stopPropagation();
var i = t(e.target).closest(".video-outer").find(".video-placeholder").data("youtubeId");
l.default.playVideo(i), t(".video-outer").addClass("playing"), (0, a.trackEvent)("Concierge Video Clicked Below")
}
})
}), function () {
[5, 15, 30, 60, 120, 240, 480].forEach(function (t) {
setTimeout(function () {
(0, a.trackEvent)("Concierge Time Elapsed ".concat(t, " Seconds"))
}, 1e3 * t)
});
var i = t(document).height(),
r = !1;
e.on("scroll", function () {
var t = e.scrollTop() > i / 2;
!r && t && ((0, a.trackEvent)("Concierge Scrolled Halfway"), r = !0)
})
}());
function p(t, e) {
for (var i = t.find("[name=Name]"), r = t.find("[name=Email]"), n = t.find("[name=Zip]"), s = t.find("[name=Phone]"), a = document.querySelector("#contact-form-error p"), o = 0; o < e.length; o++) {
var l = e[o],
u = l.fieldName,
h = l.message;
if ("name" === u) return i.addClass("input_error"), a.innerText = h, !1;
if (i.removeClass("input_error"), "email" === u) return r.addClass("input_error"), a.innerText = h, !1;
if (r.removeClass("input_error"), "zip" === u) return n.addClass("input_error"), a.innerText = h, !1;
if (n.removeClass("input_error"), "phone" === u) return s.addClass("input_error"), a.innerText = h, !1;
s.removeClass("input_error")
}
return !0
}
function m(t) {
var e = parseInt(t.replace(/[^0-9.]/g, ""));
return Number.isNaN(e) ? "" : e
}
t(".dots-playButton").each(function () {
var e = (0, o.default)("playButton");
t(this).append(e)
})
};
var r = h(i(6)),
n = i(7),
s = h(i(8)),
a = i(2),
o = h(i(9)),
l = h(i(3)),
u = i(12);
function h(t) {
return t && t.__esModule ? t : {
default: t
}
}
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function () {
var t = document.querySelector("#slider"),
e = document.querySelector("#controls");
t && e && function (t, e) {
var i = 400,
a = 1e3;
function o() {
var e = t.querySelector(".slide-active"),
i = e.offsetHeight;
t.style.height = "".concat(i, "px")
}
function l(e) {
e.stopPropagation(), e.preventDefault();
var s = e.target.classList.contains("slider-prev");
! function (e) {
var r = t.querySelector(".slide-active"),
s = e ? r.previousElementSibling : r.nextElementSibling,
l = r.querySelector(".video-placeholder");
l && n.default.stopVideo(l.dataset.youtubeId);
if (s) setTimeout(function () {
r.classList.remove("slide-active"), s.classList.add("slide-active")
}, i);
else {
var u = t.firstElementChild,
h = t.lastElementChild;
setTimeout(function () {
h.classList.toggle("slide-active", e), u.classList.toggle("slide-active", !e)
}, i)
}
t.classList.add("slides-movingIn"), o(), setTimeout(function () {
t.classList.add("slides-movingOut"), o()
}, i), setTimeout(function () {
t.classList.remove("slides-movingIn", "slides-movingOut"), t.removeAttribute("style")
}, a)
}(s), (0, r.trackEvent)("Concierge Clicked Success Story Slideshow")
}
window.addEventListener("load", o),
function (t) {
return function (t) {
if (Array.isArray(t)) return s(t)
}(t) || function (t) {
if ("undefined" != typeof Symbol && Symbol.iterator in Object(t)) return Array.from(t)
}(t) || function (t, e) {
if (!t) return;
if ("string" == typeof t) return s(t, e);
var i = Object.prototype.toString.call(t).slice(8, -1);
"Object" === i && t.constructor && (i = t.constructor.name);
if ("Map" === i || "Set" === i) return Array.from(t);
if ("Arguments" === i || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(i)) return s(t, e)
}(t) || function () {
throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.")
}()
}(e.querySelectorAll("button, a")).forEach(function (t) {
t.addEventListener("click", l), t.addEventListener("touchend", l)
})
}(t, e)
};
var r = i(2),
n = function (t) {
return t && t.__esModule ? t : {
default: t
}
}(i(3));
function s(t, e) {
(null == e || e > t.length) && (e = t.length);
for (var i = 0, r = new Array(e); i < e; i++) r[i] = t[i];
return r
}
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.getFormValues = function (t) {
return {
name: t.find('[name="Name"]').val(),
agentId: t.find('[name="agentId"]').val(),
agentUrl: window.location.href,
zip: t.find('[name="Zip"]').val(),
email: t.find('[name="Email"]').val(),
phone: t.find('[name="Phone"]').val()
}
}, e.submitCompleted = function (t) {
t ? (r("#contact-success").remove(), r("#contact-success-agent").addClass("active")) : (r("#contact-success-agent").remove(), r("#contact-success").addClass("active"));
r("#contact-form").addClass("sent")
};
var r = window.$
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function () {
var t = window.$,
e = this,
i = {},
r = {},
n = {
validate: /^[a-zA-Z][a-zA-Z0-9_]*(?:\[(?:\d*|[a-zA-Z0-9_]+)\])*$/,
key: /[a-zA-Z0-9_]+|(?=\[\])/g,
push: /^$/,
fixed: /^\d+$/,
named: /^[a-zA-Z0-9_]+$/
};
return this.build = function (t, e, i) {
return t[e] = i, t
}, this.push_counter = function (t) {
return void 0 === r[t] && (r[t] = 0), r[t]++
}, t.each(t(this).serializeArray(), function () {
if (n.validate.test(this.name)) {
for (var r, s = this.name.match(n.key), a = this.value, o = this.name; void 0 !== (r = s.pop());) o = o.replace(new RegExp("\\[" + r + "\\]$"), ""), r.match(n.push) ? a = e.build([], e.push_counter(o), a) : r.match(n.fixed) ? a = e.build([], r, a) : r.match(n.named) && (a = e.build({}, r, a));
i = t.extend(!0, i, a)
}
}), i
}
}, function (t, e, i) {
window,
t.exports = function (t) {
return function (t) {
var e = {};
function i(r) {
if (e[r]) return e[r].exports;
var n = e[r] = {
i: r,
l: !1,
exports: {}
};
return t[r].call(n.exports, n, n.exports, i), n.l = !0, n.exports
}
return i.m = t, i.c = e, i.d = function (t, e, r) {
i.o(t, e) || Object.defineProperty(t, e, {
enumerable: !0,
get: r
})
}, i.r = function (t) {
"undefined" != typeof Symbol && Symbol.toStringTag && Object.defineProperty(t, Symbol.toStringTag, {
value: "Module"
}), Object.defineProperty(t, "__esModule", {
value: !0
})
}, i.t = function (t, e) {
if (1 & e && (t = i(t)), 8 & e) return t;
if (4 & e && "object" == typeof t && t && t.__esModule) return t;
var r = Object.create(null);
if (i.r(r), Object.defineProperty(r, "default", {
enumerable: !0,
value: t
}), 2 & e && "string" != typeof t)
for (var n in t) i.d(r, n, function (e) {
return t[e]
}.bind(null, n));
return r
}, i.n = function (t) {
var e = t && t.__esModule ? function () {
return t.default
} : function () {
return t
};
return i.d(e, "a", e), e
}, i.o = function (t, e) {
return Object.prototype.hasOwnProperty.call(t, e)
}, i.p = "", i(i.s = 2)
}([function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.pointDist = function (t, e, i, r) {
return Math.sqrt(Math.pow(t - i, 2) + Math.pow(e - r, 2))
}, e.toRad = function (t) {
return t * Math.PI / 180
}, e.cssInject = function () {
var t = "ucDots-style";
if (!document.querySelector("#" + t)) {
var e = document.createElement("style");
e.id = t, e.type = "text/css", e.textContent = s.default, document.head.appendChild(e)
}
}, e.randomIntInRange = function (t, e) {
return t = Math.ceil(t), e = Math.floor(e), Math.floor(Math.random() * (e - t + 1)) + t
}, e.randomInRange = function (t, e) {
return Math.random() * (e - t) + t
};
var r, n = i(5),
s = (r = n) && r.__esModule ? r : {
default: r
}
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
});
var r = function () {
function t(t, e) {
for (var i = 0; i < e.length; i++) {
var r = e[i];
r.enumerable = r.enumerable || !1, r.configurable = !0, "value" in r && (r.writable = !0), Object.defineProperty(t, r.key, r)
}
}
return function (e, i, r) {
return i && t(e.prototype, i), r && t(e, r), e
}
}(),
n = i(4),
s = i(0),
a = function () {
function t(e) {
var i = e.tweenListen;
! function (t, e) {
if (!(t instanceof e)) throw new TypeError("Cannot call a class as a function")
}(this, t), this.self = this, this.dot = document.createElement("div"), this.dot.className = "identity-dot", this.inner = document.createElement("div"), this.inner.className = "inner", this.dot.appendChild(this.inner), this.element = this.dot, this.oriX = 0, this.oriY = 0, this.offX = 0, this.offY = 0, this.tweenedX = 0, this.tweenedY = 0, this.top = 0, this.left = 0, this.threshold = 140, this.f3d = !1, this.mouseListening = !1, this.running = !1, this.mouseMoved = this.mouseMoved.bind(this), this.mouseLeft = this.mouseLeft.bind(this), this.updatePos = this.updatePos.bind(this), this.updatePositionCircle = this.updatePositionCircle.bind(this), i && n.TweenLite.ticker.addEventListener("tick", this.updatePos)
}
return r(t, [{
key: "listen",
value: function () {
this._addMouseListener()
}
}, {
key: "ignore",
value: function () {
this._removeMouseListener()
}
}, {
key: "_addMouseListener",
value: function () {
window.addEventListener("mousemove", this.mouseMoved), document.addEventListener("mouseleave", this.mouseLeft), this.mouseListening = !0
}
}, {
key: "_removeMouseListener",
value: function () {
window.removeEventListener("mousemove", this.mouseMoved), document.removeEventListener("mouseleave", this.mouseLeft), this.mouseListening = !1, this.tweenedX = this.tweenedY = this.offX = this.offY = 0, n.TweenLite.set(this.inner, {
x: this.tweenedX,
y: this.tweenedY
})
}
}, {
key: "mouseMoved",
value: function (t) {
var e = this.dot.parentNode.getBoundingClientRect(),
i = e.top + window.scrollY,
r = e.left,
n = {
x: t.pageX,
y: t.pageY
},
a = {
x: r + this.oriX,
y: i + this.oriY
};
this.dist = (0, s.pointDist)(n.x, n.y, a.x, a.y);
var o = (0, s.toRad)(90) - Math.atan2(a.y - n.y, a.x - n.x);
this.dist < this.threshold && (this._updateOnTick(), this.offX = Math.sin(o) * (this.threshold - this.dist), this.offY = Math.cos(o) * (this.threshold - this.dist), this.offX *= .1, this.offY *= .1)
}
}, {
key: "mouseLeft",
value: function () {
Math.abs(this.offX) + Math.abs(this.offY) > 0 && (this.offX = this.offY = 0, this._updateOnTick())
}
}, {
key: "_updateOnTick",
value: function () {
this.running || (this.running = !0)
}
}, {
key: "position",
value: function (t, e) {
this.oriX = t, this.oriY = e, n.TweenLite.set(this.dot, {
x: t,
y: e,
force3D: this.f3d
})
}
}, {
key: "updatePos",
value: function () {
this.tweenedX += .1 * (this.offX - this.tweenedX), this.tweenedY += .1 * (this.offY - this.tweenedY), n.TweenLite.set(this.inner, {
x: this.tweenedX,
y: this.tweenedY
})
}
}, {
key: "setNewOri",
value: function (t, e) {
this.oriX = t, this.oriY = e
}
}, {
key: "tweenPosition",
value: function (t) {
var e = t.x,
i = t.y,
r = t.time,
s = t.delay,
a = t.type;
1 === a ? (s += .2, n.TweenLite.to(this.dot, r / 3, {
opacity: 0,
x: this.oriX + 15,
ease: n.Power2.easeIn,
delay: s,
force3D: this.f3d
}), n.TweenLite.set(this.dot, {
opacity: 0,
x: e - 15,
y: i,
delay: s + r / 3,
onStart: this.setNewOri,
onStartParams: [e, i],
force3D: this.f3d
}), n.TweenLite.to(this.dot, r / 3 * 2 - .2, {
opacity: 1,
x: e,
ease: n.Power2.easeOut,
delay: s + r / 3,
force3D: this.f3d
})) : 2 === a ? (s += .2, n.TweenLite.to(this.dot, r / 3, {
opacity: 0,
x: this.oriX + 15,
y: this.oriY + 15,
ease: n.Power2.easeIn,
delay: s,
force3D: this.f3d
}), n.TweenLite.set(this.dot, {
opacity: 0,
x: e - 15,
y: i - 15,
delay: s + r / 3,
onStart: this.setNewOri,
onStartParams: [e, i],
force3D: this.f3d
}), n.TweenLite.to(this.dot, r / 3 * 2 - .2, {
opacity: 1,
x: e,
y: i,
ease: n.Power2.easeOut,
delay: s + r / 3,
force3D: this.f3d
})) : 3 === a ? (this.oriX = e, this.oriY = i, n.TweenLite.to(this.dot, r, {
x: this.oriX,
y: this.oriY,
ease: n.Power3.easeInOut,
delay: s,
force3D: this.f3d
})) : (this.oriX = e, this.oriY = i, n.TweenLite.to(this.dot, r, {
x: this.oriX,
y: this.oriY,
ease: n.Power2.easeInOut,
delay: s,
force3D: this.f3d
}))
}
}, {
key: "tweenFromTo",
value: function (t) {
var e = t.x,
i = t.x1,
r = t.y,
s = t.y1,
a = t.delay;
n.TweenLite.set(this.dot, {
x: e,
y: r
}), n.TweenLite.to(this.dot, 1, {
x: i,
y: s,
ease: n.Power2.easeInOut,
delay: a,
force3D: this.f3d
})
}
}, {
key: "positionInCircle",
value: function (t) {
var e = t.angle,
i = t.radius,
r = t.circleX,
n = t.circleY;
this.curAngle = e, this.curRadius = i, this.curCirX = r, this.curCirY = n, this.updatePositionCircle()
}
}, {
key: "positionInHalfCircle",
value: function (t) {
var e = t.angle,
i = t.radius,
r = t.circleX,
n = t.circleY,
s = t.id;
this.positionInCircle({
angle: e,
radius: i,
circleX: r,
circleY: n
}), (s < 2 || s > 4) && (this.dot.style.opacity = 0)
}
}, {
key: "updatePositionCircle",
value: function () {
this.oriX = this.curRadius * Math.cos(this.curAngle) + this.curCirX, this.oriY = this.curRadius * Math.sin(this.curAngle) + this.curCirY, n.TweenLite.set(this.dot, {
x: this.oriX,
y: this.oriY
})
}
}, {
key: "tweenInCircle",
value: function (t) {
var e = t.newAngle,
i = t.time,
r = t.delay;
n.TweenLite.to(this, i, {
directionalRotation: {
curAngle: e + "_short",
useRadians: !0
},
onUpdate: this.updatePositionCircle,
ease: n.Power2.easeInOut,
delay: r
})
}
}, {
key: "tweenInHalfCircle",
value: function (t) {
var e = t.newAngle,
i = t.time,
r = t.delay,
s = t.id;
s < 2 || s > 4 ? n.TweenLite.to(this.dot, i, {
opacity: 0,
ease: n.Power2.easeInOut,
delay: r
}) : n.TweenLite.to(this.dot, i, {
opacity: 1,
ease: n.Power2.easeInOut,
delay: r
}), this.tweenInCircle({
newAngle: e,
time: i,
delay: r
})
}
}, {
key: "kill",
value: function () {
n.TweenLite.killTweensOf(this.dot), n.TweenLite.killTweensOf(this.self), n.TweenLite.ticker.removeEventListener("tick", this.updatePos), this.removeMouseListener()
}
}]), t
}();
e.default = a
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function (t) {
switch (t) {
case "diamond":
return (0, r.default)();
case "growth":
return (0, n.default)();
case "letterI":
return (0, s.default)();
case "playButton":
return (0, a.default)();
case "halfCircle":
return (0, o.default)("half");
default:
return (0, o.default)()
}
};
var r = l(i(3)),
n = l(i(9)),
s = l(i(10)),
a = l(i(11)),
o = l(i(12));
function l(t) {
return t && t.__esModule ? t : {
default: t
}
}
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function () {
var t = [],
e = [],
i = document.createElement("div"),
r = 0;
return (0, a.cssInject)(),
function () {
for (var r = 0; r < 9; r++) t.push([r % 3 * 30, 30 * Math.floor(r / 3)]);
for (var n = 3; n < 6; n++) t[n][0] = 30 * (5 - n);
for (var o = 0; o < 9; o++) {
var l = t[o][0],
u = t[o][1],
h = Math.sin((0, a.toRad)(45)),
c = Math.cos((0, a.toRad)(45));
t[o][0] = l * c - u * h, t[o][1] = l * h + u * c
}
for (var f = 0; f < 9; f++) {
var d = new s.default({
tweenListen: !0
});
d.position(t[f][0], t[f][1]), i.appendChild(d.element), e.push(d)
}
}(), e.forEach(function (t) {
t.listen()
}), setInterval(function () {
! function () {
r += 1;
for (var i = 0; i < 9; ++i) {
var n = (i + r) % 9;
0 === n ? e[i].tweenPosition({
x: t[n][0],
y: t[n][1],
time: 1 + .1 * (n + 9),
delay: .02 * (n + 9),
type: 2
}) : e[i].tweenPosition({
x: t[n][0],
y: t[n][1],
time: 1 + .1 * n,
delay: .02 * n,
type: 0
})
}
}()
}, 4e3), i
};
var r, n = i(1),
s = (r = n) && r.__esModule ? r : {
default: r
},
a = i(0)
}, function (e, i) {
e.exports = t
}, function (t, e, i) {
var r = i(6);
"string" == typeof r && (r = [
[t.i, r, ""]
]), i(7)(r, {
hmr: !1,
transform: void 0,
insertInto: void 0
}), r.locals && (t.exports = r.locals)
}, function (t, e) {
t.exports = ".identity-dot {\n position: absolute;\n top: 0;\n left: 0;\n}\n\n.identity-dot .inner {\n position: absolute;\n top: -2px;\n left: -2px;\n border-radius: 100%;\n width: 4px;\n height: 4px;\n background-color: #ffffff;\n background-color: var(--colorIntent-brandLight);\n -webkit-transition: background-color 0.6s linear;\n transition: background-color 0.6s linear;\n}\n"
}, function (t, e, i) {
var r, n, s = {},
a = (r = function () {
return window && document && document.all && !window.atob
}, function () {
return void 0 === n && (n = r.apply(this, arguments)), n
}),
o = function (t) {
var e = {};
return function (t) {
if ("function" == typeof t) return t();
if (void 0 === e[t]) {
var i = function (t) {
return document.querySelector(t)
}.call(this, t);
if (window.HTMLIFrameElement && i instanceof window.HTMLIFrameElement) try {
i = i.contentDocument.head
} catch (t) {
i = null
}
e[t] = i
}
return e[t]
}
}(),
l = null,
u = 0,
h = [],
c = i(8);
function f(t, e) {
for (var i = 0; i < t.length; i++) {
var r = t[i],
n = s[r.id];
if (n) {
n.refs++;
for (var a = 0; a < n.parts.length; a++) n.parts[a](r.parts[a]);
for (; a < r.parts.length; a++) n.parts.push(v(r.parts[a], e))
} else {
var o = [];
for (a = 0; a < r.parts.length; a++) o.push(v(r.parts[a], e));
s[r.id] = {
id: r.id,
refs: 1,
parts: o
}
}
}
}
function d(t, e) {
for (var i = [], r = {}, n = 0; n < t.length; n++) {
var s = t[n],
a = e.base ? s[0] + e.base : s[0],
o = {
css: s[1],
media: s[2],
sourceMap: s[3]
};
r[a] ? r[a].parts.push(o) : i.push(r[a] = {
id: a,
parts: [o]
})
}
return i
}
function p(t, e) {
var i = o(t.insertInto);
if (!i) throw new Error("Couldn't find a style target. This probably means that the value for the 'insertInto' parameter is invalid.");
var r = h[h.length - 1];
if ("top" === t.insertAt) r ? r.nextSibling ? i.insertBefore(e, r.nextSibling) : i.appendChild(e) : i.insertBefore(e, i.firstChild), h.push(e);
else if ("bottom" === t.insertAt) i.appendChild(e);
else {
if ("object" != typeof t.insertAt || !t.insertAt.before) throw new Error("[Style Loader]\n\n Invalid value for parameter 'insertAt' ('options.insertAt') found.\n Must be 'top', 'bottom', or Object.\n (https://github.com/webpack-contrib/style-loader#insertat)\n");
var n = o(t.insertInto + " " + t.insertAt.before);
i.insertBefore(e, n)
}
}
function m(t) {
if (null === t.parentNode) return !1;
t.parentNode.removeChild(t);
var e = h.indexOf(t);
e >= 0 && h.splice(e, 1)
}
function _(t) {
var e = document.createElement("style");
return t.attrs.type = "text/css", g(e, t.attrs), p(t, e), e
}
function g(t, e) {
Object.keys(e).forEach(function (i) {
t.setAttribute(i, e[i])
})
}
function v(t, e) {
var i, r, n, s;
if (e.transform && t.css) {
if (!(s = e.transform(t.css))) return function () { };
t.css = s
}
if (e.singleton) {
var a = u++;
i = l || (l = _(e)), r = w.bind(null, i, a, !1), n = w.bind(null, i, a, !0)
} else t.sourceMap && "function" == typeof URL && "function" == typeof URL.createObjectURL && "function" == typeof URL.revokeObjectURL && "function" == typeof Blob && "function" == typeof btoa ? (i = function (t) {
var e = document.createElement("link");
return t.attrs.type = "text/css", t.attrs.rel = "stylesheet", g(e, t.attrs), p(t, e), e
}(e), r = function (t, e, i) {
var r = i.css,
n = i.sourceMap,
s = void 0 === e.convertToAbsoluteUrls && n;
(e.convertToAbsoluteUrls || s) && (r = c(r)), n && (r += "\n/*# sourceMappingURL=data:application/json;base64," + btoa(unescape(encodeURIComponent(JSON.stringify(n)))) + " */");
var a = new Blob([r], {
type: "text/css"
}),
o = t.href;
t.href = URL.createObjectURL(a), o && URL.revokeObjectURL(o)
}.bind(null, i, e), n = function () {
m(i), i.href && URL.revokeObjectURL(i.href)
}) : (i = _(e), r = function (t, e) {
var i = e.css,
r = e.media;
if (r && t.setAttribute("media", r), t.styleSheet) t.styleSheet.cssText = i;
else {
for (; t.firstChild;) t.removeChild(t.firstChild);
t.appendChild(document.createTextNode(i))
}
}.bind(null, i), n = function () {
m(i)
});
return r(t),
function (e) {
if (e) {
if (e.css === t.css && e.media === t.media && e.sourceMap === t.sourceMap) return;
r(t = e)
} else n()
}
}
t.exports = function (t, e) {
if ("undefined" != typeof DEBUG && DEBUG && "object" != typeof document) throw new Error("The style-loader cannot be used in a non-browser environment");
(e = e || {}).attrs = "object" == typeof e.attrs ? e.attrs : {}, e.singleton || "boolean" == typeof e.singleton || (e.singleton = a()), e.insertInto || (e.insertInto = "head"), e.insertAt || (e.insertAt = "bottom");
var i = d(t, e);
return f(i, e),
function (t) {
for (var r = [], n = 0; n < i.length; n++) {
var a = i[n];
(o = s[a.id]).refs--, r.push(o)
}
for (t && f(d(t, e), e), n = 0; n < r.length; n++) {
var o;
if (0 === (o = r[n]).refs) {
for (var l = 0; l < o.parts.length; l++) o.parts[l]();
delete s[o.id]
}
}
}
};
var y, b = (y = [], function (t, e) {
return y[t] = e, y.filter(Boolean).join("\n")
});
function w(t, e, i, r) {
var n = i ? "" : r.css;
if (t.styleSheet) t.styleSheet.cssText = b(e, n);
else {
var s = document.createTextNode(n),
a = t.childNodes;
a[e] && t.removeChild(a[e]), a.length ? t.insertBefore(s, a[e]) : t.appendChild(s)
}
}
}, function (t, e) {
t.exports = function (t) {
var e = "undefined" != typeof window && window.location;
if (!e) throw new Error("fixUrls requires window.location");
if (!t || "string" != typeof t) return t;
var i = e.protocol + "//" + e.host,
r = i + e.pathname.replace(/\/[^\/]*$/, "/");
return t.replace(/url\s*\(((?:[^)(]|\((?:[^)(]+|\([^)(]*\))*\))*)\)/gi, function (t, e) {
var n, s = e.trim().replace(/^"(.*)"$/, function (t, e) {
return e
}).replace(/^'(.*)'$/, function (t, e) {
return e
});
return /^(#|data:|http:\/\/|https:\/\/|file:\/\/\/|\s*$)/i.test(s) ? t : (n = 0 === s.indexOf("//") ? s : 0 === s.indexOf("/") ? i + s : r + s.replace(/^\.\//, ""), "url(" + JSON.stringify(n) + ")")
})
}
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function () {
(0, a.cssInject)();
var t = [],
e = [],
i = Math.min(Math.floor(window.innerHeight / 60) + 1, 100),
r = Math.min(Math.floor(window.innerWidth / 60) + 1, 100),
n = new Set,
o = document.createElement("div");
(function (t) {
for (var n = 0; n < 3; n++) e.push({
r: (0, a.randomIntInRange)(0, i - 1),
c: (0, a.randomIntInRange)(0, r - 1)
})
})(),
function (e, i) {
for (var r = 0; r < e; r++) {
t[r] = [];
for (var s = 0; s < i; s++) {
var a = 60 * s,
o = 60 * r;
t[r].push({
x: a,
y: o
});
var l = "" + h(r) + h(s);
n.add(l)
}
}
}(i, r);
var l = setInterval(function () {
! function () {
var i = !1;
if (e.forEach(function (e) {
var r = [];
if ([{
r: 1,
c: 1
}, {
r: 0,
c: 1
}, {
r: 1,
c: 0
}, {
r: -1,
c: -1
}, {
r: 0,
c: -1
}, {
r: -1,
c: 0
}, {
r: -1,
c: 1
}, {
r: 1,
c: -1
}, {
r: 0,
c: 0
}].forEach(function (a) {
var l = e.r + a.r,
u = e.c + a.c,
c = "" + h(l) + h(u);
if (n.has(c)) {
var f = new s.default({
tweenListen: !1
}),
d = t[e.r][e.c],
p = t[l][u];
o.appendChild(f.element), f.element.style.opacity = "0", f.element.style.transform = "translate3d(\n " + d.x + "px,\n " + d.y + "px,\n 0\n )", f.element.style.transition = "all 0.6s ease-out " + Math.random() + "s", setTimeout(function () {
f.element.style.opacity = "1", f.element.style.transform = "translate3d(" + p.x + "px,\n " + p.y + "px,\n 0\n )"
}, 400);
var m = "" + h(l) + h(u);
n.delete(m), r.push(a), i = !0
}
}), r.length > 0) {
var a = u(r);
e.r += a.r, e.c += a.c
}
}), !i && n.size > 0) {
var r = [].concat(function (t) {
if (Array.isArray(t)) {
for (var e = 0, i = Array(t.length); e < t.length; e++) i[e] = t[e];
return i
}
return Array.from(t)
}(n)),
a = u(r),
c = a.slice(0, 2),
f = a.slice(2, 4);
e = [{
r: parseInt(c),
c: parseInt(f)
}]
} else 0 === n.size && clearInterval(l)
}()
}, 20);
function u(t) {
return t[Math.floor(Math.random() * t.length)]
}
function h(t) {
var e = t.toString();
return t < 10 ? "0" + e : e
}
return o
};
var r, n = i(1),
s = (r = n) && r.__esModule ? r : {
default: r
},
a = i(0)
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function () {
var t = [],
e = [],
i = document.createElement("div"),
r = 0;
return (0, a.cssInject)(),
function () {
for (var r = 0; r < 7; r++) t.push([0, 0]);
t[1][0] = t[3][0] = t[5][0] = 30, t[2][0] = t[6][0] = 60, t[3][1] = 30, t[4][1] = t[5][1] = t[6][1] = 60;
for (var n = 0; n < 7; n++) {
var a = new s.default({
tweenListen: !0
});
a.position(t[n][0], t[n][1]), i.appendChild(a.element), e.push(a)
}
}(), e.forEach(function (t) {
t.listen()
}), setInterval(function () {
! function () {
r += 1;
for (var i = 0; i < 7; ++i) {
var n = (i + r) % 7;
0 === n ? e[i].tweenPosition({
x: t[n][0],
y: t[n][1],
time: 1 + .1 * (n + 7),
delay: .02 * (n + 7),
type: 2
}) : e[i].tweenPosition({
x: t[n][0],
y: t[n][1],
time: 1 + .1 * n,
delay: .02 * n,
type: 0
})
}
}()
}, 4e3), i
};
var r, n = i(1),
s = (r = n) && r.__esModule ? r : {
default: r
},
a = i(0)
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function () {
var t = [
[8, 12],
[0, 16],
[0, 8],
[0, 0],
[8, 4],
[16, 8]
],
e = [],
i = document.createElement("div"),
r = 0;
return (0, a.cssInject)(),
function () {
for (var r = 0; r < 6; r++) {
var n = new s.default({
tweenListen: !0
});
n.position(t[r][0], t[r][1]), i.appendChild(n.element), e.push(n)
}
}(), e.forEach(function (t) {
t.listen()
}), setInterval(function () {
! function () {
r += 1;
for (var i = 0; i < 6; ++i) {
var n = (i + r) % 6;
e[i].tweenPosition({
x: t[n][0],
y: t[n][1],
time: .8 + .1 * n,
delay: 0,
type: 0
})
}
}()
}, 3e3), i
};
var r, n = i(1),
s = (r = n) && r.__esModule ? r : {
default: r
},
a = i(0)
}, function (t, e, i) {
"use strict";
Object.defineProperty(e, "__esModule", {
value: !0
}), e.default = function (t) {
var e = 360 * Math.PI / 180,
i = e / 8 * 3,
r = [],
n = document.createElement("div"),
o = 0;
return (0, a.cssInject)(),
function () {
for (var a = 0; a < 8; a++) {
var o = new s.default({
tweenListen: !0
}),
l = {
angle: e / 8 * a + i,
radius: 45,
circleX: 0,
circleY: 45,
id: a
};
"half" === t ? o.positionInHalfCircle(l) : o.positionInCircle(l), n.appendChild(o.element), r.push(o)
}
}(), r.forEach(function (t) {
t.listen()
}), setInterval(function () {
o += 1, r.forEach(function (r, n) {
var s = (n + o) % 8,
a = {
newAngle: e / 8 * s + i,
time: 1 + .1 * s,
delay: .02 * s,
id: s
};
"half" === t ? r.tweenInHalfCircle(a) : r.tweenInCircle(a)
})
}, 4e3), n
};
var r, n = i(1),
s = (r = n) && r.__esModule ? r : {
default: r
},
a = i(0)
}])
}(i(13))
}, function (t, e) {
t.exports = function (t) {
if (!t.webpackPolyfill) {
var e = Object.create(t);
e.children || (e.children = []), Object.defineProperty(e, "loaded", {
enumerable: !0,
get: function () {
return e.l
}
}), Object.defineProperty(e, "id", {
enumerable: !0,
get: function () {
return e.i
}
}), Object.defineProperty(e, "exports", {
enumerable: !0
}), e.webpackPolyfill = 1
}
return e
}
}, function (t, e) {
var i;
i = function () {
return this
}();
try {
i = i || Function("return this")() || (0, eval)("this")
} catch (t) {
"object" == typeof window && (i = window)
}
t.exports = i
}, function (t, e, i) {
"use strict";
i.r(e);
var r = i(1);
function n(t, e = {}) {
return r.post("/api/v3/lead_forms/bridge_loans_agent", t, e)
}
function s(t, e = {}) {
return r.post("/api/v3/lead_forms/concierge_agent", t, e)
}
function a(t, e = {}) {
return r.post("/api/v3/lead_forms/sell_agent", t, e)
}
function o(t, e = {}) {
return r.post("/api/v3/lead_forms/agent_profile", t, e)
}
function l(t, e = {}) {
return r.post("/api/v3/lead_forms/coming_soon", t, e)
}
function u(t, e = {}) {
return r.post("/api/v3/lead_forms/commercial", t, e)
}
function h(t, e = {}) {
return r.post("/api/v3/lead_forms/contact_us", t, e)
}
function c(t, e = {}) {
return r.post("/api/v3/lead_forms/concierge", t, e)
}
function f(t, e = {}) {
return r.post("/api/v3/lead_forms/sell", t, e)
}
function d(t, e = {}) {
return r.post("/api/v3/lead_forms/listing", t, e)
}
function p(t, e = {}) {
return r.post("/api/v3/lead_forms/non_compass_listing", t, e)
}
function m(t, e = {}) {
return r.post("/api/v3/lead_forms/private_exclusives_buyer", t, e)
}
function _(t, e = {}) {
return r.post("/api/v3/lead_forms/private_exclusives_seller", t, e)
}
i.d(e, "submitAgentBrandedBridgeLoansLead", function () {
return n
}), i.d(e, "submitAgentBrandedConciergeLead", function () {
return s
}), i.d(e, "submitAgentBrandedSellLead", function () {
return a
}), i.d(e, "submitAgentProfileLead", function () {
return o
}), i.d(e, "submitComingSoonLead", function () {
return l
}), i.d(e, "submitCommercialLead", function () {
return u
}), i.d(e, "submitContactUsLead", function () {
return h
}), i.d(e, "submitGenericConciergeLead", function () {
return c
}), i.d(e, "submitGenericSellerLead", function () {
return f
}), i.d(e, "submitListingLead", function () {
return d
}), i.d(e, "submitNonCompassListingLead", function () {
return p
}), i.d(e, "submitPrivateExclusivesBuyerLead", function () {
return m
}), i.d(e, "submitPrivateExclusivesSellerLead", function () {
return _
})
}, function (t, e, i) {
"use strict";
i.r(e);
var r = i(0);
/*!
* VERSION: 2.1.3
* DATE: 2019-05-17
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
**/
r.k._gsDefine("TweenMax", ["core.Animation", "core.SimpleTimeline", "TweenLite"], function () {
var t = function (t) {
var e, i = [],
r = t.length;
for (e = 0; e !== r; i.push(t[e++]));
return i
},
e = function (t, e, i) {
var r, n, s = t.cycle;
for (r in s) n = s[r], t[r] = "function" == typeof n ? n(i, e[i], e) : n[i % n.length];
delete t.cycle
},
i = function (t) {
if ("function" == typeof t) return t;
var e = "object" == typeof t ? t : {
each: t
},
i = e.ease,
r = e.from || 0,
n = e.base || 0,
s = {},
a = isNaN(r),
o = e.axis,
l = {
center: .5,
end: 1
}[r] || 0;
return function (t, u, h) {
var c, f, d, p, m, _, g, v, y, b = (h || e).length,
w = s[b];
if (!w) {
if (!(y = "auto" === e.grid ? 0 : (e.grid || [1 / 0])[0])) {
for (g = -1 / 0; g < (g = h[y++].getBoundingClientRect().left) && y < b;);
y--
}
for (w = s[b] = [], c = a ? Math.min(y, b) * l - .5 : r % y, f = a ? b * l / y - .5 : r / y | 0, g = 0, v = 1 / 0, _ = 0; _ < b; _++) d = _ % y - c, p = f - (_ / y | 0), w[_] = m = o ? Math.abs("y" === o ? p : d) : Math.sqrt(d * d + p * p), m > g && (g = m), m < v && (v = m);
w.max = g - v, w.min = v, w.v = b = e.amount || e.each * (y > b ? b - 1 : o ? "y" === o ? b / y : y : Math.max(y, b / y)) || 0, w.b = b < 0 ? n - b : n
}
return b = (w[t] - w.min) / w.max, w.b + (i ? i.getRatio(b) : b) * w.v
}
},
n = function (t, e, i) {
r.l.call(this, t, e, i), this._cycle = 0, this._yoyo = !0 === this.vars.yoyo || !!this.vars.yoyoEase, this._repeat = this.vars.repeat || 0, this._repeatDelay = this.vars.repeatDelay || 0, this._repeat && this._uncache(!0), this.render = n.prototype.render
},
s = r.l._internals,
a = s.isSelector,
o = s.isArray,
l = n.prototype = r.l.to({}, .1, {}),
u = [];
n.version = "2.1.3", l.constructor = n, l.kill()._gc = !1, n.killTweensOf = n.killDelayedCallsTo = r.l.killTweensOf, n.getTweensOf = r.l.getTweensOf, n.lagSmoothing = r.l.lagSmoothing, n.ticker = r.l.ticker, n.render = r.l.render, n.distribute = i, l.invalidate = function () {
return this._yoyo = !0 === this.vars.yoyo || !!this.vars.yoyoEase, this._repeat = this.vars.repeat || 0, this._repeatDelay = this.vars.repeatDelay || 0, this._yoyoEase = null, this._uncache(!0), r.l.prototype.invalidate.call(this)
}, l.updateTo = function (t, e) {
var i, n = this.ratio,
s = this.vars.immediateRender || t.immediateRender;
for (i in e && this._startTime < this._timeline._time && (this._startTime = this._timeline._time, this._uncache(!1), this._gc ? this._enabled(!0, !1) : this._timeline.insert(this, this._startTime - this._delay)), t) this.vars[i] = t[i];
if (this._initted || s)
if (e) this._initted = !1, s && this.render(0, !0, !0);
else if (this._gc && this._enabled(!0, !1), this._notifyPluginsOfEnabled && this._firstPT && r.l._onPluginEvent("_onDisable", this), this._time / this._duration > .998) {
var a = this._totalTime;
this.render(0, !0, !1), this._initted = !1, this.render(a, !0, !1)
} else if (this._initted = !1, this._init(), this._time > 0 || s)
for (var o, l = 1 / (1 - n), u = this._firstPT; u;) o = u.s + u.c, u.c *= l, u.s = o - u.c, u = u._next;
return this
}, l.render = function (t, e, i) {
this._initted || 0 === this._duration && this.vars.repeat && this.invalidate();
var n, a, o, l, u, h, c, f, d, p = this._dirty ? this.totalDuration() : this._totalDuration,
m = this._time,
_ = this._totalTime,
g = this._cycle,
v = this._duration,
y = this._rawPrevTime;
if (t >= p - 1e-8 && t >= 0 ? (this._totalTime = p, this._cycle = this._repeat, this._yoyo && 0 != (1 & this._cycle) ? (this._time = 0, this.ratio = this._ease._calcEnd ? this._ease.getRatio(0) : 0) : (this._time = v, this.ratio = this._ease._calcEnd ? this._ease.getRatio(1) : 1), this._reversed || (n = !0, a = "onComplete", i = i || this._timeline.autoRemoveChildren), 0 === v && (this._initted || !this.vars.lazy || i) && (this._startTime === this._timeline._duration && (t = 0), (y < 0 || t <= 0 && t >= -1e-8 || 1e-8 === y && "isPause" !== this.data) && y !== t && (i = !0, y > 1e-8 && (a = "onReverseComplete")), this._rawPrevTime = f = !e || t || y === t ? t : 1e-8)) : t < 1e-8 ? (this._totalTime = this._time = this._cycle = 0, this.ratio = this._ease._calcEnd ? this._ease.getRatio(0) : 0, (0 !== _ || 0 === v && y > 0) && (a = "onReverseComplete", n = this._reversed), t > -1e-8 ? t = 0 : t < 0 && (this._active = !1, 0 === v && (this._initted || !this.vars.lazy || i) && (y >= 0 && (i = !0), this._rawPrevTime = f = !e || t || y === t ? t : 1e-8)), this._initted || (i = !0)) : (this._totalTime = this._time = t, 0 !== this._repeat && (l = v + this._repeatDelay, this._cycle = this._totalTime / l >> 0, 0 !== this._cycle && this._cycle === this._totalTime / l && _ <= t && this._cycle--, this._time = this._totalTime - this._cycle * l, this._yoyo && 0 != (1 & this._cycle) && (this._time = v - this._time, (d = this._yoyoEase || this.vars.yoyoEase) && (this._yoyoEase || (!0 !== d || this._initted ? this._yoyoEase = d = !0 === d ? this._ease : d instanceof r.b ? d : r.b.map[d] : (d = this.vars.ease, this._yoyoEase = d = d ? d instanceof r.b ? d : "function" == typeof d ? new r.b(d, this.vars.easeParams) : r.b.map[d] || r.l.defaultEase : r.l.defaultEase)), this.ratio = d ? 1 - d.getRatio((v - this._time) / v) : 0)), this._time > v ? this._time = v : this._time < 0 && (this._time = 0)), this._easeType && !d ? (u = this._time / v, h = this._easeType, c = this._easePower, (1 === h || 3 === h && u >= .5) && (u = 1 - u), 3 === h && (u *= 2), 1 === c ? u *= u : 2 === c ? u *= u * u : 3 === c ? u *= u * u * u : 4 === c && (u *= u * u * u * u), this.ratio = 1 === h ? 1 - u : 2 === h ? u : this._time / v < .5 ? u / 2 : 1 - u / 2) : d || (this.ratio = this._ease.getRatio(this._time / v))), m !== this._time || i || g !== this._cycle) {
if (!this._initted) {
if (this._init(), !this._initted || this._gc) return;
if (!i && this._firstPT && (!1 !== this.vars.lazy && this._duration || this.vars.lazy && !this._duration)) return this._time = m, this._totalTime = _, this._rawPrevTime = y, this._cycle = g, s.lazyTweens.push(this), void (this._lazy = [t, e]);
!this._time || n || d ? n && this._ease._calcEnd && !d && (this.ratio = this._ease.getRatio(0 === this._time ? 0 : 1)) : this.ratio = this._ease.getRatio(this._time / v)
}
for (!1 !== this._lazy && (this._lazy = !1), this._active || !this._paused && this._time !== m && t >= 0 && (this._active = !0), 0 === _ && (2 === this._initted && t > 0 && this._init(), this._startAt && (t >= 0 ? this._startAt.render(t, !0, i) : a || (a = "_dummyGS")), this.vars.onStart && (0 === this._totalTime && 0 !== v || e || this._callback("onStart"))), o = this._firstPT; o;) o.f ? o.t[o.p](o.c * this.ratio + o.s) : o.t[o.p] = o.c * this.ratio + o.s, o = o._next;
this._onUpdate && (t < 0 && this._startAt && this._startTime && this._startAt.render(t, !0, i), e || (this._totalTime !== _ || a) && this._callback("onUpdate")), this._cycle !== g && (e || this._gc || this.vars.onRepeat && this._callback("onRepeat")), a && (this._gc && !i || (t < 0 && this._startAt && !this._onUpdate && this._startTime && this._startAt.render(t, !0, i), n && (this._timeline.autoRemoveChildren && this._enabled(!1, !1), this._active = !1), !e && this.vars[a] && this._callback(a), 0 === v && 1e-8 === this._rawPrevTime && 1e-8 !== f && (this._rawPrevTime = 0)))
} else _ !== this._totalTime && this._onUpdate && (e || this._callback("onUpdate"))
}, n.to = function (t, e, i) {
return new n(t, e, i)
}, n.from = function (t, e, i) {
return i.runBackwards = !0, i.immediateRender = 0 != i.immediateRender, new n(t, e, i)
}, n.fromTo = function (t, e, i, r) {
return r.startAt = i, r.immediateRender = 0 != r.immediateRender && 0 != i.immediateRender, new n(t, e, r)
}, n.staggerTo = n.allTo = function (s, l, h, c, f, d, p) {
var m, _, g, v, y = [],
b = i(h.stagger || c),
w = h.cycle,
x = (h.startAt || u).cycle;
for (o(s) || ("string" == typeof s && (s = r.l.selector(s) || s), a(s) && (s = t(s))), m = (s = s || []).length - 1, g = 0; g <= m; g++) {
for (v in _ = {}, h) _[v] = h[v];
if (w && (e(_, s, g), null != _.duration && (l = _.duration, delete _.duration)), x) {
for (v in x = _.startAt = {}, h.startAt) x[v] = h.startAt[v];
e(_.startAt, s, g)
}
_.delay = b(g, s[g], s) + (_.delay || 0), g === m && f && (_.onComplete = function () {
h.onComplete && h.onComplete.apply(h.onCompleteScope || this, arguments), f.apply(p || h.callbackScope || this, d || u)
}), y[g] = new n(s[g], l, _)
}
return y
}, n.staggerFrom = n.allFrom = function (t, e, i, r, s, a, o) {
return i.runBackwards = !0, i.immediateRender = 0 != i.immediateRender, n.staggerTo(t, e, i, r, s, a, o)
}, n.staggerFromTo = n.allFromTo = function (t, e, i, r, s, a, o, l) {
return r.startAt = i, r.immediateRender = 0 != r.immediateRender && 0 != i.immediateRender, n.staggerTo(t, e, r, s, a, o, l)
}, n.delayedCall = function (t, e, i, r, s) {
return new n(e, 0, {
delay: t,
onComplete: e,
onCompleteParams: i,
callbackScope: r,
onReverseComplete: e,
onReverseCompleteParams: i,
immediateRender: !1,
useFrames: s,
overwrite: 0
})
}, n.set = function (t, e) {
return new n(t, 0, e)
}, n.isTweening = function (t) {
return r.l.getTweensOf(t, !0).length > 0
};
var h = function (t, e) {
for (var i = [], n = 0, s = t._first; s;) s instanceof r.l ? i[n++] = s : (e && (i[n++] = s), n = (i = i.concat(h(s, e))).length), s = s._next;
return i
},
c = n.getAllTweens = function (t) {
return h(r.a._rootTimeline, t).concat(h(r.a._rootFramesTimeline, t))
};
n.killAll = function (t, e, i, n) {
null == e && (e = !0), null == i && (i = !0);
var s, a, o, l = c(0 != n),
u = l.length,
h = e && i && n;
for (o = 0; o < u; o++) a = l[o], (h || a instanceof r.i || (s = a.target === a.vars.onComplete) && i || e && !s) && (t ? a.totalTime(a._reversed ? 0 : a.totalDuration()) : a._enabled(!1, !1))
}, n.killChildTweensOf = function (e, i) {
if (null != e) {
var l, u, h, c, f, d = s.tweenLookup;
if ("string" == typeof e && (e = r.l.selector(e) || e), a(e) && (e = t(e)), o(e))
for (c = e.length; --c > -1;) n.killChildTweensOf(e[c], i);
else {
for (h in l = [], d)
for (u = d[h].target.parentNode; u;) u === e && (l = l.concat(d[h].tweens)), u = u.parentNode;
for (f = l.length, c = 0; c < f; c++) i && l[c].totalTime(l[c].totalDuration()), l[c]._enabled(!1, !1)
}
}
};
var f = function (t, e, i, n) {
e = !1 !== e, i = !1 !== i;
for (var s, a, o = c(n = !1 !== n), l = e && i && n, u = o.length; --u > -1;) a = o[u], (l || a instanceof r.i || (s = a.target === a.vars.onComplete) && i || e && !s) && a.paused(t)
};
return n.pauseAll = function (t, e, i) {
f(!0, t, e, i)
}, n.resumeAll = function (t, e, i) {
f(!1, t, e, i)
}, n.globalTimeScale = function (t) {
var e = r.a._rootTimeline,
i = r.l.ticker.time;
return arguments.length ? (t = t || 1e-8, e._startTime = i - (i - e._startTime) * e._timeScale / t, e = r.a._rootFramesTimeline, i = r.l.ticker.frame, e._startTime = i - (i - e._startTime) * e._timeScale / t, e._timeScale = r.a._rootTimeline._timeScale = t, t) : e._timeScale
}, l.progress = function (t, e) {
return arguments.length ? this.totalTime(this.duration() * (this._yoyo && 0 != (1 & this._cycle) ? 1 - t : t) + this._cycle * (this._duration + this._repeatDelay), e) : this.duration() ? this._time / this._duration : this.ratio
}, l.totalProgress = function (t, e) {
return arguments.length ? this.totalTime(this.totalDuration() * t, e) : this._totalTime / this.totalDuration()
}, l.time = function (t, e) {
if (!arguments.length) return this._time;
this._dirty && this.totalDuration();
var i = this._duration,
r = this._cycle,
n = r * (i + this._repeatDelay);
return t > i && (t = i), this.totalTime(this._yoyo && 1 & r ? i - t + n : this._repeat ? t + n : t, e)
}, l.duration = function (t) {
return arguments.length ? r.a.prototype.duration.call(this, t) : this._duration
}, l.totalDuration = function (t) {
return arguments.length ? -1 === this._repeat ? this : this.duration((t - this._repeat * this._repeatDelay) / (this._repeat + 1)) : (this._dirty && (this._totalDuration = -1 === this._repeat ? 999999999999 : this._duration * (this._repeat + 1) + this._repeatDelay * this._repeat, this._dirty = !1), this._totalDuration)
}, l.repeat = function (t) {
return arguments.length ? (this._repeat = t, this._uncache(!0)) : this._repeat
}, l.repeatDelay = function (t) {
return arguments.length ? (this._repeatDelay = t, this._uncache(!0)) : this._repeatDelay
}, l.yoyo = function (t) {
return arguments.length ? (this._yoyo = t, this) : this._yoyo
}, n
}, !0);
var n = r.m.TweenMax;
/*!
* VERSION: 2.1.3
* DATE: 2019-05-17
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
*/
r.k._gsDefine("plugins.CSSPlugin", ["plugins.TweenPlugin", "TweenLite"], function () {
var t, e, i, n, s = function () {
r.j.call(this, "css"), this._overwriteProps.length = 0, this.setRatio = s.prototype.setRatio
},
a = r.k._gsDefine.globals,
o = {},
l = s.prototype = new r.j("css");
l.constructor = s, s.version = "2.1.3", s.API = 2, s.defaultTransformPerspective = 0, s.defaultSkewType = "compensated", s.defaultSmoothOrigin = !0, l = "px", s.suffixMap = {
top: l,
right: l,
bottom: l,
left: l,
width: l,
height: l,
fontSize: l,
padding: l,
margin: l,
perspective: l,
lineHeight: ""
};
var u, h, c, f, d, p, m, _, g = /(?:\-|\.|\b)(\d|\.|e\-)+/g,
v = /(?:\d|\-\d|\.\d|\-\.\d|\+=\d|\-=\d|\+=.\d|\-=\.\d)+/g,
y = /(?:\+=|\-=|\-|\b)[\d\-\.]+[a-zA-Z0-9]*(?:%|\b)/gi,
b = /(?:\+=|\-=|\-|\b)[\d\-\.]+[a-zA-Z0-9]*(?:%|\b),?/gi,
w = /(?![+-]?\d*\.?\d+|[+-]|e[+-]\d+)[^0-9]/g,
x = /(?:\d|\-|\+|=|#|\.)*/g,
T = /opacity *= *([^)]*)/i,
k = /opacity:([^;]*)/i,
P = /alpha\(opacity *=.+?\)/i,
O = /^(rgb|hsl)/,
S = /([A-Z])/g,
C = /-([a-z])/gi,
A = /(^(?:url\(\"|url\())|(?:(\"\))$|\)$)/gi,
R = function (t, e) {
return e.toUpperCase()
},
M = /(?:Left|Right|Width)/i,
I = /(M11|M12|M21|M22)=[\d\-\.e]+/gi,
L = /progid\:DXImageTransform\.Microsoft\.Matrix\(.+?\)/i,
E = /,(?=[^\)]*(?:\(|$))/gi,
D = /[\s,\(]/i,
j = Math.PI / 180,
z = 180 / Math.PI,
F = {},
N = {
style: {}
},
X = r.k.document || {
createElement: function () {
return N
}
},
B = function (t, e) {
var i = X.createElementNS ? X.createElementNS(e || "http://www.w3.org/1999/xhtml", t) : X.createElement(t);
return i.style ? i : X.createElement(t)
},
Y = B("div"),
U = B("img"),
V = s._internals = {
_specialProps: o
},
q = (r.k.navigator || {}).userAgent || "",
W = function () {
var t = q.indexOf("Android"),
e = B("a");
return c = -1 !== q.indexOf("Safari") && -1 === q.indexOf("Chrome") && (-1 === t || parseFloat(q.substr(t + 8, 2)) > 3), d = c && parseFloat(q.substr(q.indexOf("Version/") + 8, 2)) < 6, f = -1 !== q.indexOf("Firefox"), (/MSIE ([0-9]{1,}[\.0-9]{0,})/.exec(q) || /Trident\/.*rv:([0-9]{1,}[\.0-9]{0,})/.exec(q)) && (p = parseFloat(RegExp.$1)), !!e && (e.style.cssText = "top:1px;opacity:.55;", /^0.55/.test(e.style.opacity))
}(),
Z = function (t) {
return T.test("string" == typeof t ? t : (t.currentStyle ? t.currentStyle.filter : t.style.filter) || "") ? parseFloat(RegExp.$1) / 100 : 1
},
G = function (t) {
r.k.console && console.log(t)
},
H = "",
$ = "",
Q = function (t, e) {
var i, r, n = (e = e || Y).style;
if (void 0 !== n[t]) return t;
for (t = t.charAt(0).toUpperCase() + t.substr(1), i = ["O", "Moz", "ms", "Ms", "Webkit"], r = 5; --r > -1 && void 0 === n[i[r] + t];);
return r >= 0 ? (H = "-" + ($ = 3 === r ? "ms" : i[r]).toLowerCase() + "-", $ + t) : null
},
J = "undefined" != typeof window ? window : X.defaultView || {
getComputedStyle: function () { }
},
K = function (t) {
return J.getComputedStyle(t)
},
tt = s.getStyle = function (t, e, i, r, n) {
var s;
return W || "opacity" !== e ? (!r && t.style[e] ? s = t.style[e] : (i = i || K(t)) ? s = i[e] || i.getPropertyValue(e) || i.getPropertyValue(e.replace(S, "-$1").toLowerCase()) : t.currentStyle && (s = t.currentStyle[e]), null == n || s && "none" !== s && "auto" !== s && "auto auto" !== s ? s : n) : Z(t)
},
et = V.convertToPixels = function (t, e, i, n, a) {
if ("px" === n || !n && "lineHeight" !== e) return i;
if ("auto" === n || !i) return 0;
var o, l, u, h = M.test(e),
c = t,
f = Y.style,
d = i < 0,
p = 1 === i;
if (d && (i = -i), p && (i *= 100), "lineHeight" !== e || n)
if ("%" === n && -1 !== e.indexOf("border")) o = i / 100 * (h ? t.clientWidth : t.clientHeight);
else {
if (f.cssText = "border:0 solid red;position:" + tt(t, "position") + ";line-height:0;", "%" !== n && c.appendChild && "v" !== n.charAt(0) && "rem" !== n) f[h ? "borderLeftWidth" : "borderTopWidth"] = i + n;
else {
if (c = t.parentNode || X.body, -1 !== tt(c, "display").indexOf("flex") && (f.position = "absolute"), l = c._gsCache, u = r.l.ticker.frame, l && h && l.time === u) return l.width * i / 100;
f[h ? "width" : "height"] = i + n
}
c.appendChild(Y), o = parseFloat(Y[h ? "offsetWidth" : "offsetHeight"]), c.removeChild(Y), h && "%" === n && !1 !== s.cacheWidths && ((l = c._gsCache = c._gsCache || {}).time = u, l.width = o / i * 100), 0 !== o || a || (o = et(t, e, i, n, !0))
}
else l = K(t).lineHeight, t.style.lineHeight = i, o = parseFloat(K(t).lineHeight), t.style.lineHeight = l;
return p && (o /= 100), d ? -o : o
},
it = V.calculateOffset = function (t, e, i) {
if ("absolute" !== tt(t, "position", i)) return 0;
var r = "left" === e ? "Left" : "Top",
n = tt(t, "margin" + r, i);
return t["offset" + r] - (et(t, e, parseFloat(n), n.replace(x, "")) || 0)
},
rt = function (t, e) {
var i, r, n, s = {};
if (e = e || K(t))
if (i = e.length)
for (; --i > -1;) - 1 !== (n = e[i]).indexOf("-transform") && Rt !== n || (s[n.replace(C, R)] = e.getPropertyValue(n));
else
for (i in e) - 1 !== i.indexOf("Transform") && At !== i || (s[i] = e[i]);
else if (e = t.currentStyle || t.style)
for (i in e) "string" == typeof i && void 0 === s[i] && (s[i.replace(C, R)] = e[i]);
return W || (s.opacity = Z(t)), r = Ut(t, e, !1), s.rotation = r.rotation, s.skewX = r.skewX, s.scaleX = r.scaleX, s.scaleY = r.scaleY, s.x = r.x, s.y = r.y, It && (s.z = r.z, s.rotationX = r.rotationX, s.rotationY = r.rotationY, s.scaleZ = r.scaleZ), s.filters && delete s.filters, s
},
nt = function (t, e, i, r, n) {
var s, a, o, l = {},
u = t.style;
for (a in i) "cssText" !== a && "length" !== a && isNaN(a) && (e[a] !== (s = i[a]) || n && n[a]) && -1 === a.indexOf("Origin") && ("number" != typeof s && "string" != typeof s || (l[a] = "auto" !== s || "left" !== a && "top" !== a ? "" !== s && "auto" !== s && "none" !== s || "string" != typeof e[a] || "" === e[a].replace(w, "") ? s : 0 : it(t, a), void 0 !== u[a] && (o = new yt(u, a, u[a], o))));
if (r)
for (a in r) "className" !== a && (l[a] = r[a]);
return {
difs: l,
firstMPT: o
}
},
st = {
width: ["Left", "Right"],
height: ["Top", "Bottom"]
},
at = ["marginLeft", "marginRight", "marginTop", "marginBottom"],
ot = function (t, e, i) {
if ("svg" === (t.nodeName + "").toLowerCase()) return (i || K(t))[e] || 0;
if (t.getCTM && Xt(t)) return t.getBBox()[e] || 0;
var r = parseFloat("width" === e ? t.offsetWidth : t.offsetHeight),
n = st[e],
s = n.length;
for (i = i || K(t); --s > -1;) r -= parseFloat(tt(t, "padding" + n[s], i, !0)) || 0, r -= parseFloat(tt(t, "border" + n[s] + "Width", i, !0)) || 0;
return r
},
lt = function (t, e) {
if ("contain" === t || "auto" === t || "auto auto" === t) return t + " ";
null != t && "" !== t || (t = "0 0");
var i, r = t.split(" "),
n = -1 !== t.indexOf("left") ? "0%" : -1 !== t.indexOf("right") ? "100%" : r[0],
s = -1 !== t.indexOf("top") ? "0%" : -1 !== t.indexOf("bottom") ? "100%" : r[1];
if (r.length > 3 && !e) {
for (r = t.split(", ").join(",").split(","), t = [], i = 0; i < r.length; i++) t.push(lt(r[i]));
return t.join(",")
}
return null == s ? s = "center" === n ? "50%" : "0" : "center" === s && (s = "50%"), ("center" === n || isNaN(parseFloat(n)) && -1 === (n + "").indexOf("=")) && (n = "50%"), t = n + " " + s + (r.length > 2 ? " " + r[2] : ""), e && (e.oxp = -1 !== n.indexOf("%"), e.oyp = -1 !== s.indexOf("%"), e.oxr = "=" === n.charAt(1), e.oyr = "=" === s.charAt(1), e.ox = parseFloat(n.replace(w, "")), e.oy = parseFloat(s.replace(w, "")), e.v = t), e || t
},
ut = function (t, e) {
return "function" == typeof t && (t = t(_, m)), "string" == typeof t && "=" === t.charAt(1) ? parseInt(t.charAt(0) + "1", 10) * parseFloat(t.substr(2)) : parseFloat(t) - parseFloat(e) || 0
},
ht = function (t, e) {
"function" == typeof t && (t = t(_, m));
var i = "string" == typeof t && "=" === t.charAt(1);
return "string" == typeof t && "v" === t.charAt(t.length - 2) && (t = (i ? t.substr(0, 2) : 0) + window["inner" + ("vh" === t.substr(-2) ? "Height" : "Width")] * (parseFloat(i ? t.substr(2) : t) / 100)), null == t ? e : i ? parseInt(t.charAt(0) + "1", 10) * parseFloat(t.substr(2)) + e : parseFloat(t) || 0
},
ct = function (t, e, i, r) {
var n, s, a, o, l;
return "function" == typeof t && (t = t(_, m)), null == t ? o = e : "number" == typeof t ? o = t : (n = 360, s = t.split("_"), a = ((l = "=" === t.charAt(1)) ? parseInt(t.charAt(0) + "1", 10) * parseFloat(s[0].substr(2)) : parseFloat(s[0])) * (-1 === t.indexOf("rad") ? 1 : z) - (l ? 0 : e), s.length && (r && (r[i] = e + a), -1 !== t.indexOf("short") && (a %= n) !== a % (n / 2) && (a = a < 0 ? a + n : a - n), -1 !== t.indexOf("_cw") && a < 0 ? a = (a + 9999999999 * n) % n - (a / n | 0) * n : -1 !== t.indexOf("ccw") && a > 0 && (a = (a - 9999999999 * n) % n - (a / n | 0) * n)), o = e + a), o < 1e-6 && o > -1e-6 && (o = 0), o
},
ft = {
aqua: [0, 255, 255],
lime: [0, 255, 0],
silver: [192, 192, 192],
black: [0, 0, 0],
maroon: [128, 0, 0],
teal: [0, 128, 128],
blue: [0, 0, 255],
navy: [0, 0, 128],
white: [255, 255, 255],
fuchsia: [255, 0, 255],
olive: [128, 128, 0],
yellow: [255, 255, 0],
orange: [255, 165, 0],
gray: [128, 128, 128],
purple: [128, 0, 128],
green: [0, 128, 0],
red: [255, 0, 0],
pink: [255, 192, 203],
cyan: [0, 255, 255],
transparent: [255, 255, 255, 0]
},
dt = function (t, e, i) {
return 255 * (6 * (t = t < 0 ? t + 1 : t > 1 ? t - 1 : t) < 1 ? e + (i - e) * t * 6 : t < .5 ? i : 3 * t < 2 ? e + (i - e) * (2 / 3 - t) * 6 : e) + .5 | 0
},
pt = s.parseColor = function (t, e) {
var i, r, n, s, a, o, l, u, h, c, f;
if (t)
if ("number" == typeof t) i = [t >> 16, t >> 8 & 255, 255 & t];
else {
if ("," === t.charAt(t.length - 1) && (t = t.substr(0, t.length - 1)), ft[t]) i = ft[t];
else if ("#" === t.charAt(0)) 4 === t.length && (t = "#" + (r = t.charAt(1)) + r + (n = t.charAt(2)) + n + (s = t.charAt(3)) + s), i = [(t = parseInt(t.substr(1), 16)) >> 16, t >> 8 & 255, 255 & t];
else if ("hsl" === t.substr(0, 3))
if (i = f = t.match(g), e) {
if (-1 !== t.indexOf("=")) return t.match(v)
} else a = Number(i[0]) % 360 / 360, o = Number(i[1]) / 100, r = 2 * (l = Number(i[2]) / 100) - (n = l <= .5 ? l * (o + 1) : l + o - l * o), i.length > 3 && (i[3] = Number(i[3])), i[0] = dt(a + 1 / 3, r, n), i[1] = dt(a, r, n), i[2] = dt(a - 1 / 3, r, n);
else i = t.match(g) || ft.transparent;
i[0] = Number(i[0]), i[1] = Number(i[1]), i[2] = Number(i[2]), i.length > 3 && (i[3] = Number(i[3]))
}
else i = ft.black;
return e && !f && (r = i[0] / 255, n = i[1] / 255, s = i[2] / 255, l = ((u = Math.max(r, n, s)) + (h = Math.min(r, n, s))) / 2, u === h ? a = o = 0 : (c = u - h, o = l > .5 ? c / (2 - u - h) : c / (u + h), a = u === r ? (n - s) / c + (n < s ? 6 : 0) : u === n ? (s - r) / c + 2 : (r - n) / c + 4, a *= 60), i[0] = a + .5 | 0, i[1] = 100 * o + .5 | 0, i[2] = 100 * l + .5 | 0), i
},
mt = function (t, e) {
var i, r, n, s = t.match(_t) || [],
a = 0,
o = "";
if (!s.length) return t;
for (i = 0; i < s.length; i++) r = s[i], a += (n = t.substr(a, t.indexOf(r, a) - a)).length + r.length, 3 === (r = pt(r, e)).length && r.push(1), o += n + (e ? "hsla(" + r[0] + "," + r[1] + "%," + r[2] + "%," + r[3] : "rgba(" + r.join(",")) + ")";
return o + t.substr(a)
},
_t = "(?:\\b(?:(?:rgb|rgba|hsl|hsla)\\(.+?\\))|\\B#(?:[0-9a-f]{3}){1,2}\\b";
for (l in ft) _t += "|" + l + "\\b";
_t = new RegExp(_t + ")", "gi"), s.colorStringFilter = function (t) {
var e, i = t[0] + " " + t[1];
_t.test(i) && (e = -1 !== i.indexOf("hsl(") || -1 !== i.indexOf("hsla("), t[0] = mt(t[0], e), t[1] = mt(t[1], e)), _t.lastIndex = 0
}, r.l.defaultStringFilter || (r.l.defaultStringFilter = s.colorStringFilter);
var gt = function (t, e, i, r) {
if (null == t) return function (t) {
return t
};
var n, s = e ? (t.match(_t) || [""])[0] : "",
a = t.split(s).join("").match(y) || [],
o = t.substr(0, t.indexOf(a[0])),
l = ")" === t.charAt(t.length - 1) ? ")" : "",
u = -1 !== t.indexOf(" ") ? " " : ",",
h = a.length,
c = h > 0 ? a[0].replace(g, "") : "";
return h ? n = e ? function (t) {
var e, f, d, p;
if ("number" == typeof t) t += c;
else if (r && E.test(t)) {
for (p = t.replace(E, "|").split("|"), d = 0; d < p.length; d++) p[d] = n(p[d]);
return p.join(",")
}
if (e = (t.match(_t) || [s])[0], d = (f = t.split(e).join("").match(y) || []).length, h > d--)
for (; ++d < h;) f[d] = i ? f[(d - 1) / 2 | 0] : a[d];
return o + f.join(u) + u + e + l + (-1 !== t.indexOf("inset") ? " inset" : "")
} : function (t) {
var e, s, f;
if ("number" == typeof t) t += c;
else if (r && E.test(t)) {
for (s = t.replace(E, "|").split("|"), f = 0; f < s.length; f++) s[f] = n(s[f]);
return s.join(",")
}
if (f = (e = t.match("," === u ? y : b) || []).length, h > f--)
for (; ++f < h;) e[f] = i ? e[(f - 1) / 2 | 0] : a[f];
return (o && "none" !== t && t.substr(0, t.indexOf(e[0])) || o) + e.join(u) + l
} : function (t) {
return t
}
},
vt = function (t) {
return t = t.split(","),
function (e, i, r, n, s, a, o) {
var l, u = (i + "").split(" ");
for (o = {}, l = 0; l < 4; l++) o[t[l]] = u[l] = u[l] || u[(l - 1) / 2 >> 0];
return n.parse(e, o, s, a)
}
},
yt = (V._setPluginRatio = function (t) {
this.plugin.setRatio(t);
for (var e, i, r, n, s, a = this.data, o = a.proxy, l = a.firstMPT; l;) e = o[l.v], l.r ? e = l.r(e) : e < 1e-6 && e > -1e-6 && (e = 0), l.t[l.p] = e, l = l._next;
if (a.autoRotate && (a.autoRotate.rotation = a.mod ? a.mod.call(this._tween, o.rotation, this.t, this._tween) : o.rotation), 1 === t || 0 === t)
for (l = a.firstMPT, s = 1 === t ? "e" : "b"; l;) {
if ((i = l.t).type) {
if (1 === i.type) {
for (n = i.xs0 + i.s + i.xs1, r = 1; r < i.l; r++) n += i["xn" + r] + i["xs" + (r + 1)];
i[s] = n
}
} else i[s] = i.s + i.xs0;
l = l._next
}
}, function (t, e, i, r, n) {
this.t = t, this.p = e, this.v = i, this.r = n, r && (r._prev = this, this._next = r)
}),
bt = (V._parseToProxy = function (t, e, i, r, n, s) {
var a, o, l, u, h, c = r,
f = {},
d = {},
p = i._transform,
m = F;
for (i._transform = null, F = e, r = h = i.parse(t, e, r, n), F = m, s && (i._transform = p, c && (c._prev = null, c._prev && (c._prev._next = null))); r && r !== c;) {
if (r.type <= 1 && (d[o = r.p] = r.s + r.c, f[o] = r.s, s || (u = new yt(r, "s", o, u, r.r), r.c = 0), 1 === r.type))
for (a = r.l; --a > 0;) l = "xn" + a, d[o = r.p + "_" + l] = r.data[l], f[o] = r[l], s || (u = new yt(r, l, o, u, r.rxp[l]));
r = r._next
}
return {
proxy: f,
end: d,
firstMPT: u,
pt: h
}
}, V.CSSPropTween = function (e, i, r, s, a, o, l, u, h, c, f) {
this.t = e, this.p = i, this.s = r, this.c = s, this.n = l || i, e instanceof bt || n.push(this.n), this.r = u ? "function" == typeof u ? u : Math.round : u, this.type = o || 0, h && (this.pr = h, t = !0), this.b = void 0 === c ? r : c, this.e = void 0 === f ? r + s : f, a && (this._next = a, a._prev = this)
}),
wt = function (t, e, i, r, n, s) {
var a = new bt(t, e, i, r - i, n, -1, s);
return a.b = i, a.e = a.xs0 = r, a
},
xt = s.parseComplex = function (t, e, i, r, n, a, o, l, h, c) {
i = i || a || "", "function" == typeof r && (r = r(_, m)), o = new bt(t, e, 0, 0, o, c ? 2 : 1, null, !1, l, i, r), r += "", n && _t.test(r + i) && (r = [i, r], s.colorStringFilter(r), i = r[0], r = r[1]);
var f, d, p, y, b, w, x, T, k, P, O, S, C, A = i.split(", ").join(",").split(" "),
R = r.split(", ").join(",").split(" "),
M = A.length,
I = !1 !== u;
for (-1 === r.indexOf(",") && -1 === i.indexOf(",") || (-1 !== (r + i).indexOf("rgb") || -1 !== (r + i).indexOf("hsl") ? (A = A.join(" ").replace(E, ", ").split(" "), R = R.join(" ").replace(E, ", ").split(" ")) : (A = A.join(" ").split(",").join(", ").split(" "), R = R.join(" ").split(",").join(", ").split(" ")), M = A.length), M !== R.length && (M = (A = (a || "").split(" ")).length), o.plugin = h, o.setRatio = c, _t.lastIndex = 0, f = 0; f < M; f++)
if (y = A[f], b = R[f] + "", (T = parseFloat(y)) || 0 === T) o.appendXtra("", T, ut(b, T), b.replace(v, ""), !(!I || -1 === b.indexOf("px")) && Math.round, !0);
else if (n && _t.test(y)) S = ")" + ((S = b.indexOf(")") + 1) ? b.substr(S) : ""), C = -1 !== b.indexOf("hsl") && W, P = b, y = pt(y, C), b = pt(b, C), (k = y.length + b.length > 6) && !W && 0 === b[3] ? (o["xs" + o.l] += o.l ? " transparent" : "transparent", o.e = o.e.split(R[f]).join("transparent")) : (W || (k = !1), C ? o.appendXtra(P.substr(0, P.indexOf("hsl")) + (k ? "hsla(" : "hsl("), y[0], ut(b[0], y[0]), ",", !1, !0).appendXtra("", y[1], ut(b[1], y[1]), "%,", !1).appendXtra("", y[2], ut(b[2], y[2]), k ? "%," : "%" + S, !1) : o.appendXtra(P.substr(0, P.indexOf("rgb")) + (k ? "rgba(" : "rgb("), y[0], b[0] - y[0], ",", Math.round, !0).appendXtra("", y[1], b[1] - y[1], ",", Math.round).appendXtra("", y[2], b[2] - y[2], k ? "," : S, Math.round), k && (y = y.length < 4 ? 1 : y[3], o.appendXtra("", y, (b.length < 4 ? 1 : b[3]) - y, S, !1))), _t.lastIndex = 0;
else if (w = y.match(g)) {
if (!(x = b.match(v)) || x.length !== w.length) return o;
for (p = 0, d = 0; d < w.length; d++) O = w[d], P = y.indexOf(O, p), o.appendXtra(y.substr(p, P - p), Number(O), ut(x[d], O), "", !(!I || "px" !== y.substr(P + O.length, 2)) && Math.round, 0 === d), p = P + O.length;
o["xs" + o.l] += y.substr(p)
} else o["xs" + o.l] += o.l || o["xs" + o.l] ? " " + b : b;
if (-1 !== r.indexOf("=") && o.data) {
for (S = o.xs0 + o.data.s, f = 1; f < o.l; f++) S += o["xs" + f] + o.data["xn" + f];
o.e = S + o["xs" + f]
}
return o.l || (o.type = -1, o.xs0 = o.e), o.xfirst || o
},
Tt = 9;
for ((l = bt.prototype).l = l.pr = 0; --Tt > 0;) l["xn" + Tt] = 0, l["xs" + Tt] = "";
l.xs0 = "", l._next = l._prev = l.xfirst = l.data = l.plugin = l.setRatio = l.rxp = null, l.appendXtra = function (t, e, i, r, n, s) {
var a = this,
o = a.l;
return a["xs" + o] += s && (o || a["xs" + o]) ? " " + t : t || "", i || 0 === o || a.plugin ? (a.l++, a.type = a.setRatio ? 2 : 1, a["xs" + a.l] = r || "", o > 0 ? (a.data["xn" + o] = e + i, a.rxp["xn" + o] = n, a["xn" + o] = e, a.plugin || (a.xfirst = new bt(a, "xn" + o, e, i, a.xfirst || a, 0, a.n, n, a.pr), a.xfirst.xs0 = 0), a) : (a.data = {
s: e + i
}, a.rxp = {}, a.s = e, a.c = i, a.r = n, a)) : (a["xs" + o] += e + (r || ""), a)
};
var kt = function (t, e) {
e = e || {}, this.p = e.prefix && Q(t) || t, o[t] = o[this.p] = this, this.format = e.formatter || gt(e.defaultValue, e.color, e.collapsible, e.multi), e.parser && (this.parse = e.parser), this.clrs = e.color, this.multi = e.multi, this.keyword = e.keyword, this.dflt = e.defaultValue, this.allowFunc = e.allowFunc, this.pr = e.priority || 0
},
Pt = V._registerComplexSpecialProp = function (t, e, i) {
"object" != typeof e && (e = {
parser: i
});
var r, n = t.split(","),
s = e.defaultValue;
for (i = i || [s], r = 0; r < n.length; r++) e.prefix = 0 === r && e.prefix, e.defaultValue = i[r] || s, new kt(n[r], e)
},
Ot = V._registerPluginProp = function (t) {
if (!o[t]) {
var e = t.charAt(0).toUpperCase() + t.substr(1) + "Plugin";
Pt(t, {
parser: function (t, i, r, n, s, l, u) {
var h = a.com.greensock.plugins[e];
return h ? (h._cssRegister(), o[r].parse(t, i, r, n, s, l, u)) : (G("Error: " + e + " js file not loaded."), s)
}
})
}
};
(l = kt.prototype).parseComplex = function (t, e, i, r, n, s) {
var a, o, l, u, h, c, f = this.keyword;
if (this.multi && (E.test(i) || E.test(e) ? (o = e.replace(E, "|").split("|"), l = i.replace(E, "|").split("|")) : f && (o = [e], l = [i])), l) {
for (u = l.length > o.length ? l.length : o.length, a = 0; a < u; a++) e = o[a] = o[a] || this.dflt, i = l[a] = l[a] || this.dflt, f && (h = e.indexOf(f)) !== (c = i.indexOf(f)) && (-1 === c ? o[a] = o[a].split(f).join("") : -1 === h && (o[a] += " " + f));
e = o.join(", "), i = l.join(", ")
}
return xt(t, this.p, e, i, this.clrs, this.dflt, r, this.pr, n, s)
}, l.parse = function (t, e, r, n, s, a, o) {
return this.parseComplex(t.style, this.format(tt(t, this.p, i, !1, this.dflt)), this.format(e), s, a)
}, s.registerSpecialProp = function (t, e, i) {
Pt(t, {
parser: function (t, r, n, s, a, o, l) {
var u = new bt(t, n, 0, 0, a, 2, n, !1, i);
return u.plugin = o, u.setRatio = e(t, r, s._tween, n), u
},
priority: i
})
}, s.useSVGTransformAttr = !0;
var St, Ct = "scaleX,scaleY,scaleZ,x,y,z,skewX,skewY,rotation,rotationX,rotationY,perspective,xPercent,yPercent".split(","),
At = Q("transform"),
Rt = H + "transform",
Mt = Q("transformOrigin"),
It = null !== Q("perspective"),
Lt = V.Transform = function () {
this.perspective = parseFloat(s.defaultTransformPerspective) || 0, this.force3D = !(!1 === s.defaultForce3D || !It) && (s.defaultForce3D || "auto")
},
Et = r.k.SVGElement,
Dt = function (t, e, i) {
var r, n = X.createElementNS("http://www.w3.org/2000/svg", t),
s = /([a-z])([A-Z])/g;
for (r in i) n.setAttributeNS(null, r.replace(s, "$1-$2").toLowerCase(), i[r]);
return e.appendChild(n), n
},
jt = X.documentElement || {},
zt = function () {
var t, e, i, n = p || /Android/i.test(q) && !r.k.chrome;
return X.createElementNS && jt.appendChild && !n && (t = Dt("svg", jt), i = (e = Dt("rect", t, {
width: 100,
height: 50,
x: 100
})).getBoundingClientRect().width, e.style[Mt] = "50% 50%", e.style[At] = "scaleX(0.5)", n = i === e.getBoundingClientRect().width && !(f && It), jt.removeChild(t)), n
}(),
Ft = function (t, e, i, r, n, a) {
var o, l, u, h, c, f, d, p, m, _, g, v, y, b, w = t._gsTransform,
x = Yt(t, !0);
w && (y = w.xOrigin, b = w.yOrigin), (!r || (o = r.split(" ")).length < 2) && (0 === (d = t.getBBox()).x && 0 === d.y && d.width + d.height === 0 && (d = {
x: parseFloat(t.hasAttribute("x") ? t.getAttribute("x") : t.hasAttribute("cx") ? t.getAttribute("cx") : 0) || 0,
y: parseFloat(t.hasAttribute("y") ? t.getAttribute("y") : t.hasAttribute("cy") ? t.getAttribute("cy") : 0) || 0,
width: 0,
height: 0
}), o = [(-1 !== (e = lt(e).split(" "))[0].indexOf("%") ? parseFloat(e[0]) / 100 * d.width : parseFloat(e[0])) + d.x, (-1 !== e[1].indexOf("%") ? parseFloat(e[1]) / 100 * d.height : parseFloat(e[1])) + d.y]), i.xOrigin = h = parseFloat(o[0]), i.yOrigin = c = parseFloat(o[1]), r && x !== Bt && (f = x[0], d = x[1], p = x[2], m = x[3], _ = x[4], g = x[5], (v = f * m - d * p) && (l = h * (m / v) + c * (-p / v) + (p * g - m * _) / v, u = h * (-d / v) + c * (f / v) - (f * g - d * _) / v, h = i.xOrigin = o[0] = l, c = i.yOrigin = o[1] = u)), w && (a && (i.xOffset = w.xOffset, i.yOffset = w.yOffset, w = i), n || !1 !== n && !1 !== s.defaultSmoothOrigin ? (l = h - y, u = c - b, w.xOffset += l * x[0] + u * x[2] - l, w.yOffset += l * x[1] + u * x[3] - u) : w.xOffset = w.yOffset = 0), a || t.setAttribute("data-svg-origin", o.join(" "))
},
Nt = function (t) {
var e, i = B("svg", this.ownerSVGElement && this.ownerSVGElement.getAttribute("xmlns") || "http://www.w3.org/2000/svg"),
r = this.parentNode,
n = this.nextSibling,
s = this.style.cssText;
if (jt.appendChild(i), i.appendChild(this), this.style.display = "block", t) try {
e = this.getBBox(), this._originalGetBBox = this.getBBox, this.getBBox = Nt
} catch (t) { } else this._originalGetBBox && (e = this._originalGetBBox());
return n ? r.insertBefore(this, n) : r.appendChild(this), jt.removeChild(i), this.style.cssText = s, e
},
Xt = function (t) {
return !(!Et || !t.getCTM || t.parentNode && !t.ownerSVGElement || ! function (t) {
try {
return t.getBBox()
} catch (e) {
return Nt.call(t, !0)
}
}(t))
},
Bt = [1, 0, 0, 1, 0, 0],
Yt = function (t, e) {
var i, r, n, s, a, o, l, u = t._gsTransform || new Lt,
h = t.style;
if (At ? r = tt(t, Rt, null, !0) : t.currentStyle && (r = (r = t.currentStyle.filter.match(I)) && 4 === r.length ? [r[0].substr(4), Number(r[2].substr(4)), Number(r[1].substr(4)), r[3].substr(4), u.x || 0, u.y || 0].join(",") : ""), i = !r || "none" === r || "matrix(1, 0, 0, 1, 0, 0)" === r, At && i && !t.offsetParent && t !== jt && (s = h.display, h.display = "block", (l = t.parentNode) && t.offsetParent || (a = 1, o = t.nextSibling, jt.appendChild(t)), i = !(r = tt(t, Rt, null, !0)) || "none" === r || "matrix(1, 0, 0, 1, 0, 0)" === r, s ? h.display = s : Zt(h, "display"), a && (o ? l.insertBefore(t, o) : l ? l.appendChild(t) : jt.removeChild(t))), (u.svg || t.getCTM && Xt(t)) && (i && -1 !== (h[At] + "").indexOf("matrix") && (r = h[At], i = 0), n = t.getAttribute("transform"), i && n && (r = "matrix(" + (n = t.transform.baseVal.consolidate().matrix).a + "," + n.b + "," + n.c + "," + n.d + "," + n.e + "," + n.f + ")", i = 0)), i) return Bt;
for (n = (r || "").match(g) || [], Tt = n.length; --Tt > -1;) s = Number(n[Tt]), n[Tt] = (a = s - (s |= 0)) ? (1e5 * a + (a < 0 ? -.5 : .5) | 0) / 1e5 + s : s;
return e && n.length > 6 ? [n[0], n[1], n[4], n[5], n[12], n[13]] : n
},
Ut = V.getTransform = function (t, e, i, n) {
if (t._gsTransform && i && !n) return t._gsTransform;
var a, o, l, u, h, c, f = i && t._gsTransform || new Lt,
d = f.scaleX < 0,
p = It && (parseFloat(tt(t, Mt, e, !1, "0 0 0").split(" ")[2]) || f.zOrigin) || 0,
m = parseFloat(s.defaultTransformPerspective) || 0;
if (f.svg = !(!t.getCTM || !Xt(t)), f.svg && (Ft(t, tt(t, Mt, e, !1, "50% 50%") + "", f, t.getAttribute("data-svg-origin")), St = s.useSVGTransformAttr || zt), (a = Yt(t)) !== Bt) {
if (16 === a.length) {
var _, g, v, y, b, w = a[0],
x = a[1],
T = a[2],
k = a[3],
P = a[4],
O = a[5],
S = a[6],
C = a[7],
A = a[8],
R = a[9],
M = a[10],
I = a[12],
L = a[13],
E = a[14],
D = a[11],
j = Math.atan2(S, M);
f.zOrigin && (I = A * (E = -f.zOrigin) - a[12], L = R * E - a[13], E = M * E + f.zOrigin - a[14]), f.rotationX = j * z, j && (_ = P * (y = Math.cos(-j)) + A * (b = Math.sin(-j)), g = O * y + R * b, v = S * y + M * b, A = P * -b + A * y, R = O * -b + R * y, M = S * -b + M * y, D = C * -b + D * y, P = _, O = g, S = v), j = Math.atan2(-T, M), f.rotationY = j * z, j && (g = x * (y = Math.cos(-j)) - R * (b = Math.sin(-j)), v = T * y - M * b, R = x * b + R * y, M = T * b + M * y, D = k * b + D * y, w = _ = w * y - A * b, x = g, T = v), j = Math.atan2(x, w), f.rotation = j * z, j && (_ = w * (y = Math.cos(j)) + x * (b = Math.sin(j)), g = P * y + O * b, v = A * y + R * b, x = x * y - w * b, O = O * y - P * b, R = R * y - A * b, w = _, P = g, A = v), f.rotationX && Math.abs(f.rotationX) + Math.abs(f.rotation) > 359.9 && (f.rotationX = f.rotation = 0, f.rotationY = 180 - f.rotationY), j = Math.atan2(P, O), f.scaleX = (1e5 * Math.sqrt(w * w + x * x + T * T) + .5 | 0) / 1e5, f.scaleY = (1e5 * Math.sqrt(O * O + S * S) + .5 | 0) / 1e5, f.scaleZ = (1e5 * Math.sqrt(A * A + R * R + M * M) + .5 | 0) / 1e5, w /= f.scaleX, P /= f.scaleY, x /= f.scaleX, O /= f.scaleY, Math.abs(j) > 2e-5 ? (f.skewX = j * z, P = 0, "simple" !== f.skewType && (f.scaleY *= 1 / Math.cos(j))) : f.skewX = 0, f.perspective = D ? 1 / (D < 0 ? -D : D) : 0, f.x = I, f.y = L, f.z = E, f.svg && (f.x -= f.xOrigin - (f.xOrigin * w - f.yOrigin * P), f.y -= f.yOrigin - (f.yOrigin * x - f.xOrigin * O))
} else if (!It || n || !a.length || f.x !== a[4] || f.y !== a[5] || !f.rotationX && !f.rotationY) {
var F = a.length >= 6,
N = F ? a[0] : 1,
X = a[1] || 0,
B = a[2] || 0,
Y = F ? a[3] : 1;
f.x = a[4] || 0, f.y = a[5] || 0, l = Math.sqrt(N * N + X * X), u = Math.sqrt(Y * Y + B * B), h = N || X ? Math.atan2(X, N) * z : f.rotation || 0, c = B || Y ? Math.atan2(B, Y) * z + h : f.skewX || 0, f.scaleX = l, f.scaleY = u, f.rotation = h, f.skewX = c, It && (f.rotationX = f.rotationY = f.z = 0, f.perspective = m, f.scaleZ = 1), f.svg && (f.x -= f.xOrigin - (f.xOrigin * N + f.yOrigin * B), f.y -= f.yOrigin - (f.xOrigin * X + f.yOrigin * Y))
}
for (o in Math.abs(f.skewX) > 90 && Math.abs(f.skewX) < 270 && (d ? (f.scaleX *= -1, f.skewX += f.rotation <= 0 ? 180 : -180, f.rotation += f.rotation <= 0 ? 180 : -180) : (f.scaleY *= -1, f.skewX += f.skewX <= 0 ? 180 : -180)), f.zOrigin = p, f) f[o] < 2e-5 && f[o] > -2e-5 && (f[o] = 0)
}
return i && (t._gsTransform = f, f.svg && (St && t.style[At] ? r.l.delayedCall(.001, function () {
Zt(t.style, At)
}) : !St && t.getAttribute("transform") && r.l.delayedCall(.001, function () {
t.removeAttribute("transform")
}))), f
},
Vt = function (t) {
var e, i, r = this.data,
n = -r.rotation * j,
s = n + r.skewX * j,
a = (Math.cos(n) * r.scaleX * 1e5 | 0) / 1e5,
o = (Math.sin(n) * r.scaleX * 1e5 | 0) / 1e5,
l = (Math.sin(s) * -r.scaleY * 1e5 | 0) / 1e5,
u = (Math.cos(s) * r.scaleY * 1e5 | 0) / 1e5,
h = this.t.style,
c = this.t.currentStyle;
if (c) {
i = o, o = -l, l = -i, e = c.filter, h.filter = "";
var f, d, m = this.t.offsetWidth,
_ = this.t.offsetHeight,
g = "absolute" !== c.position,
v = "progid:DXImageTransform.Microsoft.Matrix(M11=" + a + ", M12=" + o + ", M21=" + l + ", M22=" + u,
y = r.x + m * r.xPercent / 100,
b = r.y + _ * r.yPercent / 100;
if (null != r.ox && (y += (f = (r.oxp ? m * r.ox * .01 : r.ox) - m / 2) - (f * a + (d = (r.oyp ? _ * r.oy * .01 : r.oy) - _ / 2) * o), b += d - (f * l + d * u)), v += g ? ", Dx=" + ((f = m / 2) - (f * a + (d = _ / 2) * o) + y) + ", Dy=" + (d - (f * l + d * u) + b) + ")" : ", sizingMethod='auto expand')", -1 !== e.indexOf("DXImageTransform.Microsoft.Matrix(") ? h.filter = e.replace(L, v) : h.filter = v + " " + e, 0 !== t && 1 !== t || 1 === a && 0 === o && 0 === l && 1 === u && (g && -1 === v.indexOf("Dx=0, Dy=0") || T.test(e) && 100 !== parseFloat(RegExp.$1) || -1 === e.indexOf(e.indexOf("Alpha")) && h.removeAttribute("filter")), !g) {
var w, k, P, O = p < 8 ? 1 : -1;
for (f = r.ieOffsetX || 0, d = r.ieOffsetY || 0, r.ieOffsetX = Math.round((m - ((a < 0 ? -a : a) * m + (o < 0 ? -o : o) * _)) / 2 + y), r.ieOffsetY = Math.round((_ - ((u < 0 ? -u : u) * _ + (l < 0 ? -l : l) * m)) / 2 + b), Tt = 0; Tt < 4; Tt++) P = (i = -1 !== (w = c[k = at[Tt]]).indexOf("px") ? parseFloat(w) : et(this.t, k, parseFloat(w), w.replace(x, "")) || 0) !== r[k] ? Tt < 2 ? -r.ieOffsetX : -r.ieOffsetY : Tt < 2 ? f - r.ieOffsetX : d - r.ieOffsetY, h[k] = (r[k] = Math.round(i - P * (0 === Tt || 2 === Tt ? 1 : O))) + "px"
}
}
},
qt = V.set3DTransformRatio = V.setTransformRatio = function (t) {
var e, i, r, n, s, a, o, l, u, h, c, d, p, m, _, g, v, y, b, w, x, T = this.data,
k = this.t.style,
P = T.rotation,
O = T.rotationX,
S = T.rotationY,
C = T.scaleX,
A = T.scaleY,
R = T.scaleZ,
M = T.x,
I = T.y,
L = T.z,
E = T.svg,
D = T.perspective,
z = T.force3D,
F = T.skewY,
N = T.skewX;
if (F && (N += F, P += F), !((1 !== t && 0 !== t || "auto" !== z || this.tween._totalTime !== this.tween._totalDuration && this.tween._totalTime) && z || L || D || S || O || 1 !== R) || St && E || !It) P || N || E ? (P *= j, w = N * j, x = 1e5, i = Math.cos(P) * C, s = Math.sin(P) * C, r = Math.sin(P - w) * -A, a = Math.cos(P - w) * A, w && "simple" === T.skewType && (e = Math.tan(w - F * j), r *= e = Math.sqrt(1 + e * e), a *= e, F && (e = Math.tan(F * j), i *= e = Math.sqrt(1 + e * e), s *= e)), E && (M += T.xOrigin - (T.xOrigin * i + T.yOrigin * r) + T.xOffset, I += T.yOrigin - (T.xOrigin * s + T.yOrigin * a) + T.yOffset, St && (T.xPercent || T.yPercent) && (_ = this.t.getBBox(), M += .01 * T.xPercent * _.width, I += .01 * T.yPercent * _.height), M < (_ = 1e-6) && M > -_ && (M = 0), I < _ && I > -_ && (I = 0)), b = (i * x | 0) / x + "," + (s * x | 0) / x + "," + (r * x | 0) / x + "," + (a * x | 0) / x + "," + M + "," + I + ")", E && St ? this.t.setAttribute("transform", "matrix(" + b) : k[At] = (T.xPercent || T.yPercent ? "translate(" + T.xPercent + "%," + T.yPercent + "%) matrix(" : "matrix(") + b) : k[At] = (T.xPercent || T.yPercent ? "translate(" + T.xPercent + "%," + T.yPercent + "%) matrix(" : "matrix(") + C + ",0,0," + A + "," + M + "," + I + ")";
else {
if (f && (C < (_ = 1e-4) && C > -_ && (C = R = 2e-5), A < _ && A > -_ && (A = R = 2e-5), !D || T.z || T.rotationX || T.rotationY || (D = 0)), P || N) P *= j, g = i = Math.cos(P), v = s = Math.sin(P), N && (P -= N * j, g = Math.cos(P), v = Math.sin(P), "simple" === T.skewType && (e = Math.tan((N - F) * j), g *= e = Math.sqrt(1 + e * e), v *= e, T.skewY && (e = Math.tan(F * j), i *= e = Math.sqrt(1 + e * e), s *= e))), r = -v, a = g;
else {
if (!(S || O || 1 !== R || D || E)) return void (k[At] = (T.xPercent || T.yPercent ? "translate(" + T.xPercent + "%," + T.yPercent + "%) translate3d(" : "translate3d(") + M + "px," + I + "px," + L + "px)" + (1 !== C || 1 !== A ? " scale(" + C + "," + A + ")" : ""));
i = a = 1, r = s = 0
}
h = 1, n = o = l = u = c = d = 0, p = D ? -1 / D : 0, m = T.zOrigin, _ = 1e-6, ",", "0", (P = S * j) && (g = Math.cos(P), l = -(v = Math.sin(P)), c = p * -v, n = i * v, o = s * v, h = g, p *= g, i *= g, s *= g), (P = O * j) && (e = r * (g = Math.cos(P)) + n * (v = Math.sin(P)), y = a * g + o * v, u = h * v, d = p * v, n = r * -v + n * g, o = a * -v + o * g, h *= g, p *= g, r = e, a = y), 1 !== R && (n *= R, o *= R, h *= R, p *= R), 1 !== A && (r *= A, a *= A, u *= A, d *= A), 1 !== C && (i *= C, s *= C, l *= C, c *= C), (m || E) && (m && (M += n * -m, I += o * -m, L += h * -m + m), E && (M += T.xOrigin - (T.xOrigin * i + T.yOrigin * r) + T.xOffset, I += T.yOrigin - (T.xOrigin * s + T.yOrigin * a) + T.yOffset), M < _ && M > -_ && (M = "0"), I < _ && I > -_ && (I = "0"), L < _ && L > -_ && (L = 0)), b = T.xPercent || T.yPercent ? "translate(" + T.xPercent + "%," + T.yPercent + "%) matrix3d(" : "matrix3d(", b += (i < _ && i > -_ ? "0" : i) + "," + (s < _ && s > -_ ? "0" : s) + "," + (l < _ && l > -_ ? "0" : l), b += "," + (c < _ && c > -_ ? "0" : c) + "," + (r < _ && r > -_ ? "0" : r) + "," + (a < _ && a > -_ ? "0" : a), O || S || 1 !== R ? (b += "," + (u < _ && u > -_ ? "0" : u) + "," + (d < _ && d > -_ ? "0" : d) + "," + (n < _ && n > -_ ? "0" : n), b += "," + (o < _ && o > -_ ? "0" : o) + "," + (h < _ && h > -_ ? "0" : h) + "," + (p < _ && p > -_ ? "0" : p) + ",") : b += ",0,0,0,0,1,0,", b += M + "," + I + "," + L + "," + (D ? 1 + -L / D : 1) + ")", k[At] = b
}
};
(l = Lt.prototype).x = l.y = l.z = l.skewX = l.skewY = l.rotation = l.rotationX = l.rotationY = l.zOrigin = l.xPercent = l.yPercent = l.xOffset = l.yOffset = 0, l.scaleX = l.scaleY = l.scaleZ = 1, Pt("transform,scale,scaleX,scaleY,scaleZ,x,y,z,rotation,rotationX,rotationY,rotationZ,skewX,skewY,shortRotation,shortRotationX,shortRotationY,shortRotationZ,transformOrigin,svgOrigin,transformPerspective,directionalRotation,parseTransform,force3D,skewType,xPercent,yPercent,smoothOrigin", {
parser: function (t, e, r, n, a, o, l) {
if (n._lastParsedTransform === l) return a;
n._lastParsedTransform = l;
var u = l.scale && "function" == typeof l.scale ? l.scale : 0;
u && (l.scale = u(_, t));
var h, c, f, d, p, g, v, y, b, w = t._gsTransform,
x = t.style,
T = Ct.length,
k = l,
P = {},
O = Ut(t, i, !0, k.parseTransform),
S = k.transform && ("function" == typeof k.transform ? k.transform(_, m) : k.transform);
if (O.skewType = k.skewType || O.skewType || s.defaultSkewType, n._transform = O, "rotationZ" in k && (k.rotation = k.rotationZ), S && "string" == typeof S && At) (c = Y.style)[At] = S, c.display = "block", c.position = "absolute", -1 !== S.indexOf("%") && (c.width = tt(t, "width"), c.height = tt(t, "height")), X.body.appendChild(Y), h = Ut(Y, null, !1), "simple" === O.skewType && (h.scaleY *= Math.cos(h.skewX * j)), O.svg && (g = O.xOrigin, v = O.yOrigin, h.x -= O.xOffset, h.y -= O.yOffset, (k.transformOrigin || k.svgOrigin) && (S = {}, Ft(t, lt(k.transformOrigin), S, k.svgOrigin, k.smoothOrigin, !0), g = S.xOrigin, v = S.yOrigin, h.x -= S.xOffset - O.xOffset, h.y -= S.yOffset - O.yOffset), (g || v) && (y = Yt(Y, !0), h.x -= g - (g * y[0] + v * y[2]), h.y -= v - (g * y[1] + v * y[3]))), X.body.removeChild(Y), h.perspective || (h.perspective = O.perspective), null != k.xPercent && (h.xPercent = ht(k.xPercent, O.xPercent)), null != k.yPercent && (h.yPercent = ht(k.yPercent, O.yPercent));
else if ("object" == typeof k) {
if (h = {
scaleX: ht(null != k.scaleX ? k.scaleX : k.scale, O.scaleX),
scaleY: ht(null != k.scaleY ? k.scaleY : k.scale, O.scaleY),
scaleZ: ht(k.scaleZ, O.scaleZ),
x: ht(k.x, O.x),
y: ht(k.y, O.y),
z: ht(k.z, O.z),
xPercent: ht(k.xPercent, O.xPercent),
yPercent: ht(k.yPercent, O.yPercent),
perspective: ht(k.transformPerspective, O.perspective)
}, null != (p = k.directionalRotation))
if ("object" == typeof p)
for (c in p) k[c] = p[c];
else k.rotation = p;
"string" == typeof k.x && -1 !== k.x.indexOf("%") && (h.x = 0, h.xPercent = ht(k.x, O.xPercent)), "string" == typeof k.y && -1 !== k.y.indexOf("%") && (h.y = 0, h.yPercent = ht(k.y, O.yPercent)), h.rotation = ct("rotation" in k ? k.rotation : "shortRotation" in k ? k.shortRotation + "_short" : O.rotation, O.rotation, "rotation", P), It && (h.rotationX = ct("rotationX" in k ? k.rotationX : "shortRotationX" in k ? k.shortRotationX + "_short" : O.rotationX || 0, O.rotationX, "rotationX", P), h.rotationY = ct("rotationY" in k ? k.rotationY : "shortRotationY" in k ? k.shortRotationY + "_short" : O.rotationY || 0, O.rotationY, "rotationY", P)), h.skewX = ct(k.skewX, O.skewX), h.skewY = ct(k.skewY, O.skewY)
}
for (It && null != k.force3D && (O.force3D = k.force3D, d = !0), (f = O.force3D || O.z || O.rotationX || O.rotationY || h.z || h.rotationX || h.rotationY || h.perspective) || null == k.scale || (h.scaleZ = 1); --T > -1;)((S = h[b = Ct[T]] - O[b]) > 1e-6 || S < -1e-6 || null != k[b] || null != F[b]) && (d = !0, a = new bt(O, b, O[b], S, a), b in P && (a.e = P[b]), a.xs0 = 0, a.plugin = o, n._overwriteProps.push(a.n));
return S = "function" == typeof k.transformOrigin ? k.transformOrigin(_, m) : k.transformOrigin, O.svg && (S || k.svgOrigin) && (g = O.xOffset, v = O.yOffset, Ft(t, lt(S), h, k.svgOrigin, k.smoothOrigin), a = wt(O, "xOrigin", (w ? O : h).xOrigin, h.xOrigin, a, "transformOrigin"), a = wt(O, "yOrigin", (w ? O : h).yOrigin, h.yOrigin, a, "transformOrigin"), g === O.xOffset && v === O.yOffset || (a = wt(O, "xOffset", w ? g : O.xOffset, O.xOffset, a, "transformOrigin"), a = wt(O, "yOffset", w ? v : O.yOffset, O.yOffset, a, "transformOrigin")), S = "0px 0px"), (S || It && f && O.zOrigin) && (At ? (d = !0, b = Mt, S || (S = (S = (tt(t, b, i, !1, "50% 50%") + "").split(" "))[0] + " " + S[1] + " " + O.zOrigin + "px"), S += "", (a = new bt(x, b, 0, 0, a, -1, "transformOrigin")).b = x[b], a.plugin = o, It ? (c = O.zOrigin, S = S.split(" "), O.zOrigin = (S.length > 2 ? parseFloat(S[2]) : c) || 0, a.xs0 = a.e = S[0] + " " + (S[1] || "50%") + " 0px", (a = new bt(O, "zOrigin", 0, 0, a, -1, a.n)).b = c, a.xs0 = a.e = O.zOrigin) : a.xs0 = a.e = S) : lt(S + "", O)), d && (n._transformType = O.svg && St || !f && 3 !== this._transformType ? 2 : 3), u && (l.scale = u), a
},
allowFunc: !0,
prefix: !0
}), Pt("boxShadow", {
defaultValue: "0px 0px 0px 0px #999",
prefix: !0,
color: !0,
multi: !0,
keyword: "inset"
}), Pt("clipPath", {
defaultValue: "inset(0%)",
prefix: !0,
multi: !0,
formatter: gt("inset(0% 0% 0% 0%)", !1, !0)
}), Pt("borderRadius", {
defaultValue: "0px",
parser: function (t, r, n, s, a, o) {
r = this.format(r);
var l, u, h, c, f, d, p, m, _, g, v, y, b, w, x, T, k = ["borderTopLeftRadius", "borderTopRightRadius", "borderBottomRightRadius", "borderBottomLeftRadius"],
P = t.style;
for (_ = parseFloat(t.offsetWidth), g = parseFloat(t.offsetHeight), l = r.split(" "), u = 0; u < k.length; u++) this.p.indexOf("border") && (k[u] = Q(k[u])), -1 !== (f = c = tt(t, k[u], i, !1, "0px")).indexOf(" ") && (f = (c = f.split(" "))[0], c = c[1]), d = h = l[u], p = parseFloat(f), y = f.substr((p + "").length), (b = "=" === d.charAt(1)) ? (m = parseInt(d.charAt(0) + "1", 10), d = d.substr(2), m *= parseFloat(d), v = d.substr((m + "").length - (m < 0 ? 1 : 0)) || "") : (m = parseFloat(d), v = d.substr((m + "").length)), "" === v && (v = e[n] || y), v !== y && (w = et(t, "borderLeft", p, y), x = et(t, "borderTop", p, y), "%" === v ? (f = w / _ * 100 + "%", c = x / g * 100 + "%") : "em" === v ? (f = w / (T = et(t, "borderLeft", 1, "em")) + "em", c = x / T + "em") : (f = w + "px", c = x + "px"), b && (d = parseFloat(f) + m + v, h = parseFloat(c) + m + v)), a = xt(P, k[u], f + " " + c, d + " " + h, !1, "0px", a);
return a
},
prefix: !0,
formatter: gt("0px 0px 0px 0px", !1, !0)
}), Pt("borderBottomLeftRadius,borderBottomRightRadius,borderTopLeftRadius,borderTopRightRadius", {
defaultValue: "0px",
parser: function (t, e, r, n, s, a) {
return xt(t.style, r, this.format(tt(t, r, i, !1, "0px 0px")), this.format(e), !1, "0px", s)
},
prefix: !0,
formatter: gt("0px 0px", !1, !0)
}), Pt("backgroundPosition", {
defaultValue: "0 0",
parser: function (t, e, r, n, s, a) {
var o, l, u, h, c, f, d = "background-position",
m = i || K(t),
_ = this.format((m ? p ? m.getPropertyValue(d + "-x") + " " + m.getPropertyValue(d + "-y") : m.getPropertyValue(d) : t.currentStyle.backgroundPositionX + " " + t.currentStyle.backgroundPositionY) || "0 0"),
g = this.format(e);
if (-1 !== _.indexOf("%") != (-1 !== g.indexOf("%")) && g.split(",").length < 2 && (f = tt(t, "backgroundImage").replace(A, "")) && "none" !== f) {
for (o = _.split(" "), l = g.split(" "), U.setAttribute("src", f), u = 2; --u > -1;)(h = -1 !== (_ = o[u]).indexOf("%")) !== (-1 !== l[u].indexOf("%")) && (c = 0 === u ? t.offsetWidth - U.width : t.offsetHeight - U.height, o[u] = h ? parseFloat(_) / 100 * c + "px" : parseFloat(_) / c * 100 + "%");
_ = o.join(" ")
}
return this.parseComplex(t.style, _, g, s, a)
},
formatter: lt
}), Pt("backgroundSize", {
defaultValue: "0 0",
formatter: function (t) {
return "co" === (t += "").substr(0, 2) ? t : lt(-1 === t.indexOf(" ") ? t + " " + t : t)
}
}), Pt("perspective", {
defaultValue: "0px",
prefix: !0
}), Pt("perspectiveOrigin", {
defaultValue: "50% 50%",
prefix: !0
}), Pt("transformStyle", {
prefix: !0
}), Pt("backfaceVisibility", {
prefix: !0
}), Pt("userSelect", {
prefix: !0
}), Pt("margin", {
parser: vt("marginTop,marginRight,marginBottom,marginLeft")
}), Pt("padding", {
parser: vt("paddingTop,paddingRight,paddingBottom,paddingLeft")
}), Pt("clip", {
defaultValue: "rect(0px,0px,0px,0px)",
parser: function (t, e, r, n, s, a) {
var o, l, u;
return p < 9 ? (l = t.currentStyle, u = p < 8 ? " " : ",", o = "rect(" + l.clipTop + u + l.clipRight + u + l.clipBottom + u + l.clipLeft + ")", e = this.format(e).split(",").join(u)) : (o = this.format(tt(t, this.p, i, !1, this.dflt)), e = this.format(e)), this.parseComplex(t.style, o, e, s, a)
}
}), Pt("textShadow", {
defaultValue: "0px 0px 0px #999",
color: !0,
multi: !0
}), Pt("autoRound,strictUnits", {
parser: function (t, e, i, r, n) {
return n
}
}), Pt("border", {
defaultValue: "0px solid #000",
parser: function (t, e, r, n, s, a) {
var o = tt(t, "borderTopWidth", i, !1, "0px"),
l = this.format(e).split(" "),
u = l[0].replace(x, "");
return "px" !== u && (o = parseFloat(o) / et(t, "borderTopWidth", 1, u) + u), this.parseComplex(t.style, this.format(o + " " + tt(t, "borderTopStyle", i, !1, "solid") + " " + tt(t, "borderTopColor", i, !1, "#000")), l.join(" "), s, a)
},
color: !0,
formatter: function (t) {
var e = t.split(" ");
return e[0] + " " + (e[1] || "solid") + " " + (t.match(_t) || ["#000"])[0]
}
}), Pt("borderWidth", {
parser: vt("borderTopWidth,borderRightWidth,borderBottomWidth,borderLeftWidth")
}), Pt("float,cssFloat,styleFloat", {
parser: function (t, e, i, r, n, s) {
var a = t.style,
o = "cssFloat" in a ? "cssFloat" : "styleFloat";
return new bt(a, o, 0, 0, n, -1, i, !1, 0, a[o], e)
}
});
var Wt = function (t) {
var e, i = this.t,
r = i.filter || tt(this.data, "filter") || "",
n = this.s + this.c * t | 0;
100 === n && (-1 === r.indexOf("atrix(") && -1 === r.indexOf("radient(") && -1 === r.indexOf("oader(") ? (i.removeAttribute("filter"), e = !tt(this.data, "filter")) : (i.filter = r.replace(P, ""), e = !0)), e || (this.xn1 && (i.filter = r = r || "alpha(opacity=" + n + ")"), -1 === r.indexOf("pacity") ? 0 === n && this.xn1 || (i.filter = r + " alpha(opacity=" + n + ")") : i.filter = r.replace(T, "opacity=" + n))
};
Pt("opacity,alpha,autoAlpha", {
defaultValue: "1",
parser: function (t, e, r, n, s, a) {
var o = parseFloat(tt(t, "opacity", i, !1, "1")),
l = t.style,
u = "autoAlpha" === r;
return "string" == typeof e && "=" === e.charAt(1) && (e = ("-" === e.charAt(0) ? -1 : 1) * parseFloat(e.substr(2)) + o), u && 1 === o && "hidden" === tt(t, "visibility", i) && 0 !== e && (o = 0), W ? s = new bt(l, "opacity", o, e - o, s) : ((s = new bt(l, "opacity", 100 * o, 100 * (e - o), s)).xn1 = u ? 1 : 0, l.zoom = 1, s.type = 2, s.b = "alpha(opacity=" + s.s + ")", s.e = "alpha(opacity=" + (s.s + s.c) + ")", s.data = t, s.plugin = a, s.setRatio = Wt), u && ((s = new bt(l, "visibility", 0, 0, s, -1, null, !1, 0, 0 !== o ? "inherit" : "hidden", 0 === e ? "hidden" : "inherit")).xs0 = "inherit", n._overwriteProps.push(s.n), n._overwriteProps.push(r)), s
}
});
var Zt = function (t, e) {
e && (t.removeProperty ? ("ms" !== e.substr(0, 2) && "webkit" !== e.substr(0, 6) || (e = "-" + e), t.removeProperty(e.replace(S, "-$1").toLowerCase())) : t.removeAttribute(e))
},
Gt = function (t) {
if (this.t._gsClassPT = this, 1 === t || 0 === t) {
this.t.setAttribute("class", 0 === t ? this.b : this.e);
for (var e = this.data, i = this.t.style; e;) e.v ? i[e.p] = e.v : Zt(i, e.p), e = e._next;
1 === t && this.t._gsClassPT === this && (this.t._gsClassPT = null)
} else this.t.getAttribute("class") !== this.e && this.t.setAttribute("class", this.e)
};
Pt("className", {
parser: function (e, r, n, s, a, o, l) {
var u, h, c, f, d, p = e.getAttribute("class") || "",
m = e.style.cssText;
if ((a = s._classNamePT = new bt(e, n, 0, 0, a, 2)).setRatio = Gt, a.pr = -11, t = !0, a.b = p, h = rt(e, i), c = e._gsClassPT) {
for (f = {}, d = c.data; d;) f[d.p] = 1, d = d._next;
c.setRatio(1)
}
return e._gsClassPT = a, a.e = "=" !== r.charAt(1) ? r : p.replace(new RegExp("(?:\\s|^)" + r.substr(2) + "(?![\\w-])"), "") + ("+" === r.charAt(0) ? " " + r.substr(2) : ""), e.setAttribute("class", a.e), u = nt(e, h, rt(e), l, f), e.setAttribute("class", p), a.data = u.firstMPT, e.style.cssText !== m && (e.style.cssText = m), a = a.xfirst = s.parse(e, u.difs, a, o)
}
});
var Ht = function (t) {
if ((1 === t || 0 === t) && this.data._totalTime === this.data._totalDuration && "isFromStart" !== this.data.data) {
var e, i, r, n, s, a = this.t.style,
l = o.transform.parse;
if ("all" === this.e) a.cssText = "", n = !0;
else
for (r = (e = this.e.split(" ").join("").split(",")).length; --r > -1;) i = e[r], o[i] && (o[i].parse === l ? n = !0 : i = "transformOrigin" === i ? Mt : o[i].p), Zt(a, i);
n && (Zt(a, At), (s = this.t._gsTransform) && (s.svg && (this.t.removeAttribute("data-svg-origin"), this.t.removeAttribute("transform")), delete this.t._gsTransform))
}
};
for (Pt("clearProps", {
parser: function (e, i, r, n, s) {
return (s = new bt(e, r, 0, 0, s, 2)).setRatio = Ht, s.e = i, s.pr = -10, s.data = n._tween, t = !0, s
}
}), l = "bezier,throwProps,physicsProps,physics2D".split(","), Tt = l.length; Tt--;) Ot(l[Tt]);
(l = s.prototype)._firstPT = l._lastParsedTransform = l._transform = null, l._onInitTween = function (r, a, l, f) {
if (!r.nodeType) return !1;
this._target = m = r, this._tween = l, this._vars = a, _ = f, u = a.autoRound, t = !1, e = a.suffixMap || s.suffixMap, i = K(r), n = this._overwriteProps;
var p, g, v, y, b, w, x, T, P, O = r.style;
if (h && "" === O.zIndex && ("auto" !== (p = tt(r, "zIndex", i)) && "" !== p || this._addLazySet(O, "zIndex", 0)), "string" == typeof a && (y = O.cssText, p = rt(r, i), O.cssText = y + ";" + a, p = nt(r, p, rt(r)).difs, !W && k.test(a) && (p.opacity = parseFloat(RegExp.$1)), a = p, O.cssText = y), a.className ? this._firstPT = g = o.className.parse(r, a.className, "className", this, null, null, a) : this._firstPT = g = this.parse(r, a, null), this._transformType) {
for (P = 3 === this._transformType, At ? c && (h = !0, "" === O.zIndex && ("auto" !== (x = tt(r, "zIndex", i)) && "" !== x || this._addLazySet(O, "zIndex", 0)), d && this._addLazySet(O, "WebkitBackfaceVisibility", this._vars.WebkitBackfaceVisibility || (P ? "visible" : "hidden"))) : O.zoom = 1, v = g; v && v._next;) v = v._next;
T = new bt(r, "transform", 0, 0, null, 2), this._linkCSSP(T, null, v), T.setRatio = At ? qt : Vt, T.data = this._transform || Ut(r, i, !0), T.tween = l, T.pr = -1, n.pop()
}
if (t) {
for (; g;) {
for (w = g._next, v = y; v && v.pr > g.pr;) v = v._next;
(g._prev = v ? v._prev : b) ? g._prev._next = g : y = g, (g._next = v) ? v._prev = g : b = g, g = w
}
this._firstPT = y
}
return !0
}, l.parse = function (t, r, n, s) {
var a, l, h, c, f, d, p, g, v, y, b = t.style;
for (a in r) {
if (d = r[a], l = o[a], "function" != typeof d || l && l.allowFunc || (d = d(_, m)), l) n = l.parse(t, d, a, this, n, s, r);
else {
if ("--" === a.substr(0, 2)) {
this._tween._propLookup[a] = this._addTween.call(this._tween, t.style, "setProperty", K(t).getPropertyValue(a) + "", d + "", a, !1, a);
continue
}
f = tt(t, a, i) + "", v = "string" == typeof d, "color" === a || "fill" === a || "stroke" === a || -1 !== a.indexOf("Color") || v && O.test(d) ? (v || (d = ((d = pt(d)).length > 3 ? "rgba(" : "rgb(") + d.join(",") + ")"), n = xt(b, a, f, d, !0, "transparent", n, 0, s)) : v && D.test(d) ? n = xt(b, a, f, d, !0, null, n, 0, s) : (p = (h = parseFloat(f)) || 0 === h ? f.substr((h + "").length) : "", "" !== f && "auto" !== f || ("width" === a || "height" === a ? (h = ot(t, a, i), p = "px") : "left" === a || "top" === a ? (h = it(t, a, i), p = "px") : (h = "opacity" !== a ? 0 : 1, p = "")), (y = v && "=" === d.charAt(1)) ? (c = parseInt(d.charAt(0) + "1", 10), d = d.substr(2), c *= parseFloat(d), g = d.replace(x, "")) : (c = parseFloat(d), g = v ? d.replace(x, "") : ""), "" === g && (g = a in e ? e[a] : p), d = c || 0 === c ? (y ? c + h : c) + g : r[a], p !== g && ("" === g && "lineHeight" !== a || (c || 0 === c) && h && (h = et(t, a, h, p), "%" === g ? (h /= et(t, a, 100, "%") / 100, !0 !== r.strictUnits && (f = h + "%")) : "em" === g || "rem" === g || "vw" === g || "vh" === g ? h /= et(t, a, 1, g) : "px" !== g && (c = et(t, a, c, g), g = "px"), y && (c || 0 === c) && (d = c + h + g))), y && (c += h), !h && 0 !== h || !c && 0 !== c ? void 0 !== b[a] && (d || d + "" != "NaN" && null != d) ? (n = new bt(b, a, c || h || 0, 0, n, -1, a, !1, 0, f, d)).xs0 = "none" !== d || "display" !== a && -1 === a.indexOf("Style") ? d : f : G("invalid " + a + " tween value: " + r[a]) : (n = new bt(b, a, h, c - h, n, 0, a, !1 !== u && ("px" === g || "zIndex" === a), 0, f, d)).xs0 = g)
}
s && n && !n.plugin && (n.plugin = s)
}
return n
}, l.setRatio = function (t) {
var e, i, r, n = this._firstPT;
if (1 !== t || this._tween._time !== this._tween._duration && 0 !== this._tween._time)
if (t || this._tween._time !== this._tween._duration && 0 !== this._tween._time || -1e-6 === this._tween._rawPrevTime)
for (; n;) {
if (e = n.c * t + n.s, n.r ? e = n.r(e) : e < 1e-6 && e > -1e-6 && (e = 0), n.type)
if (1 === n.type)
if (2 === (r = n.l)) n.t[n.p] = n.xs0 + e + n.xs1 + n.xn1 + n.xs2;
else if (3 === r) n.t[n.p] = n.xs0 + e + n.xs1 + n.xn1 + n.xs2 + n.xn2 + n.xs3;
else if (4 === r) n.t[n.p] = n.xs0 + e + n.xs1 + n.xn1 + n.xs2 + n.xn2 + n.xs3 + n.xn3 + n.xs4;
else if (5 === r) n.t[n.p] = n.xs0 + e + n.xs1 + n.xn1 + n.xs2 + n.xn2 + n.xs3 + n.xn3 + n.xs4 + n.xn4 + n.xs5;
else {
for (i = n.xs0 + e + n.xs1, r = 1; r < n.l; r++) i += n["xn" + r] + n["xs" + (r + 1)];
n.t[n.p] = i
} else -1 === n.type ? n.t[n.p] = n.xs0 : n.setRatio && n.setRatio(t);
else n.t[n.p] = e + n.xs0;
n = n._next
} else
for (; n;) 2 !== n.type ? n.t[n.p] = n.b : n.setRatio(t), n = n._next;
else
for (; n;) {
if (2 !== n.type)
if (n.r && -1 !== n.type)
if (e = n.r(n.s + n.c), n.type) {
if (1 === n.type) {
for (r = n.l, i = n.xs0 + e + n.xs1, r = 1; r < n.l; r++) i += n["xn" + r] + n["xs" + (r + 1)];
n.t[n.p] = i
}
} else n.t[n.p] = e + n.xs0;
else n.t[n.p] = n.e;
else n.setRatio(t);
n = n._next
}
}, l._enableTransforms = function (t) {
this._transform = this._transform || Ut(this._target, i, !0), this._transformType = this._transform.svg && St || !t && 3 !== this._transformType ? 2 : 3
};
var $t = function (t) {
this.t[this.p] = this.e, this.data._linkCSSP(this, this._next, null, !0)
};
l._addLazySet = function (t, e, i) {
var r = this._firstPT = new bt(t, e, 0, 0, this._firstPT, 2);
r.e = i, r.setRatio = $t, r.data = this
}, l._linkCSSP = function (t, e, i, r) {
return t && (e && (e._prev = t), t._next && (t._next._prev = t._prev), t._prev ? t._prev._next = t._next : this._firstPT === t && (this._firstPT = t._next, r = !0), i ? i._next = t : r || null !== this._firstPT || (this._firstPT = t), t._next = e, t._prev = i), t
}, l._mod = function (t) {
for (var e = this._firstPT; e;) "function" == typeof t[e.p] && (e.r = t[e.p]), e = e._next
}, l._kill = function (t) {
var e, i, n, s = t;
if (t.autoAlpha || t.alpha) {
for (i in s = {}, t) s[i] = t[i];
s.opacity = 1, s.autoAlpha && (s.visibility = 1)
}
for (t.className && (e = this._classNamePT) && ((n = e.xfirst) && n._prev ? this._linkCSSP(n._prev, e._next, n._prev._prev) : n === this._firstPT && (this._firstPT = e._next), e._next && this._linkCSSP(e._next, e._next._next, n._prev), this._classNamePT = null), e = this._firstPT; e;) e.plugin && e.plugin !== i && e.plugin._kill && (e.plugin._kill(t), i = e.plugin), e = e._next;
return r.j.prototype._kill.call(this, s)
};
var Qt = function (t, e, i) {
var r, n, s, a;
if (t.slice)
for (n = t.length; --n > -1;) Qt(t[n], e, i);
else
for (n = (r = t.childNodes).length; --n > -1;) a = (s = r[n]).type, s.style && (e.push(rt(s)), i && i.push(s)), 1 !== a && 9 !== a && 11 !== a || !s.childNodes.length || Qt(s, e, i)
};
return s.cascadeTo = function (t, e, i) {
var n, s, a, o, l = r.l.to(t, e, i),
u = [l],
h = [],
c = [],
f = [],
d = r.l._internals.reservedProps;
for (t = l._targets || l.target, Qt(t, h, f), l.render(e, !0, !0), Qt(t, c), l.render(0, !0, !0), l._enabled(!0), n = f.length; --n > -1;)
if ((s = nt(f[n], h[n], c[n])).firstMPT) {
for (a in s = s.difs, i) d[a] && (s[a] = i[a]);
for (a in o = {}, s) o[a] = h[n][a];
u.push(r.l.fromTo(f[n], e, o, s))
}
return u
}, r.j.activate([s]), s
}, !0);
var s = r.m.CSSPlugin,
a = r.k._gsDefine.plugin({
propName: "attr",
API: 2,
version: "0.6.1",
init: function (t, e, i, r) {
var n, s;
if ("function" != typeof t.setAttribute) return !1;
for (n in e) "function" == typeof (s = e[n]) && (s = s(r, t)), this._addTween(t, "setAttribute", t.getAttribute(n) + "", s + "", n, !1, n), this._overwriteProps.push(n);
return !0
}
}),
o = r.k._gsDefine.plugin({
propName: "roundProps",
version: "1.7.0",
priority: -1,
API: 2,
init: function (t, e, i) {
return this._tween = i, !0
}
}),
l = function (t) {
var e = t < 1 ? Math.pow(10, (t + "").length - 2) : 1;
return function (i) {
return (Math.round(i / t) * t * e | 0) / e
}
},
u = function (t, e) {
for (; t;) t.f || t.blob || (t.m = e || Math.round), t = t._next
},
h = o.prototype;
/*!
* VERSION: 0.6.1
* DATE: 2018-08-27
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
*/
h._onInitAllProps = function () {
var t, e, i, r, n = this._tween,
s = n.vars.roundProps,
a = {},
o = n._propLookup.roundProps;
if ("object" != typeof s || s.push)
for ("string" == typeof s && (s = s.split(",")), i = s.length; --i > -1;) a[s[i]] = Math.round;
else
for (r in s) a[r] = l(s[r]);
for (r in a)
for (t = n._firstPT; t;) e = t._next, t.pg ? t.t._mod(a) : t.n === r && (2 === t.f && t.t ? u(t.t._firstPT, a[r]) : (this._add(t.t, r, t.s, t.c, a[r]), e && (e._prev = t._prev), t._prev ? t._prev._next = e : n._firstPT === t && (n._firstPT = e), t._next = t._prev = null, n._propLookup[r] = o)), t = e;
return !1
}, h._add = function (t, e, i, r, n) {
this._addTween(t, e, i, i + r, e, n || Math.round), this._overwriteProps.push(e)
};
/*!
* VERSION: 0.3.1
* DATE: 2018-08-27
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
**/
var c = r.k._gsDefine.plugin({
propName: "directionalRotation",
version: "0.3.1",
API: 2,
init: function (t, e, i, r) {
"object" != typeof e && (e = {
rotation: e
}), this.finals = {};
var n, s, a, o, l, u, h = !0 === e.useRadians ? 2 * Math.PI : 360;
for (n in e) "useRadians" !== n && ("function" == typeof (o = e[n]) && (o = o(r, t)), s = (u = (o + "").split("_"))[0], a = parseFloat("function" != typeof t[n] ? t[n] : t[n.indexOf("set") || "function" != typeof t["get" + n.substr(3)] ? n : "get" + n.substr(3)]()), l = (o = this.finals[n] = "string" == typeof s && "=" === s.charAt(1) ? a + parseInt(s.charAt(0) + "1", 10) * Number(s.substr(2)) : Number(s) || 0) - a, u.length && (-1 !== (s = u.join("_")).indexOf("short") && (l %= h) !== l % (h / 2) && (l = l < 0 ? l + h : l - h), -1 !== s.indexOf("_cw") && l < 0 ? l = (l + 9999999999 * h) % h - (l / h | 0) * h : -1 !== s.indexOf("ccw") && l > 0 && (l = (l - 9999999999 * h) % h - (l / h | 0) * h)), (l > 1e-6 || l < -1e-6) && (this._addTween(t, n, a, a + l, n), this._overwriteProps.push(n)));
return !0
},
set: function (t) {
var e;
if (1 !== t) this._super.setRatio.call(this, t);
else
for (e = this._firstPT; e;) e.f ? e.t[e.p](this.finals[e.p]) : e.t[e.p] = this.finals[e.p], e = e._next
}
});
c._autoCSS = !0,
/*!
* VERSION: 2.1.3
* DATE: 2019-05-17
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
*/
r.k._gsDefine("TimelineLite", ["core.Animation", "core.SimpleTimeline", "TweenLite"], function () {
var t = function (t) {
r.i.call(this, t);
var e, i, n = this.vars;
for (i in this._labels = {}, this.autoRemoveChildren = !!n.autoRemoveChildren, this.smoothChildTiming = !!n.smoothChildTiming, this._sortChildren = !0, this._onUpdate = n.onUpdate, n) e = n[i], s(e) && -1 !== e.join("").indexOf("{self}") && (n[i] = this._swapSelfInParams(e));
s(n.tweens) && this.add(n.tweens, 0, n.align, n.stagger)
},
e = r.l._internals,
i = t._internals = {},
n = e.isSelector,
s = e.isArray,
a = e.lazyTweens,
o = e.lazyRender,
l = r.k._gsDefine.globals,
u = function (t) {
var e, i = {};
for (e in t) i[e] = t[e];
return i
},
h = function (t, e, i) {
var r, n, s = t.cycle;
for (r in s) n = s[r], t[r] = "function" == typeof n ? n(i, e[i], e) : n[i % n.length];
delete t.cycle
},
c = i.pauseCallback = function () { },
f = function (t, e, i, r) {
var n = "immediateRender";
return n in e || (e[n] = !(i && !1 === i[n] || r)), e
},
d = function (t) {
if ("function" == typeof t) return t;
var e = "object" == typeof t ? t : {
each: t
},
i = e.ease,
r = e.from || 0,
n = e.base || 0,
s = {},
a = isNaN(r),
o = e.axis,
l = {
center: .5,
end: 1
}[r] || 0;
return function (t, u, h) {
var c, f, d, p, m, _, g, v, y, b = (h || e).length,
w = s[b];
if (!w) {
if (!(y = "auto" === e.grid ? 0 : (e.grid || [1 / 0])[0])) {
for (g = -1 / 0; g < (g = h[y++].getBoundingClientRect().left) && y < b;);
y--
}
for (w = s[b] = [], c = a ? Math.min(y, b) * l - .5 : r % y, f = a ? b * l / y - .5 : r / y | 0, g = 0, v = 1 / 0, _ = 0; _ < b; _++) d = _ % y - c, p = f - (_ / y | 0), w[_] = m = o ? Math.abs("y" === o ? p : d) : Math.sqrt(d * d + p * p), m > g && (g = m), m < v && (v = m);
w.max = g - v, w.min = v, w.v = b = e.amount || e.each * (y > b ? b - 1 : o ? "y" === o ? b / y : y : Math.max(y, b / y)) || 0, w.b = b < 0 ? n - b : n
}
return b = (w[t] - w.min) / w.max, w.b + (i ? i.getRatio(b) : b) * w.v
}
},
p = t.prototype = new r.i;
return t.version = "2.1.3", t.distribute = d, p.constructor = t, p.kill()._gc = p._forcingPlayhead = p._hasPause = !1, p.to = function (t, e, i, n) {
var s = i.repeat && l.TweenMax || r.l;
return e ? this.add(new s(t, e, i), n) : this.set(t, i, n)
}, p.from = function (t, e, i, n) {
return this.add((i.repeat && l.TweenMax || r.l).from(t, e, f(0, i)), n)
}, p.fromTo = function (t, e, i, n, s) {
var a = n.repeat && l.TweenMax || r.l;
return n = f(0, n, i), e ? this.add(a.fromTo(t, e, i, n), s) : this.set(t, n, s)
}, p.staggerTo = function (e, i, s, a, o, l, c, f) {
var p, m, _ = new t({
onComplete: l,
onCompleteParams: c,
callbackScope: f,
smoothChildTiming: this.smoothChildTiming
}),
g = d(s.stagger || a),
v = s.startAt,
y = s.cycle;
for ("string" == typeof e && (e = r.l.selector(e) || e), n(e = e || []) && (e = function (t) {
var e, i = [],
r = t.length;
for (e = 0; e !== r; i.push(t[e++]));
return i
}(e)), m = 0; m < e.length; m++) p = u(s), v && (p.startAt = u(v), v.cycle && h(p.startAt, e, m)), y && (h(p, e, m), null != p.duration && (i = p.duration, delete p.duration)), _.to(e[m], i, p, g(m, e[m], e));
return this.add(_, o)
}, p.staggerFrom = function (t, e, i, r, n, s, a, o) {
return i.runBackwards = !0, this.staggerTo(t, e, f(0, i), r, n, s, a, o)
}, p.staggerFromTo = function (t, e, i, r, n, s, a, o, l) {
return r.startAt = i, this.staggerTo(t, e, f(0, r, i), n, s, a, o, l)
}, p.call = function (t, e, i, n) {
return this.add(r.l.delayedCall(0, t, e, i), n)
}, p.set = function (t, e, i) {
return this.add(new r.l(t, 0, f(0, e, null, !0)), i)
}, t.exportRoot = function (e, i) {
null == (e = e || {}).smoothChildTiming && (e.smoothChildTiming = !0);
var n, s, a, o, l = new t(e),
u = l._timeline;
for (null == i && (i = !0), u._remove(l, !0), l._startTime = 0, l._rawPrevTime = l._time = l._totalTime = u._time, a = u._first; a;) o = a._next, i && a instanceof r.l && a.target === a.vars.onComplete || ((s = a._startTime - a._delay) < 0 && (n = 1), l.add(a, s)), a = o;
return u.add(l, 0), n && l.totalDuration(), l
}, p.add = function (e, i, n, a) {
var o, l, u, h, c, f;
if ("number" != typeof i && (i = this._parseTimeOrLabel(i, 0, !0, e)), !(e instanceof r.a)) {
if (e instanceof Array || e && e.push && s(e)) {
for (n = n || "normal", a = a || 0, o = i, l = e.length, u = 0; u < l; u++) s(h = e[u]) && (h = new t({
tweens: h
})), this.add(h, o), "string" != typeof h && "function" != typeof h && ("sequence" === n ? o = h._startTime + h.totalDuration() / h._timeScale : "start" === n && (h._startTime -= h.delay())), o += a;
return this._uncache(!0)
}
if ("string" == typeof e) return this.addLabel(e, i);
if ("function" != typeof e) throw "Cannot add " + e + " into the timeline; it is not a tween, timeline, function, or string.";
e = r.l.delayedCall(0, e)
}
if (r.i.prototype.add.call(this, e, i), (e._time || !e._duration && e._initted) && (o = (this.rawTime() - e._startTime) * e._timeScale, (!e._duration || Math.abs(Math.max(0, Math.min(e.totalDuration(), o))) - e._totalTime > 1e-5) && e.render(o, !1, !1)), (this._gc || this._time === this._duration) && !this._paused && this._duration < this.duration())
for (f = (c = this).rawTime() > e._startTime; c._timeline;) f && c._timeline.smoothChildTiming ? c.totalTime(c._totalTime, !0) : c._gc && c._enabled(!0, !1), c = c._timeline;
return this
}, p.remove = function (t) {
if (t instanceof r.a) {
this._remove(t, !1);
var e = t._timeline = t.vars.useFrames ? r.a._rootFramesTimeline : r.a._rootTimeline;
return t._startTime = (t._paused ? t._pauseTime : e._time) - (t._reversed ? t.totalDuration() - t._totalTime : t._totalTime) / t._timeScale, this
}
if (t instanceof Array || t && t.push && s(t)) {
for (var i = t.length; --i > -1;) this.remove(t[i]);
return this
}
return "string" == typeof t ? this.removeLabel(t) : this.kill(null, t)
}, p._remove = function (t, e) {
return r.i.prototype._remove.call(this, t, e), this._last ? this._time > this.duration() && (this._time = this._duration, this._totalTime = this._totalDuration) : this._time = this._totalTime = this._duration = this._totalDuration = 0, this
}, p.append = function (t, e) {
return this.add(t, this._parseTimeOrLabel(null, e, !0, t))
}, p.insert = p.insertMultiple = function (t, e, i, r) {
return this.add(t, e || 0, i, r)
}, p.appendMultiple = function (t, e, i, r) {
return this.add(t, this._parseTimeOrLabel(null, e, !0, t), i, r)
}, p.addLabel = function (t, e) {
return this._labels[t] = this._parseTimeOrLabel(e), this
}, p.addPause = function (t, e, i, n) {
var s = r.l.delayedCall(0, c, i, n || this);
return s.vars.onComplete = s.vars.onReverseComplete = e, s.data = "isPause", this._hasPause = !0, this.add(s, t)
}, p.removeLabel = function (t) {
return delete this._labels[t], this
}, p.getLabelTime = function (t) {
return null != this._labels[t] ? this._labels[t] : -1
}, p._parseTimeOrLabel = function (t, e, i, n) {
var a, o;
if (n instanceof r.a && n.timeline === this) this.remove(n);
else if (n && (n instanceof Array || n.push && s(n)))
for (o = n.length; --o > -1;) n[o] instanceof r.a && n[o].timeline === this && this.remove(n[o]);
if (a = "number" != typeof t || e ? this.duration() > 99999999999 ? this.recent().endTime(!1) : this._duration : 0, "string" == typeof e) return this._parseTimeOrLabel(e, i && "number" == typeof t && null == this._labels[e] ? t - a : 0, i);
if (e = e || 0, "string" != typeof t || !isNaN(t) && null == this._labels[t]) null == t && (t = a);
else {
if (-1 === (o = t.indexOf("="))) return null == this._labels[t] ? i ? this._labels[t] = a + e : e : this._labels[t] + e;
e = parseInt(t.charAt(o - 1) + "1", 10) * Number(t.substr(o + 1)), t = o > 1 ? this._parseTimeOrLabel(t.substr(0, o - 1), 0, i) : a
}
return Number(t) + e
}, p.seek = function (t, e) {
return this.totalTime("number" == typeof t ? t : this._parseTimeOrLabel(t), !1 !== e)
}, p.stop = function () {
return this.paused(!0)
}, p.gotoAndPlay = function (t, e) {
return this.play(t, e)
}, p.gotoAndStop = function (t, e) {
return this.pause(t, e)
}, p.render = function (t, e, i) {
this._gc && this._enabled(!0, !1);
var r, n, s, l, u, h, c, f, d = this._time,
p = this._dirty ? this.totalDuration() : this._totalDuration,
m = this._startTime,
_ = this._timeScale,
g = this._paused;
if (d !== this._time && (t += this._time - d), this._hasPause && !this._forcingPlayhead && !e) {
if (t > d)
for (r = this._first; r && r._startTime <= t && !h;) r._duration || "isPause" !== r.data || r.ratio || 0 === r._startTime && 0 === this._rawPrevTime || (h = r), r = r._next;
else
for (r = this._last; r && r._startTime >= t && !h;) r._duration || "isPause" === r.data && r._rawPrevTime > 0 && (h = r), r = r._prev;
h && (this._time = this._totalTime = t = h._startTime, f = this._startTime + (this._reversed ? this._duration - t : t) / this._timeScale)
}
if (t >= p - 1e-8 && t >= 0) this._totalTime = this._time = p, this._reversed || this._hasPausedChild() || (n = !0, l = "onComplete", u = !!this._timeline.autoRemoveChildren, 0 === this._duration && (t <= 0 && t >= -1e-8 || this._rawPrevTime < 0 || 1e-8 === this._rawPrevTime) && this._rawPrevTime !== t && this._first && (u = !0, this._rawPrevTime > 1e-8 && (l = "onReverseComplete"))), this._rawPrevTime = this._duration || !e || t || this._rawPrevTime === t ? t : 1e-8, t = p + 1e-4;
else if (t < 1e-8)
if (this._totalTime = this._time = 0, t > -1e-8 && (t = 0), (0 !== d || 0 === this._duration && 1e-8 !== this._rawPrevTime && (this._rawPrevTime > 0 || t < 0 && this._rawPrevTime >= 0)) && (l = "onReverseComplete", n = this._reversed), t < 0) this._active = !1, this._timeline.autoRemoveChildren && this._reversed ? (u = n = !0, l = "onReverseComplete") : this._rawPrevTime >= 0 && this._first && (u = !0), this._rawPrevTime = t;
else {
if (this._rawPrevTime = this._duration || !e || t || this._rawPrevTime === t ? t : 1e-8, 0 === t && n)
for (r = this._first; r && 0 === r._startTime;) r._duration || (n = !1), r = r._next;
t = 0, this._initted || (u = !0)
}
else this._totalTime = this._time = this._rawPrevTime = t;
if (this._time !== d && this._first || i || u || h) {
if (this._initted || (this._initted = !0), this._active || !this._paused && this._time !== d && t > 0 && (this._active = !0), 0 === d && this.vars.onStart && (0 === this._time && this._duration || e || this._callback("onStart")), (c = this._time) >= d)
for (r = this._first; r && (s = r._next, c === this._time && (!this._paused || g));)(r._active || r._startTime <= c && !r._paused && !r._gc) && (h === r && (this.pause(), this._pauseTime = f), r._reversed ? r.render((r._dirty ? r.totalDuration() : r._totalDuration) - (t - r._startTime) * r._timeScale, e, i) : r.render((t - r._startTime) * r._timeScale, e, i)), r = s;
else
for (r = this._last; r && (s = r._prev, c === this._time && (!this._paused || g));) {
if (r._active || r._startTime <= d && !r._paused && !r._gc) {
if (h === r) {
for (h = r._prev; h && h.endTime() > this._time;) h.render(h._reversed ? h.totalDuration() - (t - h._startTime) * h._timeScale : (t - h._startTime) * h._timeScale, e, i), h = h._prev;
h = null, this.pause(), this._pauseTime = f
}
r._reversed ? r.render((r._dirty ? r.totalDuration() : r._totalDuration) - (t - r._startTime) * r._timeScale, e, i) : r.render((t - r._startTime) * r._timeScale, e, i)
}
r = s
}
this._onUpdate && (e || (a.length && o(), this._callback("onUpdate"))), l && (this._gc || m !== this._startTime && _ === this._timeScale || (0 === this._time || p >= this.totalDuration()) && (n && (a.length && o(), this._timeline.autoRemoveChildren && this._enabled(!1, !1), this._active = !1), !e && this.vars[l] && this._callback(l)))
}
}, p._hasPausedChild = function () {
for (var e = this._first; e;) {
if (e._paused || e instanceof t && e._hasPausedChild()) return !0;
e = e._next
}
return !1
}, p.getChildren = function (t, e, i, n) {
n = n || -9999999999;
for (var s = [], a = this._first, o = 0; a;) a._startTime < n || (a instanceof r.l ? !1 !== e && (s[o++] = a) : (!1 !== i && (s[o++] = a), !1 !== t && (o = (s = s.concat(a.getChildren(!0, e, i))).length))), a = a._next;
return s
}, p.getTweensOf = function (t, e) {
var i, n, s = this._gc,
a = [],
o = 0;
for (s && this._enabled(!0, !0), n = (i = r.l.getTweensOf(t)).length; --n > -1;)(i[n].timeline === this || e && this._contains(i[n])) && (a[o++] = i[n]);
return s && this._enabled(!1, !0), a
}, p.recent = function () {
return this._recent
}, p._contains = function (t) {
for (var e = t.timeline; e;) {
if (e === this) return !0;
e = e.timeline
}
return !1
}, p.shiftChildren = function (t, e, i) {
i = i || 0;
for (var r, n = this._first, s = this._labels; n;) n._startTime >= i && (n._startTime += t), n = n._next;
if (e)
for (r in s) s[r] >= i && (s[r] += t);
return this._uncache(!0)
}, p._kill = function (t, e) {
if (!t && !e) return this._enabled(!1, !1);
for (var i = e ? this.getTweensOf(e) : this.getChildren(!0, !0, !1), r = i.length, n = !1; --r > -1;) i[r]._kill(t, e) && (n = !0);
return n
}, p.clear = function (t) {
var e = this.getChildren(!1, !0, !0),
i = e.length;
for (this._time = this._totalTime = 0; --i > -1;) e[i]._enabled(!1, !1);
return !1 !== t && (this._labels = {}), this._uncache(!0)
}, p.invalidate = function () {
for (var t = this._first; t;) t.invalidate(), t = t._next;
return r.a.prototype.invalidate.call(this)
}, p._enabled = function (t, e) {
if (t === this._gc)
for (var i = this._first; i;) i._enabled(t, !0), i = i._next;
return r.i.prototype._enabled.call(this, t, e)
}, p.totalTime = function (t, e, i) {
this._forcingPlayhead = !0;
var n = r.a.prototype.totalTime.apply(this, arguments);
return this._forcingPlayhead = !1, n
}, p.duration = function (t) {
return arguments.length ? (0 !== this.duration() && 0 !== t && this.timeScale(this._duration / t), this) : (this._dirty && this.totalDuration(), this._duration)
}, p.totalDuration = function (t) {
if (!arguments.length) {
if (this._dirty) {
for (var e, i, r = 0, n = this._last, s = 999999999999; n;) e = n._prev, n._dirty && n.totalDuration(), n._startTime > s && this._sortChildren && !n._paused && !this._calculatingDuration ? (this._calculatingDuration = 1, this.add(n, n._startTime - n._delay), this._calculatingDuration = 0) : s = n._startTime, n._startTime < 0 && !n._paused && (r -= n._startTime, this._timeline.smoothChildTiming && (this._startTime += n._startTime / this._timeScale, this._time -= n._startTime, this._totalTime -= n._startTime, this._rawPrevTime -= n._startTime), this.shiftChildren(-n._startTime, !1, -9999999999), s = 0), (i = n._startTime + n._totalDuration / n._timeScale) > r && (r = i), n = e;
this._duration = this._totalDuration = r, this._dirty = !1
}
return this._totalDuration
}
return t && this.totalDuration() ? this.timeScale(this._totalDuration / t) : this
}, p.paused = function (t) {
if (!1 === t && this._paused)
for (var e = this._first; e;) e._startTime === this._time && "isPause" === e.data && (e._rawPrevTime = 0), e = e._next;
return r.a.prototype.paused.apply(this, arguments)
}, p.usesFrames = function () {
for (var t = this._timeline; t._timeline;) t = t._timeline;
return t === r.a._rootFramesTimeline
}, p.rawTime = function (t) {
return t && (this._paused || this._repeat && this.time() > 0 && this.totalProgress() < 1) ? this._totalTime % (this._duration + this._repeatDelay) : this._paused ? this._totalTime : (this._timeline.rawTime(t) - this._startTime) * this._timeScale
}, t
}, !0);
var f = r.m.TimelineLite;
/*!
* VERSION: 2.1.3
* DATE: 2019-05-17
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
*/
r.k._gsDefine("TimelineMax", ["TimelineLite", "TweenLite", "easing.Ease"], function () {
var t = function (t) {
f.call(this, t), this._repeat = this.vars.repeat || 0, this._repeatDelay = this.vars.repeatDelay || 0, this._cycle = 0, this._yoyo = !!this.vars.yoyo, this._dirty = !0
},
e = r.l._internals,
i = e.lazyTweens,
n = e.lazyRender,
s = r.k._gsDefine.globals,
a = new r.b(null, null, 1, 0),
o = t.prototype = new f;
return o.constructor = t, o.kill()._gc = !1, t.version = "2.1.3", o.invalidate = function () {
return this._yoyo = !!this.vars.yoyo, this._repeat = this.vars.repeat || 0, this._repeatDelay = this.vars.repeatDelay || 0, this._uncache(!0), f.prototype.invalidate.call(this)
}, o.addCallback = function (t, e, i, n) {
return this.add(r.l.delayedCall(0, t, i, n), e)
}, o.removeCallback = function (t, e) {
if (t)
if (null == e) this._kill(null, t);
else
for (var i = this.getTweensOf(t, !1), r = i.length, n = this._parseTimeOrLabel(e); --r > -1;) i[r]._startTime === n && i[r]._enabled(!1, !1);
return this
}, o.removePause = function (t) {
return this.removeCallback(f._internals.pauseCallback, t)
}, o.tweenTo = function (t, e) {
e = e || {};
var i, n, o, l = {
ease: a,
useFrames: this.usesFrames(),
immediateRender: !1,
lazy: !1
},
u = e.repeat && s.TweenMax || r.l;
for (n in e) l[n] = e[n];
return l.time = this._parseTimeOrLabel(t), i = Math.abs(Number(l.time) - this._time) / this._timeScale || .001, o = new u(this, i, l), l.onStart = function () {
o.target.paused(!0), o.vars.time === o.target.time() || i !== o.duration() || o.isFromTo || o.duration(Math.abs(o.vars.time - o.target.time()) / o.target._timeScale).render(o.time(), !0, !0), e.onStart && e.onStart.apply(e.onStartScope || e.callbackScope || o, e.onStartParams || [])
}, o
}, o.tweenFromTo = function (t, e, i) {
i = i || {}, t = this._parseTimeOrLabel(t), i.startAt = {
onComplete: this.seek,
onCompleteParams: [t],
callbackScope: this
}, i.immediateRender = !1 !== i.immediateRender;
var r = this.tweenTo(e, i);
return r.isFromTo = 1, r.duration(Math.abs(r.vars.time - t) / this._timeScale || .001)
}, o.render = function (t, e, r) {
this._gc && this._enabled(!0, !1);
var s, a, o, l, u, h, c, f, d, p = this._time,
m = this._dirty ? this.totalDuration() : this._totalDuration,
_ = this._duration,
g = this._totalTime,
v = this._startTime,
y = this._timeScale,
b = this._rawPrevTime,
w = this._paused,
x = this._cycle;
if (p !== this._time && (t += this._time - p), t >= m - 1e-8 && t >= 0) this._locked || (this._totalTime = m, this._cycle = this._repeat), this._reversed || this._hasPausedChild() || (a = !0, l = "onComplete", u = !!this._timeline.autoRemoveChildren, 0 === this._duration && (t <= 0 && t >= -1e-8 || b < 0 || 1e-8 === b) && b !== t && this._first && (u = !0, b > 1e-8 && (l = "onReverseComplete"))), this._rawPrevTime = this._duration || !e || t || this._rawPrevTime === t ? t : 1e-8, this._yoyo && 1 & this._cycle ? this._time = t = 0 : (this._time = _, t = _ + 1e-4);
else if (t < 1e-8)
if (this._locked || (this._totalTime = this._cycle = 0), this._time = 0, t > -1e-8 && (t = 0), (0 !== p || 0 === _ && 1e-8 !== b && (b > 0 || t < 0 && b >= 0) && !this._locked) && (l = "onReverseComplete", a = this._reversed), t < 0) this._active = !1, this._timeline.autoRemoveChildren && this._reversed ? (u = a = !0, l = "onReverseComplete") : b >= 0 && this._first && (u = !0), this._rawPrevTime = t;
else {
if (this._rawPrevTime = _ || !e || t || this._rawPrevTime === t ? t : 1e-8, 0 === t && a)
for (s = this._first; s && 0 === s._startTime;) s._duration || (a = !1), s = s._next;
t = 0, this._initted || (u = !0)
}
else 0 === _ && b < 0 && (u = !0), this._time = this._rawPrevTime = t, this._locked || (this._totalTime = t, 0 !== this._repeat && (h = _ + this._repeatDelay, this._cycle = this._totalTime / h >> 0, this._cycle && this._cycle === this._totalTime / h && g <= t && this._cycle--, this._time = this._totalTime - this._cycle * h, this._yoyo && 1 & this._cycle && (this._time = _ - this._time), this._time > _ ? (this._time = _, t = _ + 1e-4) : this._time < 0 ? this._time = t = 0 : t = this._time));
if (this._hasPause && !this._forcingPlayhead && !e) {
if ((t = this._time) > p || this._repeat && x !== this._cycle)
for (s = this._first; s && s._startTime <= t && !c;) s._duration || "isPause" !== s.data || s.ratio || 0 === s._startTime && 0 === this._rawPrevTime || (c = s), s = s._next;
else
for (s = this._last; s && s._startTime >= t && !c;) s._duration || "isPause" === s.data && s._rawPrevTime > 0 && (c = s), s = s._prev;
c && (d = this._startTime + (this._reversed ? this._duration - c._startTime : c._startTime) / this._timeScale, c._startTime < _ && (this._time = this._rawPrevTime = t = c._startTime, this._totalTime = t + this._cycle * (this._totalDuration + this._repeatDelay)))
}
if (this._cycle !== x && !this._locked) {
var T = this._yoyo && 0 != (1 & x),
k = T === (this._yoyo && 0 != (1 & this._cycle)),
P = this._totalTime,
O = this._cycle,
S = this._rawPrevTime,
C = this._time;
if (this._totalTime = x * _, this._cycle < x ? T = !T : this._totalTime += _, this._time = p, this._rawPrevTime = 0 === _ ? b - 1e-4 : b, this._cycle = x, this._locked = !0, p = T ? 0 : _, this.render(p, e, 0 === _), e || this._gc || this.vars.onRepeat && (this._cycle = O, this._locked = !1, this._callback("onRepeat")), p !== this._time) return;
if (k && (this._cycle = x, this._locked = !0, p = T ? _ + 1e-4 : -1e-4, this.render(p, !0, !1)), this._locked = !1, this._paused && !w) return;
this._time = C, this._totalTime = P, this._cycle = O, this._rawPrevTime = S
}
if (this._time !== p && this._first || r || u || c) {
if (this._initted || (this._initted = !0), this._active || !this._paused && this._totalTime !== g && t > 0 && (this._active = !0), 0 === g && this.vars.onStart && (0 === this._totalTime && this._totalDuration || e || this._callback("onStart")), (f = this._time) >= p)
for (s = this._first; s && (o = s._next, f === this._time && (!this._paused || w));)(s._active || s._startTime <= this._time && !s._paused && !s._gc) && (c === s && (this.pause(), this._pauseTime = d), s._reversed ? s.render((s._dirty ? s.totalDuration() : s._totalDuration) - (t - s._startTime) * s._timeScale, e, r) : s.render((t - s._startTime) * s._timeScale, e, r)), s = o;
else
for (s = this._last; s && (o = s._prev, f === this._time && (!this._paused || w));) {
if (s._active || s._startTime <= p && !s._paused && !s._gc) {
if (c === s) {
for (c = s._prev; c && c.endTime() > this._time;) c.render(c._reversed ? c.totalDuration() - (t - c._startTime) * c._timeScale : (t - c._startTime) * c._timeScale, e, r), c = c._prev;
c = null, this.pause(), this._pauseTime = d
}
s._reversed ? s.render((s._dirty ? s.totalDuration() : s._totalDuration) - (t - s._startTime) * s._timeScale, e, r) : s.render((t - s._startTime) * s._timeScale, e, r)
}
s = o
}
this._onUpdate && (e || (i.length && n(), this._callback("onUpdate"))), l && (this._locked || this._gc || v !== this._startTime && y === this._timeScale || (0 === this._time || m >= this.totalDuration()) && (a && (i.length && n(), this._timeline.autoRemoveChildren && this._enabled(!1, !1), this._active = !1), !e && this.vars[l] && this._callback(l)))
} else g !== this._totalTime && this._onUpdate && (e || this._callback("onUpdate"))
}, o.getActive = function (t, e, i) {
var r, n, s = [],
a = this.getChildren(t || null == t, e || null == t, !!i),
o = 0,
l = a.length;
for (r = 0; r < l; r++)(n = a[r]).isActive() && (s[o++] = n);
return s
}, o.getLabelAfter = function (t) {
t || 0 !== t && (t = this._time);
var e, i = this.getLabelsArray(),
r = i.length;
for (e = 0; e < r; e++)
if (i[e].time > t) return i[e].name;
return null
}, o.getLabelBefore = function (t) {
null == t && (t = this._time);
for (var e = this.getLabelsArray(), i = e.length; --i > -1;)
if (e[i].time < t) return e[i].name;
return null
}, o.getLabelsArray = function () {
var t, e = [],
i = 0;
for (t in this._labels) e[i++] = {
time: this._labels[t],
name: t
};
return e.sort(function (t, e) {
return t.time - e.time
}), e
}, o.invalidate = function () {
return this._locked = !1, f.prototype.invalidate.call(this)
}, o.progress = function (t, e) {
return arguments.length ? this.totalTime(this.duration() * (this._yoyo && 0 != (1 & this._cycle) ? 1 - t : t) + this._cycle * (this._duration + this._repeatDelay), e) : this._time / this.duration() || 0
}, o.totalProgress = function (t, e) {
return arguments.length ? this.totalTime(this.totalDuration() * t, e) : this._totalTime / this.totalDuration() || 0
}, o.totalDuration = function (t) {
return arguments.length ? -1 !== this._repeat && t ? this.timeScale(this.totalDuration() / t) : this : (this._dirty && (f.prototype.totalDuration.call(this), this._totalDuration = -1 === this._repeat ? 999999999999 : this._duration * (this._repeat + 1) + this._repeatDelay * this._repeat), this._totalDuration)
}, o.time = function (t, e) {
if (!arguments.length) return this._time;
this._dirty && this.totalDuration();
var i = this._duration,
r = this._cycle,
n = r * (i + this._repeatDelay);
return t > i && (t = i), this.totalTime(this._yoyo && 1 & r ? i - t + n : this._repeat ? t + n : t, e)
}, o.repeat = function (t) {
return arguments.length ? (this._repeat = t, this._uncache(!0)) : this._repeat
}, o.repeatDelay = function (t) {
return arguments.length ? (this._repeatDelay = t, this._uncache(!0)) : this._repeatDelay
}, o.yoyo = function (t) {
return arguments.length ? (this._yoyo = t, this) : this._yoyo
}, o.currentLabel = function (t) {
return arguments.length ? this.seek(t, !0) : this.getLabelBefore(this._time + 1e-8)
}, t
}, !0);
var d = r.m.TimelineMax,
p = 180 / Math.PI,
m = [],
_ = [],
g = [],
v = {},
y = r.k._gsDefine.globals,
b = function (t, e, i, r) {
i === r && (i = r - (r - e) / 1e6), t === e && (e = t + (i - t) / 1e6), this.a = t, this.b = e, this.c = i, this.d = r, this.da = r - t, this.ca = i - t, this.ba = e - t
},
w = function (t, e, i, r) {
var n = {
a: t
},
s = {},
a = {},
o = {
c: r
},
l = (t + e) / 2,
u = (e + i) / 2,
h = (i + r) / 2,
c = (l + u) / 2,
f = (u + h) / 2,
d = (f - c) / 8;
return n.b = l + (t - l) / 4, s.b = c + d, n.c = s.a = (n.b + s.b) / 2, s.c = a.a = (c + f) / 2, a.b = f - d, o.b = h + (r - h) / 4, a.c = o.a = (a.b + o.b) / 2, [n, s, a, o]
},
x = function (t, e, i, r, n) {
var s, a, o, l, u, h, c, f, d, p, v, y, b, x = t.length - 1,
T = 0,
k = t[0].a;
for (s = 0; s < x; s++) a = (u = t[T]).a, o = u.d, l = t[T + 1].d, n ? (v = m[s], b = ((y = _[s]) + v) * e * .25 / (r ? .5 : g[s] || .5), f = o - ((h = o - (o - a) * (r ? .5 * e : 0 !== v ? b / v : 0)) + (((c = o + (l - o) * (r ? .5 * e : 0 !== y ? b / y : 0)) - h) * (3 * v / (v + y) + .5) / 4 || 0))) : f = o - ((h = o - (o - a) * e * .5) + (c = o + (l - o) * e * .5)) / 2, h += f, c += f, u.c = d = h, u.b = 0 !== s ? k : k = u.a + .6 * (u.c - u.a), u.da = o - a, u.ca = d - a, u.ba = k - a, i ? (p = w(a, k, d, o), t.splice(T, 1, p[0], p[1], p[2], p[3]), T += 4) : T++, k = c;
(u = t[T]).b = k, u.c = k + .4 * (u.d - k), u.da = u.d - u.a, u.ca = u.c - u.a, u.ba = k - u.a, i && (p = w(u.a, k, u.c, u.d), t.splice(T, 1, p[0], p[1], p[2], p[3]))
},
T = function (t, e, i, r) {
var n, s, a, o, l, u, h = [];
if (r)
for (s = (t = [r].concat(t)).length; --s > -1;) "string" == typeof (u = t[s][e]) && "=" === u.charAt(1) && (t[s][e] = r[e] + Number(u.charAt(0) + u.substr(2)));
if ((n = t.length - 2) < 0) return h[0] = new b(t[0][e], 0, 0, t[0][e]), h;
for (s = 0; s < n; s++) a = t[s][e], o = t[s + 1][e], h[s] = new b(a, 0, 0, o), i && (l = t[s + 2][e], m[s] = (m[s] || 0) + (o - a) * (o - a), _[s] = (_[s] || 0) + (l - o) * (l - o));
return h[s] = new b(t[s][e], 0, 0, t[s + 1][e]), h
},
k = function (t, e, i, r, n, s) {
var a, o, l, u, h, c, f, d, p = {},
y = [],
b = s || t[0];
for (o in n = "string" == typeof n ? "," + n + "," : ",x,y,z,left,top,right,bottom,marginTop,marginLeft,marginRight,marginBottom,paddingLeft,paddingTop,paddingRight,paddingBottom,backgroundPosition,backgroundPosition_y,", null == e && (e = 1), t[0]) y.push(o);
if (t.length > 1) {
for (d = t[t.length - 1], f = !0, a = y.length; --a > -1;)
if (o = y[a], Math.abs(b[o] - d[o]) > .05) {
f = !1;
break
}
f && (t = t.concat(), s && t.unshift(s), t.push(t[1]), s = t[t.length - 3])
}
for (m.length = _.length = g.length = 0, a = y.length; --a > -1;) o = y[a], v[o] = -1 !== n.indexOf("," + o + ","), p[o] = T(t, o, v[o], s);
for (a = m.length; --a > -1;) m[a] = Math.sqrt(m[a]), _[a] = Math.sqrt(_[a]);
if (!r) {
for (a = y.length; --a > -1;)
if (v[o])
for (c = (l = p[y[a]]).length - 1, u = 0; u < c; u++) h = l[u + 1].da / _[u] + l[u].da / m[u] || 0, g[u] = (g[u] || 0) + h * h;
for (a = g.length; --a > -1;) g[a] = Math.sqrt(g[a])
}
for (a = y.length, u = i ? 4 : 1; --a > -1;) l = p[o = y[a]], x(l, e, i, r, v[o]), f && (l.splice(0, u), l.splice(l.length - u, u));
return p
},
P = function (t, e, i) {
for (var r, n, s, a, o, l, u, h, c, f, d, p = 1 / i, m = t.length; --m > -1;)
for (s = (f = t[m]).a, a = f.d - s, o = f.c - s, l = f.b - s, r = n = 0, h = 1; h <= i; h++) r = n - (n = ((u = p * h) * u * a + 3 * (c = 1 - u) * (u * o + c * l)) * u), e[d = m * i + h - 1] = (e[d] || 0) + r * r
},
O = r.k._gsDefine.plugin({
propName: "bezier",
priority: -1,
version: "1.3.9",
API: 2,
global: !0,
init: function (t, e, i) {
this._target = t, e instanceof Array && (e = {
values: e
}), this._func = {}, this._mod = {}, this._props = [], this._timeRes = null == e.timeResolution ? 6 : parseInt(e.timeResolution, 10);
var r, n, s, a, o, l = e.values || [],
u = {},
h = l[0],
c = e.autoRotate || i.vars.orientToBezier;
for (r in this._autoRotate = c ? c instanceof Array ? c : [
["x", "y", "rotation", !0 === c ? 0 : Number(c) || 0]
] : null, h) this._props.push(r);
for (s = this._props.length; --s > -1;) r = this._props[s], this._overwriteProps.push(r), n = this._func[r] = "function" == typeof t[r], u[r] = n ? t[r.indexOf("set") || "function" != typeof t["get" + r.substr(3)] ? r : "get" + r.substr(3)]() : parseFloat(t[r]), o || u[r] !== l[0][r] && (o = u);
if (this._beziers = "cubic" !== e.type && "quadratic" !== e.type && "soft" !== e.type ? k(l, isNaN(e.curviness) ? 1 : e.curviness, !1, "thruBasic" === e.type, e.correlate, o) : function (t, e, i) {
var r, n, s, a, o, l, u, h, c, f, d, p = {},
m = "cubic" === (e = e || "soft") ? 3 : 2,
_ = "soft" === e,
g = [];
if (_ && i && (t = [i].concat(t)), null == t || t.length < m + 1) throw "invalid Bezier data";
for (c in t[0]) g.push(c);
for (l = g.length; --l > -1;) {
for (p[c = g[l]] = o = [], f = 0, h = t.length, u = 0; u < h; u++) r = null == i ? t[u][c] : "string" == typeof (d = t[u][c]) && "=" === d.charAt(1) ? i[c] + Number(d.charAt(0) + d.substr(2)) : Number(d), _ && u > 1 && u < h - 1 && (o[f++] = (r + o[f - 2]) / 2), o[f++] = r;
for (h = f - m + 1, f = 0, u = 0; u < h; u += m) r = o[u], n = o[u + 1], s = o[u + 2], a = 2 === m ? 0 : o[u + 3], o[f++] = d = 3 === m ? new b(r, n, s, a) : new b(r, (2 * n + r) / 3, (2 * n + s) / 3, s);
o.length = f
}
return p
}(l, e.type, u), this._segCount = this._beziers[r].length, this._timeRes) {
var f = function (t, e) {
var i, r, n, s, a = [],
o = [],
l = 0,
u = 0,
h = (e = e >> 0 || 6) - 1,
c = [],
f = [];
for (i in t) P(t[i], a, e);
for (n = a.length, r = 0; r < n; r++) l += Math.sqrt(a[r]), f[s = r % e] = l, s === h && (u += l, c[s = r / e >> 0] = f, o[s] = u, l = 0, f = []);
return {
length: u,
lengths: o,
segments: c
}
}(this._beziers, this._timeRes);
this._length = f.length, this._lengths = f.lengths, this._segments = f.segments, this._l1 = this._li = this._s1 = this._si = 0, this._l2 = this._lengths[0], this._curSeg = this._segments[0], this._s2 = this._curSeg[0], this._prec = 1 / this._curSeg.length
}
if (c = this._autoRotate)
for (this._initialRotations = [], c[0] instanceof Array || (this._autoRotate = c = [c]), s = c.length; --s > -1;) {
for (a = 0; a < 3; a++) r = c[s][a], this._func[r] = "function" == typeof t[r] && t[r.indexOf("set") || "function" != typeof t["get" + r.substr(3)] ? r : "get" + r.substr(3)];
r = c[s][2], this._initialRotations[s] = (this._func[r] ? this._func[r].call(this._target) : this._target[r]) || 0, this._overwriteProps.push(r)
}
return this._startRatio = i.vars.runBackwards ? 1 : 0, !0
},
set: function (t) {
var e, i, r, n, s, a, o, l, u, h, c, f = this._segCount,
d = this._func,
m = this._target,
_ = t !== this._startRatio;
if (this._timeRes) {
if (u = this._lengths, h = this._curSeg, c = t * this._length, r = this._li, c > this._l2 && r < f - 1) {
for (l = f - 1; r < l && (this._l2 = u[++r]) <= c;);
this._l1 = u[r - 1], this._li = r, this._curSeg = h = this._segments[r], this._s2 = h[this._s1 = this._si = 0]
} else if (c < this._l1 && r > 0) {
for (; r > 0 && (this._l1 = u[--r]) >= c;);
0 === r && c < this._l1 ? this._l1 = 0 : r++, this._l2 = u[r], this._li = r, this._curSeg = h = this._segments[r], this._s1 = h[(this._si = h.length - 1) - 1] || 0, this._s2 = h[this._si]
}
if (e = r, c -= this._l1, r = this._si, c > this._s2 && r < h.length - 1) {
for (l = h.length - 1; r < l && (this._s2 = h[++r]) <= c;);
this._s1 = h[r - 1], this._si = r
} else if (c < this._s1 && r > 0) {
for (; r > 0 && (this._s1 = h[--r]) >= c;);
0 === r && c < this._s1 ? this._s1 = 0 : r++, this._s2 = h[r], this._si = r
}
a = 1 === t ? 1 : (r + (c - this._s1) / (this._s2 - this._s1)) * this._prec || 0
} else a = (t - (e = t < 0 ? 0 : t >= 1 ? f - 1 : f * t >> 0) * (1 / f)) * f;
for (i = 1 - a, r = this._props.length; --r > -1;) n = this._props[r], o = (a * a * (s = this._beziers[n][e]).da + 3 * i * (a * s.ca + i * s.ba)) * a + s.a, this._mod[n] && (o = this._mod[n](o, m)), d[n] ? m[n](o) : m[n] = o;
if (this._autoRotate) {
var g, v, y, b, w, x, T, k = this._autoRotate;
for (r = k.length; --r > -1;) n = k[r][2], x = k[r][3] || 0, T = !0 === k[r][4] ? 1 : p, s = this._beziers[k[r][0]], g = this._beziers[k[r][1]], s && g && (s = s[e], g = g[e], v = s.a + (s.b - s.a) * a, v += ((b = s.b + (s.c - s.b) * a) - v) * a, b += (s.c + (s.d - s.c) * a - b) * a, y = g.a + (g.b - g.a) * a, y += ((w = g.b + (g.c - g.b) * a) - y) * a, w += (g.c + (g.d - g.c) * a - w) * a, o = _ ? Math.atan2(w - y, b - v) * T + x : this._initialRotations[r], this._mod[n] && (o = this._mod[n](o, m)), d[n] ? m[n](o) : m[n] = o)
}
}
}),
S = O.prototype;
/*!
* VERSION: 1.3.9
* DATE: 2019-05-17
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
**/
O.bezierThrough = k, O.cubicToQuadratic = w, O._autoCSS = !0, O.quadraticToCubic = function (t, e, i) {
return new b(t, (2 * e + t) / 3, (2 * e + i) / 3, i)
}, O._cssRegister = function () {
var t = y.CSSPlugin;
if (t) {
var e = t._internals,
i = e._parseToProxy,
r = e._setPluginRatio,
n = e.CSSPropTween;
e._registerComplexSpecialProp("bezier", {
parser: function (t, e, s, a, o, l) {
e instanceof Array && (e = {
values: e
}), l = new O;
var u, h, c, f = e.values,
d = f.length - 1,
p = [],
m = {};
if (d < 0) return o;
for (u = 0; u <= d; u++) c = i(t, f[u], a, o, l, d !== u), p[u] = c.end;
for (h in e) m[h] = e[h];
return m.values = p, (o = new n(t, "bezier", 0, 0, c.pt, 2)).data = c, o.plugin = l, o.setRatio = r, 0 === m.autoRotate && (m.autoRotate = !0), !m.autoRotate || m.autoRotate instanceof Array || (u = !0 === m.autoRotate ? 0 : Number(m.autoRotate), m.autoRotate = null != c.end.left ? [
["left", "top", "rotation", u, !1]
] : null != c.end.x && [
["x", "y", "rotation", u, !1]
]), m.autoRotate && (a._transform || a._enableTransforms(!1), c.autoRotate = a._target._gsTransform, c.proxy.rotation = c.autoRotate.rotation || 0, a._overwriteProps.push("rotation")), l._onInitTween(c.proxy, m, a._tween), o
}
})
}
}, S._mod = function (t) {
for (var e, i = this._overwriteProps, r = i.length; --r > -1;)(e = t[i[r]]) && "function" == typeof e && (this._mod[i[r]] = e)
}, S._kill = function (t) {
var e, i, r = this._props;
for (e in this._beziers)
if (e in t)
for (delete this._beziers[e], delete this._func[e], i = r.length; --i > -1;) r[i] === e && r.splice(i, 1);
if (r = this._autoRotate)
for (i = r.length; --i > -1;) t[r[i][2]] && r.splice(i, 1);
return this._super._kill.call(this, t)
},
/*!
* VERSION: 1.16.1
* DATE: 2018-08-27
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
**/
r.k._gsDefine("easing.Back", ["easing.Ease"], function () {
var t, e, i, n, s = r.k.GreenSockGlobals || r.k,
a = s.com.greensock,
o = 2 * Math.PI,
l = Math.PI / 2,
u = a._class,
h = function (t, e) {
var i = u("easing." + t, function () { }, !0),
n = i.prototype = new r.b;
return n.constructor = i, n.getRatio = e, i
},
c = r.b.register || function () { },
f = function (t, e, i, r, n) {
var s = u("easing." + t, {
easeOut: new e,
easeIn: new i,
easeInOut: new r
}, !0);
return c(s, t), s
},
d = function (t, e, i) {
this.t = t, this.v = e, i && (this.next = i, i.prev = this, this.c = i.v - e, this.gap = i.t - t)
},
p = function (t, e) {
var i = u("easing." + t, function (t) {
this._p1 = t || 0 === t ? t : 1.70158, this._p2 = 1.525 * this._p1
}, !0),
n = i.prototype = new r.b;
return n.constructor = i, n.getRatio = e, n.config = function (t) {
return new i(t)
}, i
},
m = f("Back", p("BackOut", function (t) {
return (t -= 1) * t * ((this._p1 + 1) * t + this._p1) + 1
}), p("BackIn", function (t) {
return t * t * ((this._p1 + 1) * t - this._p1)
}), p("BackInOut", function (t) {
return (t *= 2) < 1 ? .5 * t * t * ((this._p2 + 1) * t - this._p2) : .5 * ((t -= 2) * t * ((this._p2 + 1) * t + this._p2) + 2)
})),
_ = u("easing.SlowMo", function (t, e, i) {
e = e || 0 === e ? e : .7, null == t ? t = .7 : t > 1 && (t = 1), this._p = 1 !== t ? e : 0, this._p1 = (1 - t) / 2, this._p2 = t, this._p3 = this._p1 + this._p2, this._calcEnd = !0 === i
}, !0),
g = _.prototype = new r.b;
return g.constructor = _, g.getRatio = function (t) {
var e = t + (.5 - t) * this._p;
return t < this._p1 ? this._calcEnd ? 1 - (t = 1 - t / this._p1) * t : e - (t = 1 - t / this._p1) * t * t * t * e : t > this._p3 ? this._calcEnd ? 1 === t ? 0 : 1 - (t = (t - this._p3) / this._p1) * t : e + (t - e) * (t = (t - this._p3) / this._p1) * t * t * t : this._calcEnd ? 1 : e
}, _.ease = new _(.7, .7), g.config = _.config = function (t, e, i) {
return new _(t, e, i)
}, (g = (t = u("easing.SteppedEase", function (t, e) {
t = t || 1, this._p1 = 1 / t, this._p2 = t + (e ? 0 : 1), this._p3 = e ? 1 : 0
}, !0)).prototype = new r.b).constructor = t, g.getRatio = function (t) {
return t < 0 ? t = 0 : t >= 1 && (t = .999999999), ((this._p2 * t | 0) + this._p3) * this._p1
}, g.config = t.config = function (e, i) {
return new t(e, i)
}, (g = (e = u("easing.ExpoScaleEase", function (t, e, i) {
this._p1 = Math.log(e / t), this._p2 = e - t, this._p3 = t, this._ease = i
}, !0)).prototype = new r.b).constructor = e, g.getRatio = function (t) {
return this._ease && (t = this._ease.getRatio(t)), (this._p3 * Math.exp(this._p1 * t) - this._p3) / this._p2
}, g.config = e.config = function (t, i, r) {
return new e(t, i, r)
}, (g = (i = u("easing.RoughEase", function (t) {
for (var e, i, n, s, a, o, l = (t = t || {}).taper || "none", u = [], h = 0, c = 0 | (t.points || 20), f = c, p = !1 !== t.randomize, m = !0 === t.clamp, _ = t.template instanceof r.b ? t.template : null, g = "number" == typeof t.strength ? .4 * t.strength : .4; --f > -1;) e = p ? Math.random() : 1 / c * f, i = _ ? _.getRatio(e) : e, n = "none" === l ? g : "out" === l ? (s = 1 - e) * s * g : "in" === l ? e * e * g : e < .5 ? (s = 2 * e) * s * .5 * g : (s = 2 * (1 - e)) * s * .5 * g, p ? i += Math.random() * n - .5 * n : f % 2 ? i += .5 * n : i -= .5 * n, m && (i > 1 ? i = 1 : i < 0 && (i = 0)), u[h++] = {
x: e,
y: i
};
for (u.sort(function (t, e) {
return t.x - e.x
}), o = new d(1, 1, null), f = c; --f > -1;) a = u[f], o = new d(a.x, a.y, o);
this._prev = new d(0, 0, 0 !== o.t ? o : o.next)
}, !0)).prototype = new r.b).constructor = i, g.getRatio = function (t) {
var e = this._prev;
if (t > e.t) {
for (; e.next && t >= e.t;) e = e.next;
e = e.prev
} else
for (; e.prev && t <= e.t;) e = e.prev;
return this._prev = e, e.v + (t - e.t) / e.gap * e.c
}, g.config = function (t) {
return new i(t)
}, i.ease = new i, f("Bounce", h("BounceOut", function (t) {
return t < 1 / 2.75 ? 7.5625 * t * t : t < 2 / 2.75 ? 7.5625 * (t -= 1.5 / 2.75) * t + .75 : t < 2.5 / 2.75 ? 7.5625 * (t -= 2.25 / 2.75) * t + .9375 : 7.5625 * (t -= 2.625 / 2.75) * t + .984375
}), h("BounceIn", function (t) {
return (t = 1 - t) < 1 / 2.75 ? 1 - 7.5625 * t * t : t < 2 / 2.75 ? 1 - (7.5625 * (t -= 1.5 / 2.75) * t + .75) : t < 2.5 / 2.75 ? 1 - (7.5625 * (t -= 2.25 / 2.75) * t + .9375) : 1 - (7.5625 * (t -= 2.625 / 2.75) * t + .984375)
}), h("BounceInOut", function (t) {
var e = t < .5;
return (t = e ? 1 - 2 * t : 2 * t - 1) < 1 / 2.75 ? t *= 7.5625 * t : t = t < 2 / 2.75 ? 7.5625 * (t -= 1.5 / 2.75) * t + .75 : t < 2.5 / 2.75 ? 7.5625 * (t -= 2.25 / 2.75) * t + .9375 : 7.5625 * (t -= 2.625 / 2.75) * t + .984375, e ? .5 * (1 - t) : .5 * t + .5
})), f("Circ", h("CircOut", function (t) {
return Math.sqrt(1 - (t -= 1) * t)
}), h("CircIn", function (t) {
return -(Math.sqrt(1 - t * t) - 1)
}), h("CircInOut", function (t) {
return (t *= 2) < 1 ? -.5 * (Math.sqrt(1 - t * t) - 1) : .5 * (Math.sqrt(1 - (t -= 2) * t) + 1)
})), f("Elastic", (n = function (t, e, i) {
var n = u("easing." + t, function (t, e) {
this._p1 = t >= 1 ? t : 1, this._p2 = (e || i) / (t < 1 ? t : 1), this._p3 = this._p2 / o * (Math.asin(1 / this._p1) || 0), this._p2 = o / this._p2
}, !0),
s = n.prototype = new r.b;
return s.constructor = n, s.getRatio = e, s.config = function (t, e) {
return new n(t, e)
}, n
})("ElasticOut", function (t) {
return this._p1 * Math.pow(2, -10 * t) * Math.sin((t - this._p3) * this._p2) + 1
}, .3), n("ElasticIn", function (t) {
return -this._p1 * Math.pow(2, 10 * (t -= 1)) * Math.sin((t - this._p3) * this._p2)
}, .3), n("ElasticInOut", function (t) {
return (t *= 2) < 1 ? this._p1 * Math.pow(2, 10 * (t -= 1)) * Math.sin((t - this._p3) * this._p2) * -.5 : this._p1 * Math.pow(2, -10 * (t -= 1)) * Math.sin((t - this._p3) * this._p2) * .5 + 1
}, .45)), f("Expo", h("ExpoOut", function (t) {
return 1 - Math.pow(2, -10 * t)
}), h("ExpoIn", function (t) {
return Math.pow(2, 10 * (t - 1)) - .001
}), h("ExpoInOut", function (t) {
return (t *= 2) < 1 ? .5 * Math.pow(2, 10 * (t - 1)) : .5 * (2 - Math.pow(2, -10 * (t - 1)))
})), f("Sine", h("SineOut", function (t) {
return Math.sin(t * l)
}), h("SineIn", function (t) {
return 1 - Math.cos(t * l)
}), h("SineInOut", function (t) {
return -.5 * (Math.cos(Math.PI * t) - 1)
})), u("easing.EaseLookup", {
find: function (t) {
return r.b.map[t]
}
}, !0), c(s.SlowMo, "SlowMo", "ease,"), c(i, "RoughEase", "ease,"), c(t, "SteppedEase", "ease,"), m
}, !0);
var C = r.m.Back,
A = r.m.Elastic,
R = r.m.Bounce,
M = r.m.RoughEase,
I = r.m.SlowMo,
L = r.m.SteppedEase,
E = r.m.Circ,
D = r.m.Expo,
j = r.m.Sine,
z = r.m.ExpoScaleEase;
i.d(e, "TweenMax", function () {
return F
}), i.d(e, "default", function () {
return F
}), i.d(e, "TweenLite", function () {
return r.l
}), i.d(e, "TimelineLite", function () {
return f
}), i.d(e, "TimelineMax", function () {
return d
}), i.d(e, "CSSPlugin", function () {
return s
}), i.d(e, "AttrPlugin", function () {
return a
}), i.d(e, "BezierPlugin", function () {
return O
}), i.d(e, "DirectionalRotationPlugin", function () {
return c
}), i.d(e, "RoundPropsPlugin", function () {
return o
}), i.d(e, "TweenPlugin", function () {
return r.j
}), i.d(e, "Ease", function () {
return r.b
}), i.d(e, "Power0", function () {
return r.d
}), i.d(e, "Power1", function () {
return r.e
}), i.d(e, "Power2", function () {
return r.f
}), i.d(e, "Power3", function () {
return r.g
}), i.d(e, "Power4", function () {
return r.h
}), i.d(e, "Linear", function () {
return r.c
}), i.d(e, "Back", function () {
return C
}), i.d(e, "Elastic", function () {
return A
}), i.d(e, "Bounce", function () {
return R
}), i.d(e, "RoughEase", function () {
return M
}), i.d(e, "SlowMo", function () {
return I
}), i.d(e, "SteppedEase", function () {
return L
}), i.d(e, "Circ", function () {
return E
}), i.d(e, "Expo", function () {
return D
}), i.d(e, "Sine", function () {
return j
}), i.d(e, "ExpoScaleEase", function () {
return z
});
/*!
* VERSION: 2.1.3
* DATE: 2019-05-17
* UPDATES AND DOCS AT: http://greensock.com
*
* @license Copyright (c) 2008-2019, GreenSock. All rights reserved.
* This work is subject to the terms at http://greensock.com/standard-license or for
* Club GreenSock members, the software agreement that was issued with your membership.
*
* @author: Jack Doyle, jack@greensock.com
**/
var F = n;
F._autoActivated = [f, d, s, a, O, o, c, C, A, R, M, I, L, E, D, j, z]
}]);